Drug Information| Drug ID:   | NPD2546 |
| Drug Name:   | Riboflavin 5'-Phosphate |
| Molecular Formula:   | C17H21N4O9P |
| Canonical SMILES:   | O[C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)Cn1c2cc(C)c(cc2nc2c1nc(=O)nc2O)C |
| Standard InCHI:   | "InChI=1S/C17H21N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H,20,25,26)(H2,27,28,29)/t11-,12+,14-/m0/s1" |
| Standard InCHIKey:   | FVTCRASFADXXNN-SCRDCRAPSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2546Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC300631 |
| Intermediate Similarity | 0.7313 | NPC94167 |
| Remote Similarity | 0.6533 | NPC599782 |
| Remote Similarity | 0.6308 | NPC572908 |
| Remote Similarity | 0.5481 | NPC247668 |
| Remote Similarity | 0.5429 | NPC158055 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 456.1 |
| ALogP   | -2.1823 |
| MLogP   | 1.79 |
| XLogP   | -1.162 |
| HDA   | 13 |
| HBD   | 6 |
| Rotatable Bonds   | 15 |
| TPSA   | 214.88 |
| RO5 Violation   | 2 |