Drug Information| Drug ID:   | NPD2055 |
| Drug Name:   | Temocillin |
| Molecular Formula:   | C16H18N2O7S2 |
| Canonical SMILES:   | CO[C@@]1(N=C(C(c2cscc2)C(=O)O)O)C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C |
| Standard InCHI:   | "InChI=1S/C16H18N2O7S2/c1-15(2)9(12(22)23)18-13(24)16(25-3,14(18)27-15)17-10(19)8(11(20)21)7-4-5-26-6-7/h4-6,8-9,14H,1-3H3,(H,17,19)(H,20,21)(H,22,23)/t8?,9-,14+,16-/m0/s1" |
| Standard InCHIKey:   | BVCKFLJARNKCSS-DWPRYXJFSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2055Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 414.06 |
| ALogP   | 0.3779 |
| MLogP   | 2.01 |
| XLogP   | 0.342 |
| HDA   | 9 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 190.27 |
| RO5 Violation   | 0 |