NPASS Compound

Natural Product: NPC582373

Natural Product ID	NPC582373
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	2,6,6-trimethyl-1-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexa-1,3-diene
IUPAC Name	2,6,6-trimethyl-1-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexa-1,3-diene
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 94 95 0 0 0 0 0 0 0 0999 V2000 3.1469 1.9458 -4.1880 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3891 1.4097 -3.0597 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1474 0.7756 -1.9539 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4503 0.6565 -2.0863 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3530 0.0721 -1.1087 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6355 -0.0199 -1.3065 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2922 0.4542 -2.5431 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5736 -0.5487 -0.2721 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8452 -0.6068 -0.5421 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9244 -1.0649 0.3018 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1409 -1.0202 -0.2530 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2470 -0.5152 -1.6755 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3573 -1.3508 0.4713 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2226 -1.6960 1.7214 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9725 -1.7772 2.4561 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7396 -1.5718 1.6641 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0550 -2.9569 1.5240 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7399 -0.7144 2.4633 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0819 1.5313 -2.9706 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3042 2.2008 -3.9616 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0213 2.3157 -3.8744 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7423 1.7694 -2.7894 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0716 1.8558 -2.6241 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8537 2.5775 -3.6410 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5984 1.1717 -1.4676 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7860 1.0658 -1.0153 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9945 1.6248 -1.5484 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1706 1.4415 -0.9976 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3581 2.0792 -1.6371 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3500 0.6036 0.1777 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5169 0.4311 0.7441 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8400 -0.3733 1.9063 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1516 -0.3595 2.2766 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1119 0.4730 1.4592 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7451 -1.0779 3.3906 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7451 -1.8184 4.2424 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3986 -1.1848 4.1690 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9576 -1.2105 2.6927 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5011 -0.9312 2.7262 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1198 -2.6671 2.2425 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6237 2.5718 -4.8993 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6839 1.1092 -4.7064 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9610 2.5843 -3.7487 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6112 0.4413 -1.0817 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8964 1.0104 -2.9963 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8817 -0.2842 -0.1953 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0137 1.2612 -2.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6597 0.9637 -3.2674 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8379 -0.3741 -3.0625 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0878 -0.8652 0.6240 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0913 -0.2529 -1.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9054 0.5156 -1.7892 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7031 -1.2126 -2.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3261 -0.5547 -1.9442 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3122 -1.2984 -0.0344 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1783 -1.9495 2.2733 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9034 -2.7492 3.0516 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9894 -0.9491 3.2543 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2338 -2.9394 0.8015 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8562 -3.6878 1.2238 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6427 -3.2808 2.5075 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8750 -1.2896 2.7971 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2765 -0.4332 3.4277 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5605 0.2451 1.9761 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5849 1.0923 -2.0981 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7464 2.6584 -4.8606 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4791 2.8648 -4.7155 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2519 1.2195 -1.9787 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2117 2.9716 -4.4648 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3113 3.4724 -3.1948 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5646 1.8942 -4.1578 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8207 0.6130 -0.8278 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8670 0.4473 -0.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9649 2.2346 -2.4457 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7674 2.8974 -1.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1667 1.2949 -1.7450 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1214 2.3879 -2.6946 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5145 0.1127 0.5732 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3212 0.9948 0.2386 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2451 0.0705 0.4386 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8023 1.5314 1.4687 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1053 0.4508 1.9443 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3657 -0.4003 4.0530 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4671 -1.8301 3.0048 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0814 -1.8005 5.3159 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6826 -2.8758 3.9476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7036 -1.8372 4.7540 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4051 -0.1340 4.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1291 -1.4278 3.7032 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9640 -1.5512 1.9721 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1765 0.0944 2.8417 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1645 -2.7718 1.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4376 -2.8670 1.3763 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9341 -3.3791 3.0683 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 3 4 5 1 0 5 6 2 3 6 7 1 0 6 8 1 0 8 9 2 3 9 10 1 0 10 11 2 0 11 12 1 0 11 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 2 19 2 3 19 20 1 0 20 21 2 3 21 22 1 0 22 23 2 3 23 24 1 0 23 25 1 0 25 26 2 3 26 27 1 0 27 28 2 3 28 29 1 0 28 30 1 0 30 31 2 3 31 32 1 0 32 33 2 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 16 10 1 0 38 32 1 0 1 41 1 0 1 42 1 0 1 43 1 0 3 44 1 0 4 45 1 0 5 46 1 0 7 47 1 0 7 48 1 0 7 49 1 0 8 50 1 0 9 51 1 0 12 52 1 0 12 53 1 0 12 54 1 0 13 55 1 0 14 56 1 0 15 57 1 0 15 58 1 0 17 59 1 0 17 60 1 0 17 61 1 0 18 62 1 0 18 63 1 0 18 64 1 0 19 65 1 0 20 66 1 0 21 67 1 0 22 68 1 0 24 69 1 0 24 70 1 0 24 71 1 0 25 72 1 0 26 73 1 0 27 74 1 0 29 75 1 0 29 76 1 0 29 77 1 0 30 78 1 0 31 79 1 0 34 80 1 0 34 81 1 0 34 82 1 0 35 83 1 0 35 84 1 0 36 85 1 0 36 86 1 0 37 87 1 0 37 88 1 0 39 89 1 0 39 90 1 0 39 91 1 0 40 92 1 0 40 93 1 0 40 94 1 0 M END

