NPASS drugs

Drug Information

Drug ID:	NPD186
Drug Name:	"Nucleoside analogs (cancer), MD Anderson Cancer Center"
Molecular Formula:	C10H12ClN5O4
Canonical SMILES:	OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1c(Cl)nc2c1ncnc2N
Standard InCHI:	"InChI=1S/C10H12ClN5O4/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,13,14)/t3-,5-,6-,9-/m1/s1"
Standard InCHIKey:	MHDPPLULTMGBSI-UUOKFMHZSA-N
Max Developmental Stage:	Phase 1
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD186

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	153853
0.1-0.2	56652
0.2-0.3	774
0.3-0.4	264
0.4-0.5	164
0.5-0.6	19
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC490331
Remote Similarity	0.6786	NPC156461
Remote Similarity	0.6786	NPC322476
Remote Similarity	0.6786	NPC107374
Remote Similarity	0.6786	NPC2499
Remote Similarity	0.6786	NPC532382
Remote Similarity	0.6786	NPC584269
Remote Similarity	0.6786	NPC600382
Remote Similarity	0.6786	NPC605359
Remote Similarity	0.6786	NPC609539
Remote Similarity	0.6786	NPC612067
Remote Similarity	0.5882	NPC224076
Remote Similarity	0.5593	NPC317821
Remote Similarity	0.5397	NPC269827
Remote Similarity	0.5397	NPC602648
Remote Similarity	0.5323	NPC229974
Remote Similarity	0.5323	NPC292506
Remote Similarity	0.5231	NPC136349
Remote Similarity	0.5231	NPC219313
Remote Similarity	0.5231	NPC7092
Remote Similarity	0.5231	NPC525749
Remote Similarity	0.5152	NPC514003
Remote Similarity	0.5152	NPC578663
Remote Similarity	0.5079	NPC209525
Remote Similarity	0.5079	NPC236015
Remote Similarity	0.5079	NPC161659
Remote Similarity	0.5079	NPC137784
Remote Similarity	0.5079	NPC567109
Remote Similarity	0.5079	NPC602314
Remote Similarity	0.5075	NPC542450

Drug Structure

NPD186 OpenBabel08201723122D 25 27 0 0 1 0 0 0 0 0999 V2000 -3.0485 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6092 -2.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3794 -1.0169 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6092 -0.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5873 -0.0388 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7213 0.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4752 -0.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -0.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9781 -0.2079 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4067 0.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0933 1.7796 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 3.3412 -0.1691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4752 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4013 0.8090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.0267 -1.5522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5009 0.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6168 1.4557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3849 -1.1215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2072 -0.6691 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3412 0.8309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3357 -0.6011 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6054 1.3625 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4258 2.0435 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 17 1 0 0 0 0 2 13 2 0 0 0 0 2 14 1 0 0 0 0 3 1 1 6 0 0 0 3 5 1 0 0 0 0 3 20 1 0 0 0 0 4 7 2 0 0 0 0 4 8 1 0 0 0 0 4 15 1 0 0 0 0 5 6 1 0 0 0 0 5 18 1 1 0 0 0 6 9 1 0 0 0 0 6 19 1 1 0 0 0 7 12 1 0 0 0 0 7 13 1 0 0 0 0 8 14 2 0 0 0 0 8 16 1 0 0 0 0 9 16 1 6 0 0 0 9 20 1 0 0 0 0 10 11 1 0 0 0 0 10 15 2 0 0 0 0 10 16 1 0 0 0 0 12 21 1 0 0 0 0 12 22 1 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 19 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB004242
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	301.06
ALogP	-1.9795
MLogP	1.46
XLogP	-1.293
HDA	9
HBD	4
Rotatable Bonds	7
TPSA	139.54
RO5 Violation	0