NPASS Compound

Natural Product: NPC600293

Natural Product ID	NPC600293
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NXWBRHQQKIQDCN-UXKPDXCRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1159435
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 144152 0 0 0 0 0 0 0 0999 V2000 -4.1580 -2.8663 -3.0253 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2370 -3.5565 -2.0466 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0944 -2.8009 -1.9123 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1003 -2.0077 -0.7534 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1694 -1.0160 -1.0076 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0195 -1.1234 -0.2665 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2039 -1.4038 -1.0837 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7730 -0.2424 -1.8161 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1707 0.8949 -0.8742 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6909 2.1480 -1.5042 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6189 0.5856 0.4919 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9577 1.6352 1.4718 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4805 1.5192 1.7075 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2381 1.6166 0.4077 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3705 3.0684 0.0801 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6722 0.8055 -0.7038 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4531 1.0239 -1.9246 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7342 1.3184 -1.8218 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4695 1.4522 -0.5659 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9365 2.7635 -0.5079 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0467 2.8388 0.2745 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4289 1.4248 0.6701 C 0 0 2 0 0 0 0 0 0 0 0 0 9.8894 1.1892 0.7437 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3661 0.0734 -0.1249 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9029 0.1428 -1.5452 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7925 -1.2769 -2.0736 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9260 0.8416 -2.4431 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5947 0.8790 -1.7227 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7513 0.6742 -0.4814 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7212 1.1212 1.9483 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2958 1.9785 2.9225 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2600 1.4909 1.9156 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6429 1.0510 0.6355 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6143 -0.4712 0.6745 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1991 0.1407 0.5489 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8063 1.1975 0.1698 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0770 -0.1824 2.0341 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7635 -1.1489 2.5241 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4740 -1.5200 -0.4321 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5008 -0.6968 0.6895 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4106 -2.6665 -0.0979 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7431 -2.4086 -0.3527 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5415 -2.4716 0.7650 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2814 -3.6443 0.7193 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1955 -3.7556 1.7415 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.9800 -5.0370 1.6938 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8972 -5.1326 2.7320 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1414 -2.6081 1.8915 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0523 -2.8661 2.8882 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2514 -1.4057 2.2400 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0764 -0.3237 2.4027 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3194 -1.2627 1.0544 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5914 -0.1011 1.2248 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9613 0.9090 0.3699 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9712 1.2939 -0.5323 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5622 2.1483 -1.4659 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7316 2.0820 -2.7262 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7343 0.7596 -3.1836 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5838 3.5317 -0.8578 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6288 4.3065 -1.3600 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6699 3.3790 0.6419 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4039 3.2619 1.2194 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4661 2.1544 1.0594 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8217 2.3772 0.8722 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9585 -3.8981 -0.7992 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0736 -4.6841 -1.1820 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4131 -3.5226 -3.9075 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6374 -1.9858 -3.4938 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1297 -2.5613 -2.5897 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9660 -4.5413 -2.5377 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7540 -2.7162 0.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0776 -1.9860 0.4589 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9225 -2.1652 -1.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9525 -1.9092 -0.4363 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6365 -0.5980 -2.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0134 0.0895 -2.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3570 2.3445 -2.4003 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5771 3.0249 -0.8794 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6864 1.9821 -1.9981 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2155 -0.3361 0.8163 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8180 2.6738 1.1112 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5008 1.5113 2.4452 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7405 2.4186 2.3235 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7055 0.6362 2.3030 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1683 3.5704 0.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5805 3.3155 -0.9562 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4546 3.6631 0.3801 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8298 -0.2992 -0.4601 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9832 0.9458 -2.8872 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2842 1.4742 -2.7522 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9453 3.5001 1.1573 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8923 3.2367 -0.3223 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4836 2.1257 0.5670 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1337 0.9079 1.8022 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1696 -0.9104 0.3714 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4917 0.1425 -0.1549 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8194 -1.6031 -2.3198 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1648 -1.3252 -2.9855 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4366 -1.9879 -1.2846 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6863 1.9280 -2.4643 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9329 0.6158 -2.0564 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7880 0.4795 -3.4789 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0550 0.4010 -2.5649 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7077 1.9499 -1.9052 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6586 -0.3867 -0.2763 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9233 0.1034 2.3309 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6755 2.0960 3.6871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7745 0.8794 2.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1099 2.5325 2.1895 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7205 -0.8459 1.2571 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4749 -0.8506 1.3035 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7208 -0.9477 -0.2986 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5882 1.2422 0.9549 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3918 2.2222 0.1256 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3533 0.9318 -0.7708 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2489 0.6960 2.6396 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1035 -0.6862 1.9784 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3012 -1.6007 3.2878 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8601 -0.9796 -1.3167 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6811 0.2368 0.4777 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3436 -2.8978 1.0114 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8410 -2.6615 1.6350 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5877 -3.7882 2.6949 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2569 -5.8731 1.7989 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4384 -5.1677 0.6899 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9397 -6.0610 3.0319 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6031 -2.3824 0.9129 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9572 -2.6654 2.5431 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6569 -1.6901 3.1169 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8882 -0.5328 2.9314 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0276 -1.0608 0.1916 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8070 0.5231 -0.2645 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5833 1.8043 -1.7378 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1967 2.6933 -3.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6732 2.3383 -2.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6231 0.4878 -3.5107 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5910 3.9960 -1.0927 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1060 3.7406 -2.0188 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2033 4.2535 1.0452 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5390 3.2702 2.2039 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2920 2.0246 2.1510 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2545 2.7919 1.6619 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3372 -4.5490 -0.1466 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8209 -5.2254 -1.9782 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 6 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 6 14 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 1 20 21 1 0 22 21 1 6 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 25 28 1 0 28 29 1 0 22 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 1 11 35 1 0 35 36 1 6 35 37 1 0 37 38 1 0 4 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 41 65 1 0 65 66 1 0 65 2 1 0 35 6 1 0 52 43 1 0 63 54 1 0 16 9 1 0 29 19 1 0 33 14 1 0 33 19 1 0 29 22 1 0 1 67 1 0 1 68 1 0 1 69 1 0 2 70 1 6 4 71 1 1 6 72 1 1 7 73 1 0 7 74 1 0 8 75 1 0 8 76 1 0 10 77 1 0 10 78 1 0 10 79 1 0 11 80 1 0 12 81 1 0 12 82 1 0 13 83 1 0 13 84 1 0 15 85 1 0 15 86 1 0 15 87 1 0 16 88 1 0 17 89 1 0 18 90 1 0 21 91 1 0 21 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 26 97 1 0 26 98 1 0 26 99 1 0 27100 1 0 27101 1 0 27102 1 0 28103 1 0 28104 1 0 29105 1 0 30106 1 1 31107 1 0 32108 1 0 32109 1 0 34110 1 0 34111 1 0 34112 1 0 36113 1 0 36114 1 0 36115 1 0 37116 1 0 37117 1 0 38118 1 0 39119 1 6 40120 1 0 41121 1 1 43122 1 1 45123 1 1 46124 1 0 46125 1 0 47126 1 0 48127 1 6 49128 1 0 50129 1 1 51130 1 0 52131 1 6 54132 1 6 56133 1 6 57134 1 0 57135 1 0 58136 1 0 59137 1 1 60138 1 0 61139 1 1 62140 1 0 63141 1 1 64142 1 0 65143 1 1 66144 1 0 M END

