NPASS drugs

Drug Information

Drug ID:	NPD2647
Drug Name:	Binodenoson
Molecular Formula:	C17H25N7O4
Canonical SMILES:	OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(N/N=C/C1CCCCC1)nc2N
Standard InCHI:	"InChI=1S/C17H25N7O4/c18-14-11-15(22-17(21-14)23-20-6-9-4-2-1-3-5-9)24(8-19-11)16-13(27)12(26)10(7-25)28-16/h6,8-10,12-13,16,25-27H,1-5,7H2,(H3,18,21,22,23)/b20-6+/t10-,12-,13-,16-/m1/s1"
Standard InCHIKey:	XJFMHMFFBSOEPR-DNZQAUTHSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2647

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	121261
0.1-0.2	89477
0.2-0.3	664
0.3-0.4	254
0.4-0.5	66
0.5-0.6	15
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6324	NPC260084
Remote Similarity	0.6324	NPC257600
Remote Similarity	0.6324	NPC164665
Remote Similarity	0.5352	NPC156461
Remote Similarity	0.5352	NPC322476
Remote Similarity	0.5352	NPC107374
Remote Similarity	0.5352	NPC2499
Remote Similarity	0.5352	NPC532382
Remote Similarity	0.5352	NPC584269
Remote Similarity	0.5352	NPC600382
Remote Similarity	0.5352	NPC605359
Remote Similarity	0.5352	NPC609539
Remote Similarity	0.5352	NPC612067
Remote Similarity	0.5342	NPC269827
Remote Similarity	0.5342	NPC602648
Remote Similarity	0.5278	NPC589064
Remote Similarity	0.5278	NPC609036
Remote Similarity	0.5135	NPC189068

Drug Structure

NPD2647 OpenBabel08211702172D 34 37 0 0 1 0 0 0 0 0999 V2000 -5.1962 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9746 -3.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0685 -1.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9965 -3.0303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2533 -3.6994 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6127 -3.1994 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4048 -2.2213 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4752 -0.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0739 -1.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2836 -4.1893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3578 -4.6940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5263 -3.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5897 -2.1168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6145 -4.9324 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4512 -5.2817 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6308 -4.6007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 9 1 0 0 0 0 5 9 1 0 0 0 0 6 9 1 0 0 0 0 6 20 2 0 0 0 0 7 25 1 0 0 0 0 8 19 2 0 0 0 0 8 24 1 0 0 0 0 10 7 1 1 0 0 0 10 12 1 0 0 0 0 10 28 1 0 0 0 0 11 14 2 0 0 0 0 11 15 1 0 0 0 0 11 19 1 0 0 0 0 12 13 1 0 0 0 0 12 26 1 6 0 0 0 13 16 1 0 0 0 0 13 27 1 6 0 0 0 14 18 1 0 0 0 0 14 21 1 0 0 0 0 15 22 2 0 0 0 0 15 24 1 0 0 0 0 16 24 1 1 0 0 0 16 28 1 0 0 0 0 17 21 2 0 0 0 0 17 22 1 0 0 0 0 17 23 1 0 0 0 0 18 29 1 0 0 0 0 18 30 1 0 0 0 0 20 23 1 0 0 0 0 23 31 1 0 0 0 0 25 32 1 0 0 0 0 26 33 1 0 0 0 0 27 34 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB001763
DrugBank	DB04853
ChEMBL	CHEMBL1950554
IUPHAR/BPS
PharmaGKB
KEGG Drug	D03120
PubChem CID	9576912
ChEBI
CAS Number	144348-08-3

Drug Properties

Molecular Weight	391.2
ALogP	-3.2312
MLogP	2.12
XLogP	1.526
HDA	11
HBD	5
Rotatable Bonds	9
TPSA	163.93
RO5 Violation	1