Drug Information| Drug ID:   | NPD2017 |
| Drug Name:   | Cefadroxil |
| Molecular Formula:   | C16H17N3O5S |
| Canonical SMILES:   | Oc1ccc(cc1)[C@H](C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)C)O)N |
| Standard InCHI:   | "InChI=1S/C16H17N3O5S/c1-7-6-25-15-11(14(22)19(15)12(7)16(23)24)18-13(21)10(17)8-2-4-9(20)5-3-8/h2-5,10-11,15,20H,6,17H2,1H3,(H,18,21)(H,23,24)/t10-,11-,15-/m1/s1" |
| Standard InCHIKey:   | BOEGTKLJZSQCCD-UEKVPHQBSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD2017Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8305 | NPC13470 |
| Remote Similarity | 0.6269 | NPC206980 |
| Remote Similarity | 0.5507 | NPC278687 |
| Remote Similarity | 0.5373 | NPC144780 |
| Remote Similarity | 0.5294 | NPC237688 |
| Remote Similarity | 0.507 | NPC468984 |
| Molecular Weight   | 363.09 |
| ALogP   | -1.2788 |
| MLogP   | 2.23 |
| XLogP   | -2.601 |
| HDA   | 7 |
| HBD   | 4 |
| Rotatable Bonds   | 9 |
| TPSA   | 161.75 |
| RO5 Violation   | 0 |