Drug Information| Drug ID:   | NPD2147 |
| Drug Name:   | |
| Molecular Formula:   | C16H21N3O4S |
| Canonical SMILES:   | N[C@@H](C(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)O)C1=CCC=CC1 |
| Standard InCHI:   | "InChI=1S/C16H21N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-4,7,9-11,14H,5-6,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1" |
| Standard InCHIKey:   | RPBAFSBGYDKNRG-NJBDSQKTSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD2147Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5522 | NPC117829 |
| Remote Similarity | 0.5211 | NPC206980 |
| Remote Similarity | 0.5147 | NPC330588 |
| Remote Similarity | 0.5143 | NPC468984 |
| TTD   | DNAP001655 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 71392 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 351.13 |
| ALogP   | 0.2631 |
| MLogP   | 2.34 |
| XLogP   | -2.251 |
| HDA   | 7 |
| HBD   | 3 |
| Rotatable Bonds   | 9 |
| TPSA   | 141.52 |
| RO5 Violation   | 0 |