NPASS drugs

Drug Information

Drug ID:	NPD166
Drug Name:	Clofarabine
Molecular Formula:	C10H11ClFN5O3
Canonical SMILES:	OC[C@H]1O[C@H]([C@H]([C@@H]1O)F)n1cnc2c1nc(Cl)nc2N
Standard InCHI:	"InChI=1S/C10H11ClFN5O3/c11-10-15-7(13)5-8(16-10)17(2-14-5)9-4(12)6(19)3(1-18)20-9/h2-4,6,9,18-19H,1H2,(H2,13,15,16)/t3-,4+,6-,9-/m1/s1"
Standard InCHIKey:	WDDPHFBMKLOVOX-AYQXTPAHSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD166

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	164531
0.1-0.2	46116
0.2-0.3	834
0.3-0.4	211
0.4-0.5	38
0.5-0.6	5
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6949	NPC269827
Remote Similarity	0.6949	NPC602648
Remote Similarity	0.6833	NPC574902
Remote Similarity	0.6833	NPC599876
Remote Similarity	0.6393	NPC538546
Remote Similarity	0.5571	NPC472816
Remote Similarity	0.5571	NPC517016
Remote Similarity	0.5571	NPC574893
Remote Similarity	0.5571	NPC581344
Remote Similarity	0.5571	NPC600171

Drug Structure

NPD166 OpenBabel08201723122D 24 26 0 0 1 0 0 0 0 0999 V2000 3.7917 0.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3364 -2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1226 -0.6522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4644 -2.1303 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3305 -1.6303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7213 -1.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 2.3599 -3.1249 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6581 -2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7698 -0.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2440 -2.0371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1280 -0.5477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4390 0.6262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0530 -1.4493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 14 2 0 0 0 0 2 17 1 0 0 0 0 3 1 1 6 0 0 0 3 6 1 0 0 0 0 3 20 1 0 0 0 0 4 6 1 0 0 0 0 4 9 1 0 0 0 0 4 12 1 6 0 0 0 5 7 2 0 0 0 0 5 8 1 0 0 0 0 5 14 1 0 0 0 0 6 19 1 1 0 0 0 7 13 1 0 0 0 0 7 15 1 0 0 0 0 8 16 2 0 0 0 0 8 17 1 0 0 0 0 9 17 1 6 0 0 0 9 20 1 0 0 0 0 10 11 1 0 0 0 0 10 15 2 0 0 0 0 10 16 1 0 0 0 0 13 21 1 0 0 0 0 13 22 1 0 0 0 0 18 23 1 0 0 0 0 19 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000849
DrugBank	DB00631
ChEMBL	CHEMBL1750
IUPHAR/BPS	6802
PharmaGKB	PA164754863
KEGG Drug
PubChem CID	119182
ChEBI	681569
CAS Number	123318-82-1

Drug Properties

Molecular Weight	303.05
ALogP	-1.0395
MLogP	1.46
XLogP	-0.548
HDA	8
HBD	3
Rotatable Bonds	7
TPSA	119.31
RO5 Violation	0