Drug Information| Drug ID:   | NPD273 |
| Drug Name:   | Aprobarbital |
| Molecular Formula:   | C10H14N2O3 |
| Canonical SMILES:   | C=CCC1(C(C)C)C(=NC(=O)N=C1O)O |
| Standard InCHI:   | "InChI=1S/C10H14N2O3/c1-4-5-10(6(2)3)7(13)11-9(15)12-8(10)14/h4,6H,1,5H2,2-3H3,(H2,11,12,13,14,15)" |
| Standard InCHIKey:   | UORJNBVJVRLXMQ-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD273Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DAP001034 |
| DrugBank   | DB01352 |
| ChEMBL   | CHEMBL7863 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164754809 |
| KEGG Drug   | D00698 |
| PubChem CID   | 6464 |
| ChEBI   | 2791 |
| CAS Number   | 1977/2/1 |
| Molecular Weight   | 210.1 |
| ALogP   | 0.1711 |
| MLogP   | 2.01 |
| XLogP   | 2.134 |
| HDA   | 5 |
| HBD   | 2 |
| Rotatable Bonds   | 7 |
| TPSA   | 82.25 |
| RO5 Violation   | 0 |