Drug Information| Drug ID:   | NPD1678 |
| Drug Name:   | |
| Molecular Formula:   | C15H18F3NO5 |
| Canonical SMILES:   | COC[C@H]1CN(C(=O)O1)c1ccc(cc1)OCC[C@H](C(F)(F)F)O |
| Standard InCHI:   | "InChI=1S/C15H18F3NO5/c1-22-9-12-8-19(14(21)24-12)10-2-4-11(5-3-10)23-7-6-13(20)15(16,17)18/h2-5,12-13,20H,6-9H2,1H3/t12-,13-/m1/s1" |
| Standard InCHIKey:   | IALVDLPLCLFBCF-CHWSQXEVSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD1678Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5075 | NPC68612 |
| Molecular Weight   | 349.11 |
| ALogP   | -0.0061 |
| MLogP   | 2.12 |
| XLogP   | 2.659 |
| HDA   | 5 |
| HBD   | 1 |
| Rotatable Bonds   | 13 |
| TPSA   | 68.23 |
| RO5 Violation   | 0 |