Standard InCHIKey	NXWBRHQQKIQDCN-UXKPDXCRSA-N
Standard InCHI	InChI=1S/C48H78O18/c1-22-30(53)37(65-41-38(34(57)32(55)24(19-50)63-41)66-39-35(58)33(56)31(54)23(18-49)62-39)36(59)40(61-22)64-29-10-11-43(4)25(44(29,5)20-51)8-12-45(6)26(43)9-13-48-27-16-42(2,3)14-15-47(27,21-60-48)28(52)17-46(45,48)7/h9,13,22-41,49-59H,8,10-12,14-21H2,1-7H3/t22-,23-,24-,25?,26?,27?,28+,29+,30+,31-,32-,33+,34+,35-,36-,37+,38-,39+,40+,41+,43+,44+,45-,46+,47-,48+/m1/s1
SMILES	C[C@H]1O[C@@H](O[C@H]2CC[C@@]3(C)C(CC[C@]4(C)C3C=C[C@]35OC[C@@]6(CCC(C)(C)CC63)[C@@H](O)C[C@]54C)[C@]2(C)CO)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	942.52	Volume:	917.343 ? Van der Waals volume.
Dense:	1.027	LogP:	-0.116 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.835 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.851 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	47.0
TPSA:	287.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	11.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.104	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.702	Fsp³:	0.958
MCE-18:	256.085 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.705	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.012 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.052 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.197	Promiscuous compounds:	0.069

