Natural Product: NPC609455
| Natural Product ID | NPC609455 |
Common Name
?
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| NYBWZWSQGCROAE-IBGZPJMESA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster |
n.a. |
| ChEMBL Identifier |
CHEMBL4067254 |
| PubChem CID |
n.a. |
| Chemical Classification |
-
CHEMONTID:0000000 [Organic compounds]
|
The Chemical Classification was calculated by
Classyfire, a software for chemical taxonomy calculation.
Reference:
DOI:10.1186/s13321-016-0174-y.
Chemical Representations
RDKit 3D
64 63 0 0 0 0 0 0 0 0999 V2000
-7.5631 0.6432 -0.2694 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3223 -0.0562 -0.8403 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7617 -0.9991 -1.9250 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5958 -0.7055 0.2829 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3521 -1.4344 -0.0981 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3805 -0.5127 -0.7250 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9188 0.6432 0.1113 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2424 0.2641 1.3792 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8112 1.4698 2.1754 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8516 2.2930 1.3762 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3676 1.4521 1.0029 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0709 0.9613 2.1881 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2873 0.1658 2.1055 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3509 -1.1491 1.4681 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0574 -1.3005 0.0308 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8903 -0.5264 -0.9301 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3449 -0.8312 -0.8914 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9437 -0.7938 0.1930 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9772 -1.1456 -2.0443 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2750 -1.4524 -2.2712 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3393 -0.4318 -2.0760 C 0 0 1 0 0 0 0 0 0 0 0 0
7.0821 0.6895 -2.8672 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7203 -0.0880 -0.6730 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9449 -1.2357 0.0919 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.6267 0.4746 0.8273 H 0 0 0 0 0 0 0 0 0 0 0 0
-7.5241 1.7418 -0.4208 H 0 0 0 0 0 0 0 0 0 0 0 0
-8.4899 0.2045 -0.6911 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.7308 0.7386 -1.3390 H 0 0 0 0 0 0 0 0 0 0 0 0
-6.9259 -2.0278 -1.5753 H 0 0 0 0 0 0 0 0 0 0 0 0
-7.7535 -0.6258 -2.2946 H 0 0 0 0 0 0 0 0 0 0 0 0
-6.0904 -0.9466 -2.8268 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.3777 0.0838 1.0399 H 0 0 0 0 0 0 0 0 0 0 0 0
-6.2827 -1.4604 0.7667 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5881 -2.2253 -0.8574 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.9245 -2.0283 0.7559 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.8078 -0.1582 -1.6873 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4549 -1.0872 -1.0277 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.8059 1.2647 0.3471 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2315 1.2837 -0.4812 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3534 -0.3823 1.2294 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8932 -0.3216 2.0731 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4162 1.1976 3.1695 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7361 2.1405 2.3477 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4793 3.1790 1.9726 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3200 2.7513 0.4820 H 0 0 0 0 0 0 0 0 0 0 0 0
