Drug Information| Drug ID:   | NPD16 |
| Drug Name:   | Bamethan Sulfate |
| Molecular Formula:   | 2C12H19NO2.H2O4S |
| Canonical SMILES:   | OS(=O)(=O)O.CCCCNCC(c1ccc(cc1)O)O.CCCCNCC(c1ccc(cc1)O)O |
| Standard InCHI:   | "InChI=1S/2C12H19NO2.H2O4S/c2*1-2-3-8-13-9-12(15)10-4-6-11(14)7-5-10;1-5(2,3)4/h2*4-7,12-15H,2-3,8-9H2,1H3;(H2,1,2,3,4)" |
| Standard InCHIKey:   | PARMADWNFXEEFC-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD16Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5476 | NPC124830 |
| Remote Similarity | 0.5476 | NPC213 |
| Remote Similarity | 0.5476 | NPC10286 |
| Remote Similarity | 0.5476 | NPC604424 |
| Remote Similarity | 0.5476 | NPC609563 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 209.14 |
| ALogP   | -1.8929 |
| MLogP   | 2.45 |
| XLogP   | 1.814 |
| HDA   | 2 |
| HBD   | 3 |
| Rotatable Bonds   | 9 |
| TPSA   | 52.49 |
| RO5 Violation   | 0 |