NPASS drugs

Drug Information

Drug ID:	NPD2055
Drug Name:	Temocillin
Molecular Formula:	C16H18N2O7S2
Canonical SMILES:	CO[C@@]1(N=C(C(c2cscc2)C(=O)O)O)C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C
Standard InCHI:	InChI=1S/C16H18N2O7S2/c1-15(2)9(12(22)23)18-13(24)16(25-3,14(18)27-15)17-10(19)8(11(20)21)7-4-5-26-6-7/h4-6,8-9,14H,1-3H3,(H,17,19)(H,20,21)(H,22,23)/t8?,9-,14+,16-/m0/s1
Standard InCHIKey:	BVCKFLJARNKCSS-DWPRYXJFSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2055

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	106
0.1-0.2	1173
0.2-0.3	7503
0.3-0.4	19783
0.4-0.5	1938
0.5-0.6	333
0.6-0.7	54
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6943	NPC468984
Remote Similarity	0.6724	NPC317362
Remote Similarity	0.6724	NPC318930
Remote Similarity	0.6629	NPC317725
Remote Similarity	0.6629	NPC326407
Remote Similarity	0.6564	NPC145113
Remote Similarity	0.6524	NPC105717
Remote Similarity	0.6467	NPC122427
Remote Similarity	0.6442	NPC322878
Remote Similarity	0.6438	NPC92784
Remote Similarity	0.6438	NPC470884
Remote Similarity	0.6438	NPC476133
Remote Similarity	0.6438	NPC89489
Remote Similarity	0.6438	NPC178662
Remote Similarity	0.6438	NPC98424
Remote Similarity	0.6398	NPC165538
Remote Similarity	0.6386	NPC283783
Remote Similarity	0.6378	NPC329961
Remote Similarity	0.6375	NPC471265
Remote Similarity	0.6375	NPC471264
Remote Similarity	0.6369	NPC286551
Remote Similarity	0.6364	NPC329761
Remote Similarity	0.6364	NPC225648
Remote Similarity	0.6358	NPC269398
Remote Similarity	0.6358	NPC263493
Remote Similarity	0.6325	NPC240848
Remote Similarity	0.631	NPC162104
Remote Similarity	0.6287	NPC13470
Remote Similarity	0.6242	NPC5620
Remote Similarity	0.6242	NPC209509
Remote Similarity	0.6203	NPC300315
Remote Similarity	0.6196	NPC307357
Remote Similarity	0.6196	NPC268841
Remote Similarity	0.6196	NPC46098
Remote Similarity	0.6173	NPC68865
Remote Similarity	0.6158	NPC239660
Remote Similarity	0.6158	NPC106235
Remote Similarity	0.6145	NPC313867
Remote Similarity	0.6145	NPC316008
Remote Similarity	0.6108	NPC314358
Remote Similarity	0.6095	NPC129666
Remote Similarity	0.6084	NPC314388
Remote Similarity	0.6084	NPC476978
Remote Similarity	0.6084	NPC315283
Remote Similarity	0.608	NPC14877
Remote Similarity	0.608	NPC475350
Remote Similarity	0.608	NPC145178
Remote Similarity	0.6054	NPC161143
Remote Similarity	0.6049	NPC248283
Remote Similarity	0.6036	NPC471820
Remote Similarity	0.6036	NPC471821
Remote Similarity	0.6024	NPC161069
Remote Similarity	0.6024	NPC139326
Remote Similarity	0.6012	NPC262077
Remote Similarity	0.599	NPC251036
Remote Similarity	0.5976	NPC127741
Remote Similarity	0.5976	NPC128237
Remote Similarity	0.5976	NPC83790
Remote Similarity	0.5963	NPC130309
Remote Similarity	0.5952	NPC471680
Remote Similarity	0.5946	NPC190955
Remote Similarity	0.5924	NPC6975
Remote Similarity	0.5893	NPC52748
Remote Similarity	0.589	NPC287401
Remote Similarity	0.5882	NPC138775
Remote Similarity	0.5858	NPC315266
Remote Similarity	0.5856	NPC315388
Remote Similarity	0.5852	NPC297145
Remote Similarity	0.5852	NPC197743
Remote Similarity	0.5842	NPC4910
Remote Similarity	0.5833	NPC200964
Remote Similarity	0.5833	NPC176226
Remote Similarity	0.582	NPC96016
Remote Similarity	0.5814	NPC2501
Remote Similarity	0.5808	NPC239762
Remote Similarity	0.5808	NPC163392
Remote Similarity	0.5808	NPC476259
Remote Similarity	0.5798	NPC470903
Remote Similarity	0.5798	NPC470112
Remote Similarity	0.5798	NPC167763
Remote Similarity	0.5796	NPC202521
Remote Similarity	0.5793	NPC471097
Remote Similarity	0.5793	NPC475149
Remote Similarity	0.5779	NPC239357
Remote Similarity	0.5778	NPC472923
Remote Similarity	0.5776	NPC319766
Remote Similarity	0.5774	NPC469427
Remote Similarity	0.5774	NPC469426
Remote Similarity	0.5765	NPC201244
Remote Similarity	0.5765	NPC477217
Remote Similarity	0.5759	NPC252878
Remote Similarity	0.5759	NPC329731
Remote Similarity	0.575	NPC143325
Remote Similarity	0.5732	NPC302169
Remote Similarity	0.5732	NPC246079
Remote Similarity	0.5732	NPC476990
Remote Similarity	0.5723	NPC46427
Remote Similarity	0.5722	NPC475421
Remote Similarity	0.5714	NPC122590
Remote Similarity	0.5706	NPC200589
Remote Similarity	0.5698	NPC135121
Remote Similarity	0.568	NPC168113
Remote Similarity	0.5672	NPC75498
Remote Similarity	0.5668	NPC475196
Remote Similarity	0.5663	NPC59827
Remote Similarity	0.5663	NPC184933
Remote Similarity	0.5655	NPC475791
Remote Similarity	0.5655	NPC13175
Remote Similarity	0.5647	NPC77905
Remote Similarity	0.5647	NPC197682
Remote Similarity	0.5644	NPC473322
Remote Similarity	0.5641	NPC470545
Remote Similarity	0.5625	NPC262166
Remote Similarity	0.5605	NPC470546
Remote Similarity	0.56	NPC475168
Remote Similarity	0.56	NPC7817
Remote Similarity	0.56	NPC171734

