NPASS drugs

Drug Information

Drug ID:	NPD2098
Drug Name:	Amoxicillin
Molecular Formula:	C16H19N3O5S
Canonical SMILES:	OC(=O)[C@@H]1N2C(=O)[C@H]([C@H]2SC1(C)C)N=C([C@@H](c1ccc(cc1)O)N)O
Standard InCHI:	"InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1"
Standard InCHIKey:	LSQZJLSUYDQPKJ-NJBDSQKTSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2098

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	68255
0.1-0.2	138242
0.2-0.3	5163
0.3-0.4	65
0.4-0.5	5
0.5-0.6	7
0.6-0.7	1
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC206980
Intermediate Similarity	0.8276	NPC468984
Remote Similarity	0.6349	NPC330588
Remote Similarity	0.5758	NPC90478
Remote Similarity	0.5735	NPC611431
Remote Similarity	0.5294	NPC117829
Remote Similarity	0.5211	NPC487966
Remote Similarity	0.5147	NPC485035
Remote Similarity	0.5147	NPC469134
Remote Similarity	0.507	NPC13470

Drug Structure

NPD2098 OpenBabel08211701392D 30 32 0 0 1 0 0 0 0 0999 V2000 3.4049 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4049 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8284 -3.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7944 -3.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1213 -3.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1554 -3.3801 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9511 0.3090 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4483 -2.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8966 -4.3461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.0191 -2.3449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5176 -2.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2382 1.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5909 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9511 -1.3090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.6037 -5.0532 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0694 -4.6049 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2779 -1.3789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7765 -3.8978 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6128 1.7953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 16 1 0 0 0 0 3 5 1 0 0 0 0 3 7 2 0 0 0 0 4 6 2 0 0 0 0 4 7 1 0 0 0 0 5 8 2 0 0 0 0 6 8 1 0 0 0 0 7 9 1 0 0 0 0 8 20 1 0 0 0 0 9 12 1 6 0 0 0 9 17 1 0 0 0 0 10 13 1 0 0 0 0 10 14 1 0 0 0 0 10 18 1 6 0 0 0 11 15 1 1 0 0 0 11 16 1 0 0 0 0 11 19 1 0 0 0 0 12 18 2 3 0 0 0 12 21 1 0 0 0 0 13 19 1 0 0 0 0 13 22 2 0 0 0 0 14 19 1 0 0 0 0 14 25 1 6 0 0 0 15 23 2 0 0 0 0 15 24 1 0 0 0 0 16 25 1 0 0 0 0 17 26 1 0 0 0 0 17 27 1 0 0 0 0 20 28 1 0 0 0 0 21 29 1 0 0 0 0 24 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000443
DrugBank	DB01060
ChEMBL	CHEMBL1082
IUPHAR/BPS
PharmaGKB	PA448406
KEGG Drug	D07452
PubChem CID	33613
ChEBI	2676
CAS Number	26787-78-0

Drug Properties

Molecular Weight	365.1
ALogP	-1.3208
MLogP	2.23
XLogP	-2.141
HDA	7
HBD	4
Rotatable Bonds	10
TPSA	161.75
RO5 Violation	0