NPASS drugs

Drug Information

Drug ID:	NPD2022
Drug Name:	Azidocillin
Molecular Formula:	C16H17N5O4S
Canonical SMILES:	OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)[C@@H](c1ccccc1)N=[N+]=[N-]
Standard InCHI:	"InChI=1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1"
Standard InCHIKey:	ODFHGIPNGIAMDK-NJBDSQKTSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD2022

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	108571
0.1-0.2	100834
0.2-0.3	2306
0.3-0.4	14
0.4-0.5	7
0.5-0.6	3
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6351	NPC487965
Remote Similarity	0.6308	NPC330588
Remote Similarity	0.6212	NPC90478
Remote Similarity	0.6029	NPC468984
Remote Similarity	0.5362	NPC485035
Remote Similarity	0.5362	NPC469134
Remote Similarity	0.5205	NPC206980

Drug Structure

NPD2022 OpenBabel08211701392D 28 30 0 0 1 0 0 0 0 0999 V2000 3.4049 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4049 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8296 0.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5708 -0.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1225 1.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6049 -0.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1566 0.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8978 -0.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9511 0.3090 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7424 2.1566 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2247 0.2247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.4836 1.1907 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2382 1.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5909 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9511 -1.3090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6128 1.7953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 16 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 8 2 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 12 1 1 0 0 0 9 19 1 0 0 0 0 10 13 1 0 0 0 0 10 14 1 0 0 0 0 10 18 1 6 0 0 0 11 15 1 1 0 0 0 11 16 1 0 0 0 0 11 21 1 0 0 0 0 12 18 2 3 0 0 0 12 22 1 0 0 0 0 13 21 1 0 0 0 0 13 23 2 0 0 0 0 14 21 1 0 0 0 0 14 26 1 6 0 0 0 15 24 2 0 0 0 0 15 25 1 0 0 0 0 16 26 1 0 0 0 0 17 20 2 0 0 0 0 19 20 2 0 0 0 0 22 27 1 0 0 0 0 25 28 1 0 0 0 0 M CHG 2 17 -1 20 1 M END $$$$

External Identifiers

TTD
DrugBank	DB08795
ChEMBL	CHEMBL2105907
IUPHAR/BPS
PharmaGKB	PA165958414
KEGG Drug
PubChem CID	0
ChEBI	51758
CAS Number	17243-38-8

Drug Properties

Molecular Weight	375.1
ALogP	-2.5771
MLogP	2.12
XLogP	2.287
HDA	8
HBD	2
Rotatable Bonds	9
TPSA	127.86
RO5 Violation	0