Drug Structure

NPD2055 OpenBabel08211701392D 30 32 0 0 1 0 0 0 0 0999 V2000 1.0000 3.4049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 3.4049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2247 -1.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8314 -1.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7790 -2.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2685 -1.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8978 -0.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6390 0.1895 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.3090 1.9511 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6730 0.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 0.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2601 2.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5000 2.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9659 -0.2588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.4142 1.4142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3120 0.6378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0872 1.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0032 1.5909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4680 3.2382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7071 -0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2588 -0.9659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8131 -2.3923 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 1.9511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -2.1213 2.1213 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7944 2.5696 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4190 3.5472 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 15 1 0 0 0 0 2 15 1 0 0 0 0 3 25 1 0 0 0 0 4 5 2 0 0 0 0 4 7 1 0 0 0 0 5 26 1 0 0 0 0 6 7 2 0 0 0 0 6 26 1 0 0 0 0 7 8 1 0 0 0 0 8 10 1 0 0 0 0 8 11 1 0 0 0 0 9 12 1 6 0 0 0 9 15 1 0 0 0 0 9 18 1 0 0 0 0 10 17 2 3 0 0 0 10 19 1 0 0 0 0 11 20 2 0 0 0 0 11 21 1 0 0 0 0 12 22 2 0 0 0 0 12 23 1 0 0 0 0 13 16 1 0 0 0 0 13 18 1 0 0 0 0 13 24 2 0 0 0 0 14 16 1 1 0 0 0 14 18 1 0 0 0 0 14 27 1 0 0 0 0 15 27 1 0 0 0 0 16 17 1 1 0 0 0 16 25 1 0 0 0 0 19 28 1 0 0 0 0 21 29 1 0 0 0 0 23 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	414.06
ALogP	0.3779
MLogP	2.01
XLogP	0.342
HDA	9
HBD	3
Rotatable Bonds	12
TPSA	190.27
RO5 Violation	0