Drug Information| Drug ID:   | NPD1706 |
| Drug Name:   | |
| Molecular Formula:   | C15H19N3O6 |
| Canonical SMILES:   | C=Cc1cn(c(nc1=N)O)C1OC(C(C1OC(=O)C)OC(=O)C)C |
| Standard InCHI:   | "InChI=1S/C15H19N3O6/c1-5-10-6-18(15(21)17-13(10)16)14-12(24-9(4)20)11(7(2)22-14)23-8(3)19/h5-7,11-12,14H,1H2,2-4H3,(H2,16,17,21)" |
| Standard InCHIKey:   | NELWQUQCCZMRPB-UHFFFAOYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD1706Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6207 | NPC127416 |
| Molecular Weight   | 337.13 |
| ALogP   | -0.5115 |
| MLogP   | 2.12 |
| XLogP   | 1.792 |
| HDA   | 9 |
| HBD   | 2 |
| Rotatable Bonds   | 10 |
| TPSA   | 121.51 |
| RO5 Violation   | 0 |