Drug Information| Drug ID:   | NPD217 |
| Drug Name:   | Inosine Pranobex |
| Molecular Formula:   | C10H12N4O5.3C9H9NO3.3C5H13NO |
| Canonical SMILES:   | CN(CC(O)C)C.CN(CC(O)C)C.CN(CC(O)C)C.CC(=Nc1ccc(cc1)C(=O)O)O.CC(=Nc1ccc(cc1)C(=O)O)O.CC(=Nc1ccc(cc1)C(=O)O)O.OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2O |
| Standard InCHI:   | "InChI=1S/C10H12N4O5.3C9H9NO3.3C5H13NO/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;3*1-6(11)10-8-4-2-7(3-5-8)9(12)13;3*1-5(7)4-6(2)3/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);3*2-5H,1H3,(H,10,11)(H,12,13);3*5,7H,4H2,1-3H3/t4-,6-,7-,10-;;;;;;/m1....../s1" |
| Standard InCHIKey:   | YLDCUKJMEKGGFI-QCSRICIXSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD217Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6164 | NPC54320 |
| Remote Similarity | 0.6164 | NPC79321 |
| Remote Similarity | 0.6164 | NPC546842 |
| Remote Similarity | 0.5119 | NPC261595 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 268.08 |
| ALogP   | -1.9895 |
| MLogP   | 1.57 |
| XLogP   | -1.742 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 6 |
| TPSA   | 133.75 |
| RO5 Violation   | 0 |