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.58	MDCK Permeability:	-4.988
Pgp-inhibitor:	0.0	Pgp-substrate:	0.268
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.128
20% Bioavailability (F20%):	0.113	30% Bioavailability (F30%):	0.982
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.008	MRP1:	0.024
Plasma Protein Binding (PPB):	74.679%	Volume Distribution (VD):	-0.487
Fu:	19.367% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.003
BSEP inhibitor:	0.061

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.039	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.235
HLM stability:	0.012 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.099

Half-life (T1/2):

4.359

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.019
Human Hepatotoxicity (H-HT):	0.491	Drug-induced Liver Injury (DILI):	0.491
AMES Toxicity:	0.83	Rat Oral Acute Toxicity:	0.008
Maximum Recommended Daily Dose:	0.014	Skin Sensitization:	1.0
Carcinogencity:	0.158	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.058	Drug-induced Nephrotoxicity:	0.787
Genotoxicity:	0.039	RPMI-8226 Immunitoxicity:	0.192
A549 Cytotoxicity:	0.176	Hek293 Cytotoxicity:	0.435
BCF:	1.15 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.527 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.027 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.022 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO51841	Bupleurum spinosum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	5

Activity Type	# Activity
Organism	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT29	Organism	Rattus norvegicus	Rattus norvegicus	Inhibition	=	-7.8	%	DOI[10.1016/S0960-894X(97)00418-6]
NPT29	Organism	Rattus norvegicus	Rattus norvegicus	Inhibition	=	-6.5	%	DOI[10.1016/S0960-894X(97)00418-6]
NPT29	Organism	Rattus norvegicus	Rattus norvegicus	Inhibition	=	-12.2	%	DOI[10.1016/S0960-894X(97)00418-6]
NPT29	Organism	Rattus norvegicus	Rattus norvegicus	Inhibition	=	-5.4	%	DOI[10.1016/S0960-894X(97)00418-6]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC600293 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26083
0.1-0.2	20482
0.2-0.3	2397
0.3-0.4	740
0.4-0.5	116
0.5-0.6	22
0.6-0.7	2
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	3
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9667	High Similarity	NPC476305
0.9091	High Similarity	NPC180459
0.9091	High Similarity	NPC195116
0.9091	High Similarity	NPC221110
0.8602	High Similarity	NPC44298
0.8261	Intermediate Similarity	NPC285253
0.7917	Intermediate Similarity	NPC473128
0.7755	Intermediate Similarity	NPC40133
0.7755	Intermediate Similarity	NPC49413
0.764	Intermediate Similarity	NPC38376
0.764	Intermediate Similarity	NPC80210
0.7526	Intermediate Similarity	NPC110494
0.75	Intermediate Similarity	NPC290608
0.7172	Intermediate Similarity	NPC473130
0.6495	Remote Similarity	NPC473125
0.6476	Remote Similarity	NPC157474
0.5929	Remote Similarity	NPC471373
0.5625	Remote Similarity	NPC171741
0.5614	Remote Similarity	NPC253611
0.5614	Remote Similarity	NPC488782
0.5484	Remote Similarity	NPC92885
0.5472	Remote Similarity	NPC109792
0.5472	Remote Similarity	NPC57065
0.5472	Remote Similarity	NPC54521
0.5431	Remote Similarity	NPC77717
0.5424	Remote Similarity	NPC475630
0.5321	Remote Similarity	NPC473127
0.5321	Remote Similarity	NPC110656
0.5278	Remote Similarity	NPC162354
0.5263	Remote Similarity	NPC323231
0.525	Remote Similarity	NPC471374
0.5207	Remote Similarity	NPC209798
0.5179	Remote Similarity	NPC18724
0.5169	Remote Similarity	NPC267238
0.5091	Remote Similarity	NPC473126
0.5085	Remote Similarity	NPC158367
0.5079	Remote Similarity	NPC189575
0.5042	Remote Similarity	NPC470623

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC600293 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7821
0.1-0.2	1281
0.2-0.3	47
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data