NPASS drugs

Drug Information

Drug ID:	NPD2148
Drug Name:
Molecular Formula:	C16H21N3O4S2
Canonical SMILES:	C[C@H]([C@H]1C(=O)N2[C@@H]1[C@@H](C)C(=C2C(=O)O)SC1CN(C1)C1=NCCS1)O
Standard InCHI:	InChI=1S/C16H21N3O4S2/c1-7-11-10(8(2)20)14(21)19(11)12(15(22)23)13(7)25-9-5-18(6-9)16-17-3-4-24-16/h7-11,20H,3-6H2,1-2H3,(H,22,23)/t7-,8-,10-,11-/m1/s1
Standard InCHIKey:	GXXLUDOKHXEFBQ-YJFSRANCSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2148

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	63
0.1-0.2	1066
0.2-0.3	18389
0.3-0.4	10097
0.4-0.5	1132
0.5-0.6	138
0.6-0.7	4
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.8235	NPC59249
Remote Similarity	0.619	NPC144780
Remote Similarity	0.6131	NPC288109
Remote Similarity	0.6	NPC470788
Remote Similarity	0.6	NPC188785
Remote Similarity	0.5918	NPC41162
Remote Similarity	0.5852	NPC296143
Remote Similarity	0.5704	NPC471259
Remote Similarity	0.5704	NPC476155
Remote Similarity	0.5704	NPC17581
Remote Similarity	0.5682	NPC474985
Remote Similarity	0.5639	NPC474873
Remote Similarity	0.562	NPC474099
Remote Similarity	0.5615	NPC117829
Remote Similarity	0.561	NPC475342
Remote Similarity	0.5603	NPC472536
Remote Similarity	0.5603	NPC50694
Remote Similarity	0.5603	NPC474984
Remote Similarity	0.5603	NPC103391

Drug Structure

NPD2148 OpenBabel08211701392D 27 30 0 0 1 0 0 0 0 0999 V2000 -1.4868 -1.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4960 -1.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1488 -2.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4417 -3.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0314 -0.4853 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4960 -1.5578 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -3.9960 -0.6918 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0300 -0.4330 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4502 1.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 0.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2548 0.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3978 2.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7071 -1.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6948 -1.5507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2888 0.5330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.9960 -2.4238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1208 0.7742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5068 2.5302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2365 2.6209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5507 -2.6948 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -2.9960 -2.4238 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1842 3.6195 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3 4 1 0 0 0 0 3 17 1 0 0 0 0 4 24 1 0 0 0 0 5 9 1 0 0 0 0 5 18 1 0 0 0 0 6 9 1 0 0 0 0 6 18 1 0 0 0 0 7 1 1 6 0 0 0 7 11 1 0 0 0 0 7 13 1 0 0 0 0 8 2 1 6 0 0 0 8 20 1 0 0 0 0 9 25 1 0 0 0 0 10 8 1 1 0 0 0 10 11 1 0 0 0 0 10 14 1 0 0 0 0 11 19 1 6 0 0 0 12 13 2 0 0 0 0 12 15 1 0 0 0 0 12 19 1 0 0 0 0 13 25 1 0 0 0 0 14 19 1 0 0 0 0 14 21 2 0 0 0 0 15 22 2 0 0 0 0 15 23 1 0 0 0 0 16 17 2 0 0 0 0 16 18 1 0 0 0 0 16 24 1 0 0 0 0 20 26 1 0 0 0 0 23 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL001015
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	9800194
ChEBI
CAS Number

Drug Properties

Molecular Weight	383.10
ALogP	-0.8267
MLogP	2.23
XLogP	0.726
HDA	7
HBD	2
Rotatable Bonds	9
TPSA	144.04
RO5 Violation	0