Drug Information| Drug ID:   | NPD2646 |
| Drug Name:   | SDZ-WAG-994 |
| Molecular Formula:   | C17H25N5O4 |
| Canonical SMILES:   | CO[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2NC1CCCCC1)CO |
| Standard InCHI:   | "InChI=1S/C17H25N5O4/c1-25-14-13(24)11(7-23)26-17(14)22-9-20-12-15(18-8-19-16(12)22)21-10-5-3-2-4-6-10/h8-11,13-14,17,23-24H,2-7H2,1H3,(H,18,19,21)/t11-,13-,14-,17-/m1/s1" |
| Standard InCHIKey:   | JAKAFSGZUXCHLF-LSCFUAHRSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD2646Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6769 | NPC309832 |
| Remote Similarity | 0.6438 | NPC195140 |
| Remote Similarity | 0.5616 | NPC211025 |
| Remote Similarity | 0.5135 | NPC561547 |
| Remote Similarity | 0.5132 | NPC316865 |
| Remote Similarity | 0.5063 | NPC525371 |
| Molecular Weight   | 363.19 |
| ALogP   | -3.0315 |
| MLogP   | 2.34 |
| XLogP   | 0.499 |
| HDA   | 9 |
| HBD   | 3 |
| Rotatable Bonds   | 8 |
| TPSA   | 114.55 |
| RO5 Violation   | 0 |