NPASS Compound

Natural Product: NPC546553

Natural Product ID	NPC546553
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	2-(3-hydroxy-4-methoxy-phenyl)-7-methoxy-5-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{R},5~{S})-3,4,5-trihydroxytetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxy-chromen-4-one
IUPAC Name	2-(3-hydroxy-4-methoxy-phenyl)-7-methoxy-5-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{R},5~{S})-3,4,5-trihydroxytetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxy-chromen-4-one
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 75 79 0 0 0 0 0 0 0 0999 V2000 4.5675 5.3809 1.3262 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2376 4.9397 1.4994 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9067 3.6591 1.0811 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5911 3.2286 1.2518 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1703 1.9750 0.8655 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0932 1.5136 1.0101 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2137 2.1308 1.5922 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7099 1.2810 2.5251 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9737 0.8083 2.4080 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9889 -0.3880 1.4932 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2913 -0.8766 1.3575 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3212 -1.9727 0.4892 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7379 -3.1384 1.0703 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0811 -3.2949 1.2449 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9384 -2.9353 0.0623 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8927 -3.9203 -0.2321 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1172 -2.5790 -1.1668 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9139 -1.9466 -2.1276 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1146 -1.5381 -0.7136 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7685 -0.3226 -0.4734 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0138 1.8337 2.0955 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6711 2.3041 3.2404 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4780 2.9975 1.2991 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4341 3.4112 0.3417 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1678 2.7027 0.6084 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6376 3.9355 0.1871 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1076 1.1323 0.2910 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7531 -0.1271 -0.1117 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5773 -0.5075 0.0442 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7360 -0.9351 -0.6828 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0327 -0.4974 -0.8454 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0659 -1.3544 -1.4471 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3434 -0.8473 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3807 -1.5731 -2.1487 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1411 -2.8672 -2.5691 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1730 -3.6276 -3.1307 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4728 -3.0996 -3.2887 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8824 -3.3925 -2.4272 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6171 -4.6956 -2.8456 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8399 -2.6404 -1.8667 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3016 0.7158 -0.4386 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4327 1.5403 0.1099 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8326 2.8004 0.5038 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5937 6.4910 1.5184 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9816 5.1629 0.3156 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2778 4.9575 2.0659 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9151 3.9444 1.7085 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7966 3.0225 2.1588 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2496 0.3975 3.4296 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6163 -0.1686 0.4743 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3309 -1.2088 1.8630 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2499 -2.1441 0.1536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4546 -2.8081 2.1889 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2639 -4.3918 1.4334 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5332 -2.0032 0.3002 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4993 -4.6181 -0.8164 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5733 -3.4422 -1.5779 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4504 -1.2289 -1.7295 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4153 -1.3321 -1.5408 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2818 -0.3640 0.3776 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7965 1.3467 1.4765 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2859 1.5786 3.5245 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3652 3.8638 1.9776 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4259 4.3849 0.2248 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4105 2.0609 -0.2648 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7721 4.5856 0.9522 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4107 -1.9134 -0.9840 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5324 0.1705 -1.2697 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3722 -1.1539 -2.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1253 -3.9828 -3.5717 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8189 -2.6373 -2.3544 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5141 -2.3922 -4.1467 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8846 -5.4615 -2.2175 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8634 -3.0648 -1.7646 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8771 3.1357 0.3649 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 9 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 5 27 2 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 1 0 35 38 1 0 38 39 1 0 38 40 2 0 31 41 1 0 41 42 1 0 42 43 2 0 43 3 1 0 25 7 1 0 42 27 1 0 19 12 1 0 40 32 1 0 1 44 1 0 1 45 1 0 1 46 1 0 4 47 1 0 7 48 1 1 9 49 1 1 10 50 1 0 10 51 1 0 12 52 1 6 14 53 1 0 14 54 1 0 15 55 1 1 16 56 1 0 17 57 1 6 18 58 1 0 19 59 1 6 20 60 1 0 21 61 1 6 22 62 1 0 23 63 1 1 24 64 1 0 25 65 1 6 26 66 1 0 30 67 1 0 33 68 1 0 34 69 1 0 37 70 1 0 37 71 1 0 37 72 1 0 39 73 1 0 40 74 1 0 43 75 1 0 M END

Standard InCHIKey	QPXXNLYWPXJSCA-XRFMZOFTSA-N
Standard InCHI	InChI=1S/C28H32O15/c1-37-12-6-18-21(14(30)8-17(41-18)11-3-4-16(38-2)13(29)5-11)19(7-12)42-28-26(36)24(34)23(33)20(43-28)10-40-27-25(35)22(32)15(31)9-39-27/h3-8,15,20,22-29,31-36H,9-10H2,1-2H3/t15-,20+,22+,23+,24-,25+,26+,27+,28+/m0/s1
SMILES	COC1=CC(O[C@@H]2O[C@H](CO[C@H]3OC[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)=C2C(=O)C=C(C3=CC=C(OC)C(O)=C3)OC2=C1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	608.17	Volume:	560.823 ? Van der Waals volume.
Dense:	1.084	LogP:	0.886 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.408 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.496 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	30.0
TPSA:	227.2 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.16	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.62	Fsp³:	0.464
MCE-18:	115.098 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.628	Fluc inhibitor:	0.284 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.962 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.827 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.039	Promiscuous compounds:	0.275

