NPASS drugs

Drug Information

Drug ID:	NPD2567
Drug Name:	Cocaine Hydrochloride
Molecular Formula:	C17H21NO4.ClH
Canonical SMILES:	COC(=O)[C@H]1[C@H](C[C@H]2N([C@@H]1CC2)C)OC(=O)c1ccccc1.Cl
Standard InCHI:	InChI=1S/C17H21NO4.ClH/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11;/h3-7,12-15H,8-10H2,1-2H3;1H/t12-,13+,14-,15+;/m0./s1
Standard InCHIKey:	PIQVDUKEQYOJNR-VZXSFKIWSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2567

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	114
0.1-0.2	653
0.2-0.3	1997
0.3-0.4	5780
0.4-0.5	9235
0.5-0.6	11356
0.6-0.7	1680
0.7-0.8	68
0.8-0.85	5
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC281104
High Similarity	0.8906	NPC26285
Intermediate Similarity	0.8195	NPC291027
Intermediate Similarity	0.8195	NPC317474
Intermediate Similarity	0.8195	NPC213126
Intermediate Similarity	0.8195	NPC84281
Intermediate Similarity	0.8195	NPC169485
Intermediate Similarity	0.7914	NPC69496
Intermediate Similarity	0.7908	NPC476443
Intermediate Similarity	0.7908	NPC133817

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD2567 OpenBabel08211702172D 23 24 0 0 1 0 0 0 0 0999 V2000 2.0481 -3.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3109 -0.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5524 -1.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7224 -1.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5524 -2.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8923 -1.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7224 -3.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0400 -5.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4767 -4.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6280 -4.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8923 -2.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9974 -5.1767 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7316 -3.4344 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4569 -3.5120 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6129 -3.0579 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0623 -3.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6560 -2.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6604 -4.0906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0623 -4.3862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5935 -1.9012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0147 -1.3882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2323 -2.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1087 -2.1251 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 21 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 11 2 0 0 0 0 7 11 1 0 0 0 0 8 9 1 0 0 0 0 10 12 1 0 0 0 0 10 14 1 0 0 0 0 11 16 1 0 0 0 0 12 8 1 6 0 0 0 12 18 1 0 0 0 0 13 9 1 6 0 0 0 13 15 1 0 0 0 0 13 18 1 0 0 0 0 14 15 1 0 0 0 0 14 22 1 1 0 0 0 15 17 1 1 0 0 0 16 19 2 0 0 0 0 16 22 1 0 0 0 0 17 20 2 0 0 0 0 17 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	303.15
ALogP	-1.1243
MLogP	2.78
XLogP	3.336
HDA	5
HBD	0
Rotatable Bonds	7
TPSA	55.84
RO5 Violation	0