NPASS drugs

Drug Information

Drug ID:	NPD2567
Drug Name:	Cocaine Hydrochloride
Molecular Formula:	C17H21NO4.ClH
Canonical SMILES:	COC(=O)[C@H]1[C@H](C[C@H]2N([C@@H]1CC2)C)OC(=O)c1ccccc1.Cl
Standard InCHI:	"InChI=1S/C17H21NO4.ClH/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11;/h3-7,12-15H,8-10H2,1-2H3;1H/t12-,13+,14-,15+;/m0./s1"
Standard InCHIKey:	PIQVDUKEQYOJNR-VZXSFKIWSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2567

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	97686
0.1-0.2	108321
0.2-0.3	5335
0.3-0.4	339
0.4-0.5	49
0.5-0.6	1
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9773	NPC508378
High Similarity	0.9773	NPC599862
Remote Similarity	0.625	NPC597508
Remote Similarity	0.6122	NPC26285
Remote Similarity	0.6122	NPC551766
Remote Similarity	0.6122	NPC570472
Remote Similarity	0.6122	NPC609506
Remote Similarity	0.6034	NPC513958
Remote Similarity	0.6034	NPC596943
Remote Similarity	0.5082	NPC253096

Drug Structure

NPD2567 OpenBabel08211702172D 23 24 0 0 1 0 0 0 0 0999 V2000 2.0481 -3.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3109 -0.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5524 -1.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7224 -1.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5524 -2.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8923 -1.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7224 -3.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0400 -5.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4767 -4.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6280 -4.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8923 -2.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9974 -5.1767 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7316 -3.4344 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4569 -3.5120 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6129 -3.0579 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0623 -3.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6560 -2.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6604 -4.0906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0623 -4.3862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5935 -1.9012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0147 -1.3882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2323 -2.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1087 -2.1251 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 21 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 11 2 0 0 0 0 7 11 1 0 0 0 0 8 9 1 0 0 0 0 10 12 1 0 0 0 0 10 14 1 0 0 0 0 11 16 1 0 0 0 0 12 8 1 6 0 0 0 12 18 1 0 0 0 0 13 9 1 6 0 0 0 13 15 1 0 0 0 0 13 18 1 0 0 0 0 14 15 1 0 0 0 0 14 22 1 1 0 0 0 15 17 1 1 0 0 0 16 19 2 0 0 0 0 16 22 1 0 0 0 0 17 20 2 0 0 0 0 17 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	303.15
ALogP	-1.1243
MLogP	2.78
XLogP	3.336
HDA	5
HBD	0
Rotatable Bonds	7
TPSA	55.84
RO5 Violation	0