NPASS Compound

Natural Product: NPC600079

Natural Product ID	NPC600079
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	APKNPYLTWRYLIE-UXQKBCBTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL4170553
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 122123 0 0 0 0 0 0 0 0999 V2000 3.6812 -6.1612 2.3301 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3381 -4.8622 2.6270 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3338 -3.8286 1.5671 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9791 -4.3854 0.3274 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1186 -2.9929 1.3727 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2926 -2.0361 0.2900 N 0 0 0 0 0 0 0 0 0 0 0 0 3.3153 -0.6442 0.4928 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1657 -0.3571 1.7034 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4757 0.4450 -0.4701 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8406 0.5021 -1.0485 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3492 -0.6191 -1.7973 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1151 -1.6229 -1.2566 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5942 -2.6744 -2.0512 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3182 -2.7395 -3.3836 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5548 -1.7466 -3.9391 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0827 -0.7096 -3.1554 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2091 1.6750 0.3091 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1534 2.5114 -0.0123 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5067 2.1488 -1.0124 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7141 3.7619 0.6913 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6936 4.8611 0.7421 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9493 4.4591 1.4701 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0598 5.9758 1.5925 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9795 7.1506 1.7088 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4431 4.2017 0.1079 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7236 3.4974 0.4158 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5487 2.5043 1.1333 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1130 3.8048 -0.0258 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0860 4.2930 -1.4195 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5275 3.3512 -2.4258 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4470 4.8028 -1.8932 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8632 2.6369 0.2425 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.7270 2.3821 1.3146 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8511 3.2808 2.0989 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4460 1.0742 1.4740 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8899 1.2025 1.7778 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6656 1.9455 0.7122 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1930 1.7380 3.1329 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6852 1.8314 3.3581 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1527 0.2337 0.3311 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2114 -0.8203 0.3326 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6512 -0.9139 1.4551 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8843 -1.7143 -0.7991 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0287 -2.6015 -1.2461 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2605 -1.8024 -1.6737 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6196 -3.3180 -2.5268 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3124 -2.3276 -3.6595 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7187 -2.4304 -0.3687 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5705 -3.7673 -0.0241 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6259 -4.4102 0.0146 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3056 -4.4745 0.3002 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2506 -5.6684 -0.6551 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8921 -3.7061 0.2541 N 0 0 0 0 0 0 0 0 0 0 0 0 1.8328 -3.7126 1.3179 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4455 -4.4266 2.2550 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4512 -7.0016 2.4104 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1512 -6.2429 1.3732 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9752 -6.4094 3.1434 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3871 -5.0911 2.9954 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8665 -4.4015 3.5349 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1782 -3.0931 1.9340 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4967 -4.0387 -0.6077 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0763 -4.3285 0.3051 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7626 -5.4977 0.3432 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0392 -2.3800 2.3409 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3982 -2.3362 -0.6516 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7038 0.3360 -1.2672 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8708 1.4543 -1.6762 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6149 0.7488 -0.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3626 -1.6212 -0.2099 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1994 -3.4681 -1.6307 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6935 -3.5603 -3.9976 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3365 -1.7982 -4.9923 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4811 0.0736 -3.5919 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7959 1.8926 1.0802 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5163 3.3921 1.7526 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9289 5.2964 -0.2617 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4672 5.3787 1.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7231 4.0135 0.8159 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7217 3.8481 2.3441 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9156 5.5213 2.6030 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0655 6.2139 1.1914 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3516 8.0791 1.6004 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4437 7.2414 2.7218 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7302 7.1986 0.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3981 4.9805 -0.4955 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4549 4.6716 0.6361 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4274 5.2129 -1.4332 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0895 3.3911 -3.3871 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4633 3.5985 -2.7140 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5041 2.2960 -2.1044 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6886 5.7916 -1.4612 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4707 4.9188 -2.9960 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2477 4.0469 -1.6583 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7886 1.8480 -0.4191 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9380 0.6275 2.3881 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3270 0.1544 1.7564 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4872 3.0377 0.7985 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7491 1.7785 0.9312 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4825 1.5512 -0.2881 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8143 0.9835 3.8832 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7509 2.7215 3.2763 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8488 1.8986 4.4533 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1362 2.7155 2.9022 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1196 0.8702 3.0326 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6097 0.3824 -0.5429 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6775 -1.1073 -1.7233 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3939 -3.2520 -0.4532 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0634 -0.9809 -2.3416 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8727 -2.5660 -2.2592 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9167 -1.5243 -0.8541 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4782 -3.9210 -2.9153 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6963 -3.9103 -2.4561 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3424 -1.8350 -3.5476 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1586 -3.0226 -4.5515 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1583 -1.7118 -3.9460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8415 -1.8808 -0.2935 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4686 -4.9620 1.3068 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2435 -6.1717 -0.5476 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1175 -5.3304 -1.6849 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5042 -6.3998 -0.3165 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1452 -3.1180 -0.5207 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 9 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 20 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 28 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 35 40 1 0 40 41 1 0 41 42 2 0 41 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 43 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 54 55 2 0 54 5 1 0 16 11 1 0 1 56 1 0 1 57 1 0 1 58 1 0 2 59 1 0 2 60 1 0 3 61 1 1 4 62 1 0 4 63 1 0 4 64 1 0 5 65 1 1 6 66 1 0 9 67 1 6 10 68 1 0 10 69 1 0 12 70 1 0 13 71 1 0 14 72 1 0 15 73 1 0 16 74 1 0 17 75 1 0 20 76 1 1 21 77 1 6 22 78 1 0 22 79 1 0 22 80 1 0 23 81 1 0 23 82 1 0 24 83 1 0 24 84 1 0 24 85 1 0 25 86 1 0 28 87 1 1 29 88 1 0 30 89 1 0 30 90 1 0 30 91 1 0 31 92 1 0 31 93 1 0 31 94 1 0 32 95 1 0 35 96 1 1 36 97 1 1 37 98 1 0 37 99 1 0 37100 1 0 38101 1 0 38102 1 0 39103 1 0 39104 1 0 39105 1 0 40106 1 0 43107 1 6 44108 1 1 45109 1 0 45110 1 0 45111 1 0 46112 1 0 46113 1 0 47114 1 0 47115 1 0 47116 1 0 48117 1 0 51118 1 1 52119 1 0 52120 1 0 52121 1 0 53122 1 0 M END