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.19	MDCK Permeability:	-5.298
Pgp-inhibitor:	0.001	Pgp-substrate:	0.813
PAMPA:	0.993 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.033
20% Bioavailability (F20%):	0.038	30% Bioavailability (F30%):	0.482
50% Bioavailability (F50%):	0.99

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.069
Plasma Protein Binding (PPB):	76.407%	Volume Distribution (VD):	-0.266
Fu:	22.075% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.685
BSEP inhibitor:	0.779

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.012
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.016
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.997
HLM stability:	0.071 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.382

Half-life (T1/2):

4.709

ADMET: Toxicity

hERG Blockers:	0.025	hERG Blockers (10um):	0.256
Human Hepatotoxicity (H-HT):	0.547	Drug-induced Liver Injury (DILI):	0.881
AMES Toxicity:	0.879	Rat Oral Acute Toxicity:	0.036
Maximum Recommended Daily Dose:	0.181	Skin Sensitization:	0.977
Carcinogencity:	0.07	Eye Corrosion:	0.0
Eye Irritation:	0.477	Respiratory Toxicity:	0.037
Drug-induced Neurotoxicity:	0.003	Ototoxicity:	0.933
Hematotoxicity:	0.254	Drug-induced Nephrotoxicity:	0.644
Genotoxicity:	0.674	RPMI-8226 Immunitoxicity:	0.192
A549 Cytotoxicity:	0.095	Hek293 Cytotoxicity:	0.253
BCF:	0.326 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.973 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.46 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.724 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1618	Ovidia pillo-pillo	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1618	Ovidia pillo-pillo	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC546553 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20814
0.1-0.2	25239
0.2-0.3	2860
0.3-0.4	668
0.4-0.5	226
0.5-0.6	35
0.6-0.7	8
0.7-0.8	1
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8554	High Similarity	NPC295613
0.8353	Intermediate Similarity	NPC129827
0.8161	Intermediate Similarity	NPC284277
0.8118	Intermediate Similarity	NPC473657
0.7931	Intermediate Similarity	NPC473512
0.7816	Intermediate Similarity	NPC15358
0.7753	Intermediate Similarity	NPC475497
0.6842	Remote Similarity	NPC209296
0.6632	Remote Similarity	NPC475366
0.6383	Remote Similarity	NPC51774
0.6327	Remote Similarity	NPC51326
0.6304	Remote Similarity	NPC293004
0.6211	Remote Similarity	NPC236191
0.6022	Remote Similarity	NPC284960
0.6	Remote Similarity	NPC52353
0.5979	Remote Similarity	NPC301683
0.5918	Remote Similarity	NPC22062
0.5918	Remote Similarity	NPC473634
0.5918	Remote Similarity	NPC138811
0.5806	Remote Similarity	NPC182045
0.5728	Remote Similarity	NPC231194
0.57	Remote Similarity	NPC204693
0.5699	Remote Similarity	NPC610763
0.5684	Remote Similarity	NPC22832
0.5657	Remote Similarity	NPC142996
0.5631	Remote Similarity	NPC488089
0.56	Remote Similarity	NPC210073
0.5567	Remote Similarity	NPC194483
0.5534	Remote Similarity	NPC473623
0.5534	Remote Similarity	NPC483707
0.5534	Remote Similarity	NPC473327
0.55	Remote Similarity	NPC44931
0.549	Remote Similarity	NPC488074
0.5484	Remote Similarity	NPC110349
0.5437	Remote Similarity	NPC65711
0.5421	Remote Similarity	NPC244875
0.5398	Remote Similarity	NPC198199
0.5354	Remote Similarity	NPC211594
0.53	Remote Similarity	NPC254540
0.5294	Remote Similarity	NPC102028
0.5259	Remote Similarity	NPC120952
0.5253	Remote Similarity	NPC61791
0.5248	Remote Similarity	NPC471079
0.5234	Remote Similarity	NPC235575
0.5204	Remote Similarity	NPC605067
0.52	Remote Similarity	NPC172807
0.5196	Remote Similarity	NPC67326
0.5192	Remote Similarity	NPC46202
0.5093	Remote Similarity	NPC101636
0.5052	Remote Similarity	NPC229687

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC546553 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5220
0.1-0.2	3861
0.2-0.3	53
0.3-0.4	11
0.4-0.5	3
0.5-0.6	0
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7849	Intermediate Similarity	NPD7472	Pre-clinical
0.6842	Remote Similarity	NPD7054	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data