NPASS drugs

Drug Information

Drug ID:	NPD169
Drug Name:	Tocladesine
Molecular Formula:	C10H11ClN5O6P
Canonical SMILES:	O[C@@H]1[C@@H]2OP(=O)(O)OC[C@H]2O[C@H]1n1c(Cl)nc2c1ncnc2N
Standard InCHI:	"InChI=1S/C10H11ClN5O6P/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-5(17)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,17H,1H2,(H,18,19)(H2,12,13,14)/t3-,5-,6-,9-/m1/s1"
Standard InCHIKey:	CLLFEJLEDNXZNR-UUOKFMHZSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD169

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	149542
0.1-0.2	61166
0.2-0.3	454
0.3-0.4	404
0.4-0.5	147
0.5-0.6	11
0.6-0.7	1
0.7-0.8	6
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC224076
Intermediate Similarity	0.7246	NPC302778
Intermediate Similarity	0.7246	NPC329404
Intermediate Similarity	0.7246	NPC212551
Intermediate Similarity	0.7246	NPC303729
Intermediate Similarity	0.7246	NPC66877
Intermediate Similarity	0.7246	NPC523889
Remote Similarity	0.6173	NPC323608
Remote Similarity	0.5882	NPC490331
Remote Similarity	0.5823	NPC325191
Remote Similarity	0.5526	NPC164952
Remote Similarity	0.5526	NPC505783
Remote Similarity	0.5395	NPC136075
Remote Similarity	0.5375	NPC565216
Remote Similarity	0.5195	NPC317920
Remote Similarity	0.5185	NPC329408
Remote Similarity	0.5176	NPC319652
Remote Similarity	0.5176	NPC525974
Remote Similarity	0.506	NPC328660

Drug Structure

NPD169 OpenBabel08201723122D 27 30 0 0 1 0 0 0 0 0999 V2000 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3939 -2.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8097 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 0.3090 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5529 -1.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8587 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2709 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8587 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5497 1.2601 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7.5039 -1.3601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.3450 -2.6473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6508 -2.2872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.8097 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.2709 -0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.9921 1.2601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 -1.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 8.2471 -2.0292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7118 -0.3820 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3230 2.0032 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.7321 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 1 0 0 0 0 2 13 2 0 0 0 0 2 14 1 0 0 0 0 3 1 1 6 0 0 0 3 6 1 0 0 0 0 3 21 1 0 0 0 0 4 7 2 0 0 0 0 4 8 1 0 0 0 0 4 15 1 0 0 0 0 5 6 1 0 0 0 0 5 9 1 0 0 0 0 5 17 1 1 0 0 0 6 22 1 1 0 0 0 7 12 1 0 0 0 0 7 13 1 0 0 0 0 8 14 2 0 0 0 0 8 16 1 0 0 0 0 9 16 1 6 0 0 0 9 21 1 0 0 0 0 10 11 1 0 0 0 0 10 15 2 0 0 0 0 10 16 1 0 0 0 0 12 24 1 0 0 0 0 12 25 1 0 0 0 0 17 26 1 0 0 0 0 18 23 1 0 0 0 0 18 27 1 0 0 0 0 19 23 2 0 0 0 0 20 23 1 0 0 0 0 22 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	363.01
ALogP	-1.3063
MLogP	1.13
XLogP	-2.362
HDA	11
HBD	3
Rotatable Bonds	5
TPSA	164.65
RO5 Violation	1