NPASS drugs

Drug Information

Drug ID:	NPD267
Drug Name:	PSI-6130
Molecular Formula:	C10H14FN3O4
Canonical SMILES:	OC[C@H]1O[C@H]([C@]([C@@H]1O)(C)F)n1ccc(=N)nc1O
Standard InCHI:	"InChI=1S/C10H14FN3O4/c1-10(11)7(16)5(4-15)18-8(10)14-3-2-6(12)13-9(14)17/h2-3,5,7-8,15-16H,4H2,1H3,(H2,12,13,17)/t5-,7-,8-,10-/m1/s1"
Standard InCHIKey:	NYPIRLYMDJMKGW-VPCXQMTMSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD267

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	96067
0.1-0.2	114520
0.2-0.3	1103
0.3-0.4	28
0.4-0.5	15
0.5-0.6	3
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6538	NPC480848
Remote Similarity	0.6275	NPC62927
Remote Similarity	0.6154	NPC229249
Remote Similarity	0.6154	NPC140420
Remote Similarity	0.569	NPC280946
Remote Similarity	0.566	NPC487916
Remote Similarity	0.5424	NPC6166

Drug Structure

NPD267 OpenBabel08201723122D 22 23 0 0 1 0 0 0 0 0999 V2000 0.0076 1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4432 0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 0.8364 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9487 1.7024 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9706 1.4945 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6615 2.4456 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.0310 1.5409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3554 2.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7796 0.0933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6243 2.4544 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7677 3.4250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 3 2 0 0 0 0 2 6 1 0 0 0 0 3 14 1 0 0 0 0 4 15 1 0 0 0 0 5 4 1 6 0 0 0 5 7 1 0 0 0 0 5 18 1 0 0 0 0 6 12 2 0 0 0 0 6 13 1 0 0 0 0 7 10 1 1 0 0 0 7 16 1 0 0 0 0 8 10 1 6 0 0 0 8 14 1 0 0 0 0 8 18 1 0 0 0 0 9 13 2 0 0 0 0 9 14 1 0 0 0 0 9 17 1 0 0 0 0 10 1 1 6 0 0 0 10 11 1 0 0 0 0 12 19 1 0 0 0 0 15 20 1 0 0 0 0 16 21 1 0 0 0 0 17 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB004335
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	259.1
ALogP	-1.2433
MLogP	1.68
XLogP	0.534
HDA	7
HBD	4
Rotatable Bonds	7
TPSA	109.37
RO5 Violation	0