Drug Information| Drug ID:   | NPD225 |
| Drug Name:   | Sodium Phenylbutyrate |
| Molecular Formula:   | C10H12O2.Na |
| Canonical SMILES:   | [O-]C(=O)CCCc1ccccc1.[Na+] |
| Standard InCHI:   | "InChI=1S/C10H12O2.Na/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8H2,(H,11,12);/q;+1/p-1" |
| Standard InCHIKey:   | VPZRWNZGLKXFOE-UHFFFAOYSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD225Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | DB06819 |
| ChEMBL   | CHEMBL1469 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | D05868 |
| PubChem CID   | 0 |
| ChEBI   | 41500 |
| CAS Number   | 1821-12-1 |
| Molecular Weight   | 163.08 |
| ALogP   | -1.1084 |
| MLogP   | 2.34 |
| XLogP   | 3.737 |
| HDA   | 2 |
| HBD   | 0 |
| Rotatable Bonds   | 5 |
| TPSA   | 40.13 |
| RO5 Violation   | 0 |