Drug Information| Drug ID:   | NPD2258 |
| Drug Name:   | Oseltamivir Phosphate |
| Molecular Formula:   | C16H28N2O4.H3O4P |
| Canonical SMILES:   | OP(=O)(O)O.CCOC(=O)C1=C[C@H]([C@@H]([C@H](C1)N)N=C(O)C)OC(CC)CC |
| Standard InCHI:   | "InChI=1S/C16H28N2O4.H3O4P/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19;1-5(2,3)4/h9,12-15H,5-8,17H2,1-4H3,(H,18,19);(H3,1,2,3,4)/t13-,14+,15+;/m0./s1" |
| Standard InCHIKey:   | PGZUMBJQJWIWGJ-ONAKXNSWSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2258Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 312.2 |
| ALogP   | -1.1666 |
| MLogP   | 2.56 |
| XLogP   | 1.536 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 94.14 |
| RO5 Violation   | 0 |