Drug Information| Drug ID:   | NPD2544 |
| Drug Name:   | |
| Molecular Formula:   | C17H21N4O8P |
| Canonical SMILES:   | O[C@@H]1[C@@H](COP2(=O)OCC[C@H](O2)c2ccncc2)O[C@H]([C@H]1O)n1ccc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C17H21N4O8P/c18-13-3-7-21(17(24)20-13)16-15(23)14(22)12(28-16)9-27-30(25)26-8-4-11(29-30)10-1-5-19-6-2-10/h1-3,5-7,11-12,14-16,22-23H,4,8-9H2,(H2,18,20,24)/t11-,12+,14+,15-,16+,30?/m0/s1" |
| Standard InCHIKey:   | HOAHIHGOMCBTFW-WUTQSZGESA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD2544Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5833 | NPC226769 |
| Remote Similarity | 0.5385 | NPC120887 |
| Remote Similarity | 0.5185 | NPC328779 |
| Remote Similarity | 0.5185 | NPC240517 |
| Remote Similarity | 0.5185 | NPC129 |
| Remote Similarity | 0.5172 | NPC328914 |
| Remote Similarity | 0.5143 | NPC62927 |
| TTD   | DNCL002574 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 44418783 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 440.11 |
| ALogP   | -2.3535 |
| MLogP   | 1.9 |
| XLogP   | -0.162 |
| HDA   | 12 |
| HBD   | 4 |
| Rotatable Bonds   | 8 |
| TPSA   | 176.83 |
| RO5 Violation   | 1 |