Drug Information| Drug ID:   | NPD1428 |
| Drug Name:   | Valtorcitabine |
| Molecular Formula:   | C14H22N4O5 |
| Canonical SMILES:   | OC[C@@H]1O[C@@H](C[C@H]1OC(=O)[C@H](C(C)C)N)n1ccc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C14H22N4O5/c1-7(2)12(16)13(20)23-8-5-11(22-9(8)6-19)18-4-3-10(15)17-14(18)21/h3-4,7-9,11-12,19H,5-6,16H2,1-2H3,(H2,15,17,21)/t8-,9+,11+,12+/m1/s1" |
| Standard InCHIKey:   | VFCYZPOEGWLYRM-QCZKYFFMSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1428Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 326.16 |
| ALogP   | -2.1305 |
| MLogP   | 2.01 |
| XLogP   | 0.383 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 11 |
| TPSA   | 141.46 |
| RO5 Violation   | 0 |