NPASS drugs

Drug Information

Drug ID:	NPD195
Drug Name:	Fludarabine
Molecular Formula:	C10H12FN5O4
Canonical SMILES:	OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1cnc2c1nc(F)nc2N
Standard InCHI:	"InChI=1S/C10H12FN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6+,9-/m1/s1"
Standard InCHIKey:	HBUBKKRHXORPQB-FJFJXFQQSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; DrugBank; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD195

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	155607
0.1-0.2	54908
0.2-0.3	775
0.3-0.4	252
0.4-0.5	134
0.5-0.6	18
0.6-0.7	21
0.7-0.8	7
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC269827
High Similarity	1.0	NPC602648
Intermediate Similarity	0.7258	NPC472816
Intermediate Similarity	0.7258	NPC517016
Intermediate Similarity	0.7258	NPC574893
Intermediate Similarity	0.7258	NPC581344
Intermediate Similarity	0.7258	NPC600171
Intermediate Similarity	0.7069	NPC574902
Intermediate Similarity	0.7069	NPC599876
Remote Similarity	0.6667	NPC156461
Remote Similarity	0.6667	NPC322476
Remote Similarity	0.6667	NPC107374
Remote Similarity	0.6667	NPC2499
Remote Similarity	0.6667	NPC532382
Remote Similarity	0.6667	NPC584269
Remote Similarity	0.6667	NPC600382
Remote Similarity	0.6667	NPC605359
Remote Similarity	0.6667	NPC609539
Remote Similarity	0.6667	NPC612067
Remote Similarity	0.661	NPC538546
Remote Similarity	0.6552	NPC589064
Remote Similarity	0.6552	NPC609036
Remote Similarity	0.6441	NPC260084
Remote Similarity	0.6441	NPC257600
Remote Similarity	0.6441	NPC164665
Remote Similarity	0.6338	NPC518550
Remote Similarity	0.6338	NPC572845
Remote Similarity	0.6338	NPC611003
Remote Similarity	0.6333	NPC189068
Remote Similarity	0.6066	NPC589892
Remote Similarity	0.5556	NPC535553
Remote Similarity	0.5556	NPC589839
Remote Similarity	0.5556	NPC608983
Remote Similarity	0.55	NPC317821
Remote Similarity	0.5397	NPC490331
Remote Similarity	0.5385	NPC136349
Remote Similarity	0.5385	NPC219313
Remote Similarity	0.5385	NPC7092
Remote Similarity	0.5385	NPC525749
Remote Similarity	0.5161	NPC54320
Remote Similarity	0.5161	NPC79321
Remote Similarity	0.5161	NPC546842
Remote Similarity	0.5156	NPC321052
Remote Similarity	0.5079	NPC311197
Remote Similarity	0.5077	NPC604250
Remote Similarity	0.5075	NPC514003
Remote Similarity	0.5075	NPC578663
Remote Similarity	0.5072	NPC177964

Drug Structure

NPD195 OpenBabel08201723122D 25 27 0 0 1 0 0 0 0 0999 V2000 3.7917 0.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3364 -2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1226 -0.6522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3305 -1.6303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4644 -2.1303 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7213 -1.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6581 -2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7698 -0.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2440 -2.0371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3599 -3.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1280 -0.5477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4390 0.6262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0530 -1.4493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4464 -3.5316 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 17 1 0 0 0 0 2 13 2 0 0 0 0 2 16 1 0 0 0 0 3 1 1 6 0 0 0 3 5 1 0 0 0 0 3 20 1 0 0 0 0 4 7 2 0 0 0 0 4 8 1 0 0 0 0 4 13 1 0 0 0 0 5 6 1 0 0 0 0 5 18 1 1 0 0 0 6 9 1 0 0 0 0 6 19 1 6 0 0 0 7 12 1 0 0 0 0 7 14 1 0 0 0 0 8 15 2 0 0 0 0 8 16 1 0 0 0 0 9 16 1 6 0 0 0 9 20 1 0 0 0 0 10 11 1 0 0 0 0 10 14 2 0 0 0 0 10 15 1 0 0 0 0 12 21 1 0 0 0 0 12 22 1 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 19 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000567
DrugBank	DB01073
ChEMBL	CHEMBL1568
IUPHAR/BPS	4802
PharmaGKB	PA449655
KEGG Drug	D01907
PubChem CID	657237
ChEBI	94701
CAS Number	21679-14-1

Drug Properties

Molecular Weight	285.09
ALogP	-2.1762
MLogP	1.46
XLogP	-1.43
HDA	9
HBD	4
Rotatable Bonds	7
TPSA	139.54
RO5 Violation	0