NPASS drugs

Drug Information

Drug ID:	NPD2098
Drug Name:	Amoxicillin
Molecular Formula:	C16H19N3O5S
Canonical SMILES:	OC(=O)[C@@H]1N2C(=O)[C@H]([C@H]2SC1(C)C)N=C([C@@H](c1ccc(cc1)O)N)O
Standard InCHI:	InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1
Standard InCHIKey:	LSQZJLSUYDQPKJ-NJBDSQKTSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2098

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	132
0.1-0.2	1178
0.2-0.3	7306
0.3-0.4	5740
0.4-0.5	12750
0.5-0.6	3234
0.6-0.7	441
0.7-0.8	104
0.8-0.85	3
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9295	NPC315388
High Similarity	0.8792	NPC468984
Intermediate Similarity	0.8333	NPC13470
Intermediate Similarity	0.8086	NPC323336
Intermediate Similarity	0.8086	NPC326349
Intermediate Similarity	0.7862	NPC83790
Intermediate Similarity	0.7862	NPC128237
Intermediate Similarity	0.7861	NPC153554
Intermediate Similarity	0.7798	NPC61004
Intermediate Similarity	0.7771	NPC476989

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD2098 OpenBabel08211701392D 30 32 0 0 1 0 0 0 0 0999 V2000 3.4049 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4049 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8284 -3.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7944 -3.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1213 -3.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1554 -3.3801 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9511 0.3090 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4483 -2.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8966 -4.3461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.0191 -2.3449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5176 -2.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2382 1.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5909 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9511 -1.3090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.6037 -5.0532 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0694 -4.6049 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2779 -1.3789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7765 -3.8978 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6128 1.7953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 16 1 0 0 0 0 3 5 1 0 0 0 0 3 7 2 0 0 0 0 4 6 2 0 0 0 0 4 7 1 0 0 0 0 5 8 2 0 0 0 0 6 8 1 0 0 0 0 7 9 1 0 0 0 0 8 20 1 0 0 0 0 9 12 1 6 0 0 0 9 17 1 0 0 0 0 10 13 1 0 0 0 0 10 14 1 0 0 0 0 10 18 1 6 0 0 0 11 15 1 1 0 0 0 11 16 1 0 0 0 0 11 19 1 0 0 0 0 12 18 2 3 0 0 0 12 21 1 0 0 0 0 13 19 1 0 0 0 0 13 22 2 0 0 0 0 14 19 1 0 0 0 0 14 25 1 6 0 0 0 15 23 2 0 0 0 0 15 24 1 0 0 0 0 16 25 1 0 0 0 0 17 26 1 0 0 0 0 17 27 1 0 0 0 0 20 28 1 0 0 0 0 21 29 1 0 0 0 0 24 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000443
DrugBank	DB01060
ChEMBL	CHEMBL1082
IUPHAR/BPS
PharmaGKB	PA448406
KEGG Drug	D07452
PubChem CID	33613
ChEBI	2676
CAS Number	26787-78-0

Drug Properties

Molecular Weight	365.10
ALogP	-1.3208
MLogP	2.23
XLogP	-2.141
HDA	7
HBD	4
Rotatable Bonds	10
TPSA	161.75
RO5 Violation	0