Drug Information| Drug ID:   | NPD2436 |
| Drug Name:   | Carbenicillin Disodium |
| Molecular Formula:   | C17H18N2O6S.2Na |
| Canonical SMILES:   | [O-]C(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)C(c1ccccc1)C(=O)[O-].[Na+].[Na+] |
| Standard InCHI:   | "InChI=1S/C17H18N2O6S.2Na/c1-17(2)11(16(24)25)19-13(21)10(14(19)26-17)18-12(20)9(15(22)23)8-6-4-3-5-7-8;;/h3-7,9-11,14H,1-2H3,(H,18,20)(H,22,23)(H,24,25);;/q;2*+1/p-2/t9?,10-,11+,14-;;/m1../s1" |
| Standard InCHIKey:   | RTYJTGSCYUUYAL-YCAHSCEMSA-L |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2436Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7 | NPC485035 |
| Intermediate Similarity | 0.7 | NPC330588 |
| Intermediate Similarity | 0.7 | NPC469134 |
| Remote Similarity | 0.5909 | NPC468984 |
| Remote Similarity | 0.5846 | NPC90478 |
| Remote Similarity | 0.5286 | NPC487966 |
| Remote Similarity | 0.507 | NPC206980 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 376.07 |
| ALogP   | -1.6936 |
| MLogP   | 2.34 |
| XLogP   | 1.555 |
| HDA   | 8 |
| HBD   | 1 |
| Rotatable Bonds   | 10 |
| TPSA   | 158.46 |
| RO5 Violation   | 0 |