Standard InCHIKey	APKNPYLTWRYLIE-UXQKBCBTSA-N
Standard InCHI	InChI=1S/C41H67N7O7/c1-12-23(7)31-38(52)42-27(11)35(49)45-33(25(9)14-3)41(55)48-34(26(10)15-4)40(54)44-30(22(5)6)37(51)47-32(24(8)13-2)39(53)43-29(36(50)46-31)21-28-19-17-16-18-20-28/h16-20,22-27,29-34H,12-15,21H2,1-11H3,(H,42,52)(H,43,53)(H,44,54)(H,45,49)(H,46,50)(H,47,51)(H,48,55)/t23-,24-,25+,26-,27-,29+,30-,31-,32-,33+,34-/m1/s1
SMILES	CC[C@@H](C)[C@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]([C@H](C)CC)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]([C@H](C)CC)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H](C)NC1=O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	769.51	Volume:	812.723 ? Van der Waals volume.
Dense:	0.947	LogP:	2.568 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.496 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.749 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	34.0
TPSA:	203.7 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	7.0	Rings:	2.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.179	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.394	Fsp³:	0.683
MCE-18:	83.275 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.547	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.312 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.393 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.011	Promiscuous compounds:	0.094

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.584	MDCK Permeability:	-4.972
Pgp-inhibitor:	1.0	Pgp-substrate:	0.002
PAMPA:	0.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.985
20% Bioavailability (F20%):	0.923	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	95.593%	Volume Distribution (VD):	-0.453
Fu:	3.047% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.005
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.617
CYP2C19-inhibitor:	0.157	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.997
CYP3A4-inhibitor:	0.043	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.161 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.217

Half-life (T1/2):

1.015

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.876	Drug-induced Liver Injury (DILI):	0.029
AMES Toxicity:	0.001	Rat Oral Acute Toxicity:	0.019
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	0.999
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.025
Drug-induced Neurotoxicity:	0.018	Ototoxicity:	0.924
Hematotoxicity:	0.646	Drug-induced Nephrotoxicity:	0.976
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.693
A549 Cytotoxicity:	0.001	Hek293 Cytotoxicity:	0.001
BCF:	0.395 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.16 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.199 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.713 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO49145	Mortierella sp.	Species	Mortierellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	9

Activity Type	# Activity
Cell line	3
Unchecked	1
Organism	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1160	Cell line	BJ	Homo sapiens	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT83	Cell line	MCF7	Homo sapiens	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT28438	Unchecked	Unchecked	n.a.	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT20	Organism	Candida albicans	Candida albicans	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT5312	Organism	Staphylococcus warneri	Staphylococcus warneri	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT29584	Cell line	Keratinocyte	Homo sapiens	Activity	n.a.	n.a.	n.a.	PMID[28921982]
NPT1531	Organism	Enterococcus faecium	Enterococcus faecium	Activity	n.a.	n.a.	n.a.	PMID[28921982]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC600079 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24414
0.1-0.2	23982
0.2-0.3	1244
0.3-0.4	145
0.4-0.5	42
0.5-0.6	16
0.6-0.7	6
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.878	High Similarity	NPC473501
0.8542	High Similarity	NPC606917
0.8049	Intermediate Similarity	NPC602289
0.75	Intermediate Similarity	NPC605567
0.7273	Intermediate Similarity	NPC609985
0.7083	Intermediate Similarity	NPC602452
0.7083	Intermediate Similarity	NPC607209
0.6481	Remote Similarity	NPC600760
0.6481	Remote Similarity	NPC607773
0.6296	Remote Similarity	NPC610863
0.6167	Remote Similarity	NPC602991
0.6071	Remote Similarity	NPC608836
0.6042	Remote Similarity	NPC606945
0.5932	Remote Similarity	NPC610885
0.5873	Remote Similarity	NPC600670
0.5873	Remote Similarity	NPC607589
0.5846	Remote Similarity	NPC601721
0.5652	Remote Similarity	NPC476990
0.5574	Remote Similarity	NPC611366
0.5538	Remote Similarity	NPC600428
0.5507	Remote Similarity	NPC476989
0.5429	Remote Similarity	NPC601302
0.541	Remote Similarity	NPC601903
0.5357	Remote Similarity	NPC603846
0.5224	Remote Similarity	NPC600414
0.5211	Remote Similarity	NPC610128
0.5122	Remote Similarity	NPC607518
0.5075	Remote Similarity	NPC603874
0.5075	Remote Similarity	NPC603975

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC600079 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3096
0.1-0.2	5641
0.2-0.3	409
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data