Drug Information| Drug ID:   | NPD1867 |
| Drug Name:   | Benoxaprofen |
| Molecular Formula:   | C16H12ClNO3 |
| Canonical SMILES:   | OC(=O)C(c1ccc2c(c1)nc(o2)c1ccc(cc1)Cl)C |
| Standard InCHI:   | "InChI=1S/C16H12ClNO3/c1-9(16(19)20)11-4-7-14-13(8-11)18-15(21-14)10-2-5-12(17)6-3-10/h2-9H,1H3,(H,19,20)" |
| Standard InCHIKey:   | MITFXPHMIHQXPI-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1867Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.625 | NPC480712 |
| TTD   | DCL000338 |
| DrugBank   | DB04812 |
| ChEMBL   | CHEMBL340978 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 39941 |
| ChEBI   | 76114 |
| CAS Number   | 51234-28-7 |
| Molecular Weight   | 301.05 |
| ALogP   | 0.6452 |
| MLogP   | 2.67 |
| XLogP   | 3.891 |
| HDA   | 3 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 63.33 |
| RO5 Violation   | 0 |