Drug Information| Drug ID:   | NPD1385 |
| Drug Name:   | FO-152 |
| Molecular Formula:   | C14H20FN3O7 |
| Canonical SMILES:   | CC(C(C(=O)OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cc(F)c(nc1=O)O)N)C |
| Standard InCHI:   | "InChI=1S/C14H20FN3O7/c1-5(2)8(16)13(22)24-4-7-9(19)10(20)12(25-7)18-3-6(15)11(21)17-14(18)23/h3,5,7-10,12,19-20H,4,16H2,1-2H3,(H,17,21,23)/t7-,8?,9-,10-,12-/m1/s1" |
| Standard InCHIKey:   | CUDUXVBVSUAOTK-ATTBJVBRSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD1385Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6197 | NPC317639 |
| Molecular Weight   | 361.13 |
| ALogP   | -2.4949 |
| MLogP   | 1.79 |
| XLogP   | -1.278 |
| HDA   | 10 |
| HBD   | 4 |
| Rotatable Bonds   | 13 |
| TPSA   | 154.91 |
| RO5 Violation   | 0 |