Drug Information| Drug ID:   | NPD1455 |
| Drug Name:   | Citicoline |
| Molecular Formula:   | C14H26N4O11P2 |
| Canonical SMILES:   | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OCC[N+](C)(C)C)O)O)O[C@H]([C@@H]1O)n1ccc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C14H26N4O11P2/c1-18(2,3)6-7-26-30(22,23)29-31(24,25)27-8-9-11(19)12(20)13(28-9)17-5-4-10(15)16-14(17)21/h4-5,9,11-13,19-20H,6-8H2,1-3H3,(H3-,15,16,21,22,23,24,25)/p+1/t9-,11-,12-,13-/m1/s1" |
| Standard InCHIKey:   | RZZPDXZPRHQOCG-OJAKKHQRSA-O |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1455Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7887 | NPC328914 |
| Intermediate Similarity | 0.7879 | NPC328779 |
| Intermediate Similarity | 0.7879 | NPC240517 |
| Intermediate Similarity | 0.7879 | NPC129 |
| Intermediate Similarity | 0.7424 | NPC120887 |
| Intermediate Similarity | 0.7324 | NPC126704 |
| Intermediate Similarity | 0.7031 | NPC226769 |
| Remote Similarity | 0.5658 | NPC329384 |
| Remote Similarity | 0.5479 | NPC90240 |
| Remote Similarity | 0.5303 | NPC62927 |
| Remote Similarity | 0.5119 | NPC548131 |
| Remote Similarity | 0.5067 | NPC329277 |
| Molecular Weight   | 489.12 |
| ALogP   | -3.569 |
| MLogP   | 1.13 |
| XLogP   | -3.312 |
| HDA   | 14 |
| HBD   | 6 |
| Rotatable Bonds   | 18 |
| TPSA   | 231.28 |
| RO5 Violation   | 2 |