0.9715 2.1535 0.3670 H 0 0 0 0 0 0 0 0 0 0 0 0
0.0332 0.6756 0.2940 H 0 0 0 0 0 0 0 0 0 0 0 0
1.2837 1.8417 2.8789 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3009 0.3904 2.8145 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7147 0.1155 3.1674 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1035 0.8004 1.6025 H 0 0 0 0 0 0 0 0 0 0 0 0
1.7378 -1.9354 2.0158 H 0 0 0 0 0 0 0 0 0 0 0 0
3.3972 -1.5560 1.6450 H 0 0 0 0 0 0 0 0 0 0 0 0
1.0104 -1.2673 -0.2880 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3242 -2.4127 -0.1947 H 0 0 0 0 0 0 0 0 0 0 0 0
2.4673 -0.6852 -1.9509 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7162 0.5803 -0.7575 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5180 -2.3780 -1.6519 H 0 0 0 0 0 0 0 0 0 0 0 0
6.3560 -1.8732 -3.3258 H 0 0 0 0 0 0 0 0 0 0 0 0
8.3092 -0.8810 -2.5477 H 0 0 0 0 0 0 0 0 0 0 0 0
6.1220 0.9213 -2.8235 H 0 0 0 0 0 0 0 0 0 0 0 0
7.1003 0.6693 -0.1841 H 0 0 0 0 0 0 0 0 0 0 0 0
8.7610 0.4094 -0.6931 H 0 0 0 0 0 0 0 0 0 0 0 0
7.7332 -0.9984 1.0279 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
23 24 1 0
1 25 1 0
1 26 1 0
1 27 1 0
2 28 1 0
3 29 1 0
3 30 1 0
3 31 1 0
4 32 1 0
4 33 1 0
5 34 1 0
5 35 1 0
6 36 1 0
6 37 1 0
7 38 1 0
7 39 1 0
8 40 1 0
8 41 1 0
9 42 1 0
9 43 1 0
10 44 1 0
10 45 1 0
11 46 1 0
11 47 1 0
12 48 1 0
12 49 1 0
13 50 1 0
13 51 1 0
14 52 1 0
14 53 1 0
15 54 1 0
15 55 1 0
16 56 1 0
16 57 1 0
20 58 1 0
20 59 1 0
21 60 1 6
22 61 1 0
23 62 1 0
23 63 1 0
24 64 1 0
M END
| Standard InCHIKey |
NYBWZWSQGCROAE-IBGZPJMESA-N |
| Standard InCHI |
InChI=1S/C20H40O4/c1-18(2)14-12-10-8-6-4-3-5-7-9-11-13-15-20(23)24-17-19(22)16-21/h18-19,21-22H,3-17H2,1-2H3/t19-/m0/s1 |
| SMILES |
CC(C)CCCCCCCCCCCCCC(=O)OC[C@@H](O)CO |
  Calculated Properties
Physi-Chem Properties
MedChem Properties
ADMET: Absorption
ADMET: Distribution
ADMET: Metabolism
ADMET: Excretion
ADMET: Toxicity
  Species Source
| Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
| NPO42945 |
Streptomyces OM-3209 |
Genus |
Streptomycetaceae |
Bacteria |
n.a. |
n.a. |
n.a. |
Database[COCONUT] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
| Organism ID |
Organism Name |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Activity Type |
# Activity |
| EC |
1 |
| Activity Type |
# Activity |
| Unchecked |
1 |
Molecular-level activity
| Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
In vitro activity
| Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
| NPT28438 |
Unchecked |
Unchecked |
n.a. |
EC |
= |
29.5 |
mM |
PMID[28231520] |
In vivo activity
| Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
Experimental ADME
| Experiment Model |
Experiment Tissue |
ADME Type |
ADME Relation |
ADME Value |
ADME Unit |
Reference |
  Chemically structural similarity
Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC609455 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| range |
Tanimoto Coefficient |
| 0-0.1 | 14370 |
| 0.1-0.2 | 30062 |
| 0.2-0.3 | 5157 |
| 0.3-0.4 | 204 |
| 0.4-0.5 | 42 |
| 0.5-0.6 | 8 |
| 0.6-0.7 | 6 |
| 0.7-0.8 | 0 |
| 0.8-0.85 | 0 |
| 0.85-0.9 | 0 |
| 0.9-0.95 | 0 |
| 0.95-1 | 0 |
Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC609455 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| range |
Tanimoto Coefficient |
| 0-0.1 | 5340 |
| 0.1-0.2 | 3533 |
| 0.2-0.3 | 257 |
| 0.3-0.4 | 17 |
| 0.4-0.5 | 1 |
| 0.5-0.6 | 1 |
| 0.6-0.7 | 0 |
| 0.7-0.8 | 0 |
| 0.8-0.85 | 0 |
| 0.85-0.9 | 0 |
| 0.9-0.95 | 0 |
| 0.95-1 | 0 |
| Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
| 0.5854 |
Remote Similarity |
NPD3728 |
Approved |