NPASS drugs

Drug Information

Drug ID:	NPD1705
Drug Name:	BMS-181168
Molecular Formula:	C15H19F3N4O
Canonical SMILES:	O=C1CCCN1CC1CCN(CC1)c1ccnc(n1)C(F)(F)F
Standard InCHI:	InChI=1S/C15H19F3N4O/c16-15(17,18)14-19-6-3-12(20-14)21-8-4-11(5-9-21)10-22-7-1-2-13(22)23/h3,6,11H,1-2,4-5,7-10H2
Standard InCHIKey:	KEWFMWJJMGQBAN-UHFFFAOYSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD1705

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	319
0.1-0.2	23902
0.2-0.3	3581
0.3-0.4	2111
0.4-0.5	843
0.5-0.6	129
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.675	NPC326364
Remote Similarity	0.6378	NPC476128
Remote Similarity	0.6269	NPC27699
Remote Similarity	0.6241	NPC222061
Remote Similarity	0.6028	NPC68938
Remote Similarity	0.5896	NPC75844
Remote Similarity	0.5882	NPC168702
Remote Similarity	0.5882	NPC125659
Remote Similarity	0.5849	NPC197068
Remote Similarity	0.5833	NPC167285
Remote Similarity	0.5833	NPC76544
Remote Similarity	0.5833	NPC226184
Remote Similarity	0.5828	NPC207633
Remote Similarity	0.5818	NPC472833
Remote Similarity	0.5766	NPC163105
Remote Similarity	0.5745	NPC256849
Remote Similarity	0.5714	NPC18308
Remote Similarity	0.5714	NPC472832
Remote Similarity	0.5696	NPC65408
Remote Similarity	0.5676	NPC109322
Remote Similarity	0.5669	NPC296437
Remote Similarity	0.5638	NPC180493
Remote Similarity	0.5633	NPC470266
Remote Similarity	0.5603	NPC329046

Drug Structure

NPD1705 OpenBabel08211701082D 23 25 0 0 0 0 0 0 0 0999 V2000 -6.7788 -0.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2788 0.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1097 -1.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3007 -0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 0.8660 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.5575 0.6637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 7 1 0 0 0 0 2 13 1 0 0 0 0 3 6 2 0 0 0 0 3 12 1 0 0 0 0 4 8 1 0 0 0 0 4 11 1 0 0 0 0 5 9 1 0 0 0 0 5 11 1 0 0 0 0 6 19 1 0 0 0 0 7 22 1 0 0 0 0 8 21 1 0 0 0 0 9 21 1 0 0 0 0 10 11 1 0 0 0 0 10 22 1 0 0 0 0 12 20 2 0 0 0 0 12 21 1 0 0 0 0 13 22 1 0 0 0 0 13 23 2 0 0 0 0 14 15 1 0 0 0 0 14 19 2 0 0 0 0 14 20 1 0 0 0 0 15 16 1 0 0 0 0 15 17 1 0 0 0 0 15 18 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB005390
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	328.15
ALogP	-0.6124
MLogP	2.23
XLogP	2.46
HDA	5
HBD	0
Rotatable Bonds	7
TPSA	49.33
RO5 Violation	0