Standard InCHIKey	SONVPQQKNKXERO-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C40H54/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-15,17-23,25-28H,16,24,29-30H2,1-10H3
SMILES	CC(C=CC=C(C)C=CC1=C(C)C=CCC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	534.42	Volume:	651.645 ? Van der Waals volume.
Dense:	0.82	LogP:	12.206 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	7.078 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-11.49 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	21.0
TPSA:	0.0 ? Topological Polar Surface Area.	H-Bond Acceptor:	0.0
H-Bond Donor:	0.0	Rings:	2.0
Heavy Atoms:	0.0

MedChem Properties

QED Drug-Likeness Score:	0.244	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	3.992	Fsp³:	0.4
MCE-18:	24.286 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	1.0	Fluc inhibitor:	0.659 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.02 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.004 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.671	Promiscuous compounds:	0.186

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.907	MDCK Permeability:	-4.761
Pgp-inhibitor:	0.928	Pgp-substrate:	0.484
PAMPA:	0.048 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.011	30% Bioavailability (F30%):	0.269
50% Bioavailability (F50%):	0.984

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.994	MRP1:	0.995
Plasma Protein Binding (PPB):	97.126%	Volume Distribution (VD):	0.618
Fu:	2.739% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.972
OATP1B3 inhibitor:	0.05	BCRP inhibitor:	0.006
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	1.0	CYP1A2-substrate:	1.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.856
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.022
CYP2D6-inhibitor:	0.982	CYP2D6-substrate:	0.999
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	1.0	CYP2C8-inhibitor:	1.0
HLM stability:	1.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

8.534

Half-life (T1/2):

0.153

ADMET: Toxicity

hERG Blockers:	0.385	hERG Blockers (10um):	0.668
Human Hepatotoxicity (H-HT):	0.334	Drug-induced Liver Injury (DILI):	0.17
AMES Toxicity:	0.836	Rat Oral Acute Toxicity:	0.884
Maximum Recommended Daily Dose:	0.981	Skin Sensitization:	0.994
Carcinogencity:	0.871	Eye Corrosion:	0.002
Eye Irritation:	0.283	Respiratory Toxicity:	0.949
Drug-induced Neurotoxicity:	0.729	Ototoxicity:	0.42
Hematotoxicity:	0.162	Drug-induced Nephrotoxicity:	0.898
Genotoxicity:	0.846	RPMI-8226 Immunitoxicity:	0.247
A549 Cytotoxicity:	0.335	Hek293 Cytotoxicity:	0.763
BCF:	3.899 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.201 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.763 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	6.685 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17711348]
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19919067]
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	The fungus is isolated from the leaves of L. rhodostegia, collected in June 2007 at Nanning, Guangxi Province, China	2007-JUN	PMID[20550196]
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24328302]
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Title]
NPO18557	Epicoccum nigrum	Species	Didymellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC582373 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	41605
0.1-0.2	8156
0.2-0.3	64
0.3-0.4	9
0.4-0.5	12
0.5-0.6	6
0.6-0.7	5
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7941	Intermediate Similarity	NPC17810
0.7941	Intermediate Similarity	NPC606095
0.65	Remote Similarity	NPC22019
0.65	Remote Similarity	NPC281986
0.65	Remote Similarity	NPC321568
0.6341	Remote Similarity	NPC55412
0.6341	Remote Similarity	NPC249645
0.5745	Remote Similarity	NPC254886
0.5532	Remote Similarity	NPC226066
0.5435	Remote Similarity	NPC329416
0.5435	Remote Similarity	NPC317025
0.5435	Remote Similarity	NPC326645
0.5435	Remote Similarity	NPC317177

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC582373 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8760
0.1-0.2	377
0.2-0.3	0
0.3-0.4	2
0.4-0.5	4
0.5-0.6	5
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7941	Intermediate Similarity	NPD8262	Phase 4
0.6341	Remote Similarity	NPD4219	Phase 4
0.5532	Remote Similarity	NPD5325	Clinical (unspecified phase)
0.5435	Remote Similarity	NPD4191	Approved
0.5435	Remote Similarity	NPD4192	Phase 4
0.5435	Remote Similarity	NPD4193	Phase 4
0.5435	Remote Similarity	NPD4194	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data