Drug Information| Drug ID:   | NPD1582 |
| Drug Name:   | Cefaclor |
| Molecular Formula:   | C15H14ClN3O4S |
| Canonical SMILES:   | N[C@@H](C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)Cl)O)c1ccccc1 |
| Standard InCHI:   | "InChI=1S/C15H14ClN3O4S/c16-8-6-24-14-10(13(21)19(14)11(8)15(22)23)18-12(20)9(17)7-4-2-1-3-5-7/h1-5,9-10,14H,6,17H2,(H,18,20)(H,22,23)/t9-,10-,14-/m1/s1" |
| Standard InCHIKey:   | QYIYFLOTGYLRGG-GPCCPHFNSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1582Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 367.04 |
| ALogP   | -0.8962 |
| MLogP   | 2.12 |
| XLogP   | -0.609 |
| HDA   | 7 |
| HBD   | 3 |
| Rotatable Bonds   | 8 |
| TPSA   | 141.52 |
| RO5 Violation   | 0 |