NPASS drugs

Drug Information

Drug ID:	NPD2032
Drug Name:	CNS-5788
Molecular Formula:	C16H18ClN3OS2
Canonical SMILES:	CSc1ccc(c(c1)NC(=N)N(c1cccc(c1)[S@](=O)C)C)Cl
Standard InCHI:	InChI=1S/C16H18ClN3OS2/c1-20(11-5-4-6-13(9-11)23(3)21)16(18)19-15-10-12(22-2)7-8-14(15)17/h4-10H,1-3H3,(H2,18,19)/t23-/m1/s1
Standard InCHIKey:	RODJWDCTFWIGQR-HSZRJFAPSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2032

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	1375
0.1-0.2	11341
0.2-0.3	13103
0.3-0.4	4008
0.4-0.5	980
0.5-0.6	77
0.6-0.7	5
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7537	NPC125416
Remote Similarity	0.6918	NPC321053
Remote Similarity	0.6397	NPC328877
Remote Similarity	0.6204	NPC474430
Remote Similarity	0.6148	NPC317642
Remote Similarity	0.6078	NPC469949
Remote Similarity	0.5969	NPC229477
Remote Similarity	0.5938	NPC134825
Remote Similarity	0.5932	NPC314557
Remote Similarity	0.5915	NPC320863
Remote Similarity	0.589	NPC314141
Remote Similarity	0.5866	NPC315715
Remote Similarity	0.5789	NPC315403
Remote Similarity	0.5705	NPC252794
Remote Similarity	0.5696	NPC473417
Remote Similarity	0.5674	NPC291610
Remote Similarity	0.5672	NPC240134
Remote Similarity	0.5669	NPC145754
Remote Similarity	0.5639	NPC43655
Remote Similarity	0.5633	NPC328590
Remote Similarity	0.56	NPC288232

Drug Structure

NPD2032 OpenBabel08211701392D 25 26 0 0 0 0 0 0 0 0999 V2000 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -2.5000 0.0000 S 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 1 0 0 0 0 2 22 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 11 1 0 0 0 0 6 13 2 0 0 0 0 7 8 2 0 0 0 0 7 12 1 0 0 0 0 8 14 1 0 0 0 0 9 11 2 0 0 0 0 9 13 1 0 0 0 0 10 12 2 0 0 0 0 10 15 1 0 0 0 0 11 20 1 0 0 0 0 12 22 1 0 0 0 0 13 23 1 0 0 0 0 14 15 2 0 0 0 0 14 17 1 0 0 0 0 15 19 1 0 0 0 0 16 18 2 0 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 18 24 1 0 0 0 0 19 25 1 0 0 0 0 21 23 2 0 0 0 0 23 3 1 1 0 0 0 M END $$$$

External Identifiers

TTD	DIB003276
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	367.06
ALogP	0.6511
MLogP	2.45
XLogP	4.308
HDA	4
HBD	2
Rotatable Bonds	10
TPSA	100.7
RO5 Violation	0