Drug Information| Drug ID:   | NPD2569 |
| Drug Name:   | Cocaine |
| Molecular Formula:   | C17H21NO4 |
| Canonical SMILES:   | COC(=O)[C@H]1[C@H](C[C@H]2N([C@@H]1CC2)C)OC(=O)c1ccccc1 |
| Standard InCHI:   | "InChI=1S/C17H21NO4/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/t12-,13+,14-,15+/m0/s1" |
| Standard InCHIKey:   | ZPUCINDJVBIVPJ-LJISPDSOSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD2569Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC508378 |
| High Similarity | 1.0 | NPC599862 |
| Remote Similarity | 0.6364 | NPC597508 |
| Remote Similarity | 0.625 | NPC26285 |
| Remote Similarity | 0.625 | NPC551766 |
| Remote Similarity | 0.625 | NPC570472 |
| Remote Similarity | 0.625 | NPC609506 |
| Remote Similarity | 0.614 | NPC513958 |
| Remote Similarity | 0.614 | NPC596943 |
| Remote Similarity | 0.5167 | NPC253096 |
| Molecular Weight   | 303.15 |
| ALogP   | -1.1243 |
| MLogP   | 2.78 |
| XLogP   | 3.336 |
| HDA   | 5 |
| HBD   | 0 |
| Rotatable Bonds   | 7 |
| TPSA   | 55.84 |
| RO5 Violation   | 0 |