NPASS drugs

Drug Information

Drug ID:	NPD251
Drug Name:	Zidovudine
Molecular Formula:	C10H13N5O4
Canonical SMILES:	OC[C@H]1O[C@H](C[C@@H]1N=[N+]=[N-])n1cc(C)c(nc1=O)O
Standard InCHI:	"InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1"
Standard InCHIKey:	HBOMLICNUCNMMY-XLPZGREQSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD251

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	125933
0.1-0.2	85409
0.2-0.3	372
0.3-0.4	15
0.4-0.5	4
0.5-0.6	2
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC478793
Remote Similarity	0.6724	NPC171116
Remote Similarity	0.6622	NPC529039
Remote Similarity	0.614	NPC71339
Remote Similarity	0.6034	NPC117529
Remote Similarity	0.5424	NPC163352
Remote Similarity	0.5424	NPC210456

Drug Structure

NPD251 OpenBabel08201723122D 21 22 0 0 1 0 0 0 0 0999 V2000 -2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7796 -0.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3554 -2.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4487 -0.8364 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9487 -1.7024 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6188 -2.3499 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.4432 -0.7319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0310 -1.5409 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.3500 -2.7205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9706 -1.4945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7567 -3.6341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 2 6 1 0 0 0 0 3 5 2 0 0 0 0 3 15 1 0 0 0 0 4 16 1 0 0 0 0 5 9 1 0 0 0 0 6 7 1 0 0 0 0 6 13 1 6 0 0 0 7 4 1 1 0 0 0 7 19 1 0 0 0 0 8 2 1 1 0 0 0 8 15 1 0 0 0 0 8 19 1 0 0 0 0 9 12 2 0 0 0 0 9 17 1 0 0 0 0 10 12 1 0 0 0 0 10 15 1 0 0 0 0 10 18 2 0 0 0 0 11 14 2 0 0 0 0 13 14 2 0 0 0 0 16 20 1 0 0 0 0 17 21 1 0 0 0 0 M CHG 2 11 -1 14 1 M END $$$$

External Identifiers

TTD	DAP000701
DrugBank	DB00495
ChEMBL	CHEMBL129
IUPHAR/BPS	4825
PharmaGKB	PA451954
KEGG Drug	D00413
PubChem CID	35370
ChEBI	10110
CAS Number	30516-87-1

Drug Properties

Molecular Weight	267.1
ALogP	-3.889
MLogP	1.57
XLogP	-0.526
HDA	8
HBD	2
Rotatable Bonds	6
TPSA	94.72
RO5 Violation	0