NPASS drugs

Drug Information

Drug ID:	NPD1301
Drug Name:	Cyclothiazide
Molecular Formula:	C14H16ClN3O4S2
Canonical SMILES:	Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C1CC2CC1C=C2
Standard InCHI:	InChI=1S/C14H16ClN3O4S2/c15-10-5-11-13(6-12(10)23(16,19)20)24(21,22)18-14(17-11)9-4-7-1-2-8(9)3-7/h1-2,5-9,14,17-18H,3-4H2,(H2,16,19,20)
Standard InCHIKey:	BOCUKUHCLICSIY-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD1301

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	668
0.1-0.2	8345
0.2-0.3	15854
0.3-0.4	4455
0.4-0.5	1473
0.5-0.6	93
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.8633	NPC321053
Remote Similarity	0.6144	NPC125416
Remote Similarity	0.5974	NPC218710
Remote Similarity	0.5971	NPC315403
Remote Similarity	0.5878	NPC328877
Remote Similarity	0.5767	NPC252794
Remote Similarity	0.575	NPC475915
Remote Similarity	0.5732	NPC145754
Remote Similarity	0.5697	NPC328590
Remote Similarity	0.5638	NPC291610
Remote Similarity	0.5633	NPC313673
Remote Similarity	0.5604	NPC469897
Remote Similarity	0.5603	NPC43655

Drug Structure

NPD1301 OpenBabel08211700192D 28 31 0 0 1 0 0 0 0 0999 V2000 -4.3149 -0.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7271 -1.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7760 0.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9225 0.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4538 -0.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4723 0.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7271 0.5228 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -2.7760 -0.7862 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -2.4470 -0.0472 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.4723 -0.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9446 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9815 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4538 0.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4168 0.8500 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.9815 -1.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -0.3992 0.8967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9261 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9261 1.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8967 -0.3992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3992 -0.8967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9446 2.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0945 2.1908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 2.9446 1.7000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.1777 1.6907 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3754 0.9993 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4168 -0.8500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4168 2.5501 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 7 1 0 0 0 0 2 8 1 0 0 0 0 3 7 1 0 0 0 0 3 8 1 0 0 0 0 4 7 1 0 0 0 0 4 9 1 0 0 0 0 5 10 2 0 0 0 0 5 11 1 0 0 0 0 6 12 2 0 0 0 0 6 13 1 0 0 0 0 8 9 1 0 0 0 0 9 14 1 0 0 0 0 10 12 1 0 0 0 0 10 15 1 0 0 0 0 11 13 2 0 0 0 0 11 17 1 0 0 0 0 12 23 1 0 0 0 0 13 24 1 0 0 0 0 14 17 1 0 0 0 0 14 18 1 0 0 0 0 16 23 1 0 0 0 0 16 25 1 0 0 0 0 16 26 1 0 0 0 0 17 27 1 0 0 0 0 18 24 1 0 0 0 0 18 28 1 0 0 0 0 19 23 2 0 0 0 0 20 23 2 0 0 0 0 21 24 2 0 0 0 0 22 24 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000604
DrugBank	DB00606
ChEMBL	CHEMBL61593
IUPHAR/BPS	4167
PharmaGKB	PA449168
KEGG Drug	D01256
PubChem CID	2910
ChEBI	31448
CAS Number	2259-96-3

Drug Properties

Molecular Weight	389.03
ALogP	-1.7426
MLogP	1.9
XLogP	0.802
HDA	7
HBD	3
Rotatable Bonds	4
TPSA	135.12
RO5 Violation	0