Drug Information| Drug ID: | NPD1126 |
| Drug Name: | Tezampanel |
| Molecular Formula: | C13H21N5O2 |
| Canonical SMILES: | OC(=O)[C@H]1NC[C@H]2[C@@H](C1)C[C@H](CC2)CCc1n[nH]nn1 |
| Standard InCHI: | InChI=1S/C13H21N5O2/c19-13(20)11-6-10-5-8(1-3-9(10)7-14-11)2-4-12-15-17-18-16-12/h8-11,14H,1-7H2,(H,19,20)(H,15,16,17,18)/t8-,9+,10-,11+/m1/s1 |
| Standard InCHIKey: | ZXFRFPSZAKNPQQ-YTWAJWBKSA-N |
| Max Developmental Stage: | Phase 2 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD1126Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5841 | NPC304454 |
| Remote Similarity | 0.5784 | NPC15864 |
| Remote Similarity | 0.576 | NPC15413 |
| Remote Similarity | 0.5667 | NPC472736 |
| Remote Similarity | 0.563 | NPC174117 |