Drug Information| Drug ID:   | NPD22 |
| Drug Name:   | Penicillin V Benzathine |
| Molecular Formula:   | 2C16H18N2O5S.C16H20N2 |
| Canonical SMILES:   | N(Cc1ccccc1)CCNCc1ccccc1.OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)COc1ccccc1.OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)COc1ccccc1 |
| Standard InCHI:   | "InChI=1S/2C16H18N2O5S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12+,14-;/m11./s1" |
| Standard InCHIKey:   | BBTOYUUSUQNIIY-ANPZCEIESA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD22Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 350.09 |
| ALogP   | -0.3094 |
| MLogP   | 2.34 |
| XLogP   | 1.739 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 124.73 |
| RO5 Violation   | 0 |