Drug Information| Drug ID: | NPD1625 |
| Drug Name: | Mefenamic Acid |
| Molecular Formula: | C15H15NO2 |
| Canonical SMILES: | OC(=O)c1ccccc1Nc1cccc(c1C)C |
| Standard InCHI: | InChI=1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) |
| Standard InCHIKey: | HYYBABOKPJLUIN-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD1625Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Molecular Weight | 241.11 |
| ALogP | 0.6238 |
| MLogP | 2.78 |
| XLogP | 5.011 |
| HDA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| TPSA | 49.33 |
| RO5 Violation | 1 |