Drug Information| Drug ID:   | NPD21 |
| Drug Name:   | Benzathine benzylpenicillin |
| Molecular Formula:   | 2C16H18N2O4S.C16H20N2 |
| Canonical SMILES:   | N(Cc1ccccc1)CCNCc1ccccc1.OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)Cc1ccccc1.OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)Cc1ccccc1 |
| Standard InCHI:   | "InChI=1S/2C16H18N2O4S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12+,14-;/m11./s1" |
| Standard InCHIKey:   | BVGLIYRKPOITBQ-ANPZCEIESA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD21Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7937 | NPC90478 |
| Remote Similarity | 0.5775 | NPC330588 |
| Remote Similarity | 0.5753 | NPC468984 |
| Remote Similarity | 0.5556 | NPC485035 |
| Remote Similarity | 0.5556 | NPC469134 |
| TTD   | |
| DrugBank   | DB09323 |
| ChEMBL   | CHEMBL3182097 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 51352 |
| CAS Number   | 1538-09-6 |
| Molecular Weight   | 334.1 |
| ALogP   | 0.0813 |
| MLogP   | 2.45 |
| XLogP   | 2.874 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 8 |
| TPSA   | 115.5 |
| RO5 Violation   | 0 |