NPASS Compound

Natural Product: NPC488088

Natural Product ID	NPC488088
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LVOGUHTYJUNQSC-AIUGDTPHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 110115 0 0 0 0 0 0 0 0999 V2000 -2.2500 -13.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -13.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1595 -14.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3086 -13.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0481 -12.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6386 -11.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3886 -10.2356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6386 -8.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8886 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2981 -7.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5586 -5.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4095 -4.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -5.1962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7500 -1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7395 -6.6734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6595 -3.3841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4095 -2.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5586 -3.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9681 -2.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2286 -1.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0796 -0.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3296 1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5796 2.5033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0796 2.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3296 1.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3296 3.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6700 -0.6078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9786 0.2401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4681 -2.5362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2181 -3.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4681 -5.1343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7181 -3.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3086 -4.3483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3086 -4.3483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7981 -7.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4895 -12.4988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5481 -12.0477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0586 -14.8239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4095 -15.7881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1595 -17.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -17.0872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4095 -18.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -13.9761 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2500 -15.4761 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2500 -12.4761 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4895 -15.4533 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3086 -15.4533 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7181 -13.0119 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3086 -10.5705 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3806 -10.7177 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2578 -9.5226 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0194 -8.3505 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7395 -8.6017 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7367 -8.5590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0202 -5.9847 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7578 -4.0256 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7395 -3.7189 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -2.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2500 1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2500 -3.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 -3.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2500 -3.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7990 -1.8481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2010 -3.3481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -1.5720 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6770 -4.2628 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5783 -3.9065 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6382 -1.5720 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1025 1.0023 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5275 2.1070 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0305 0.4542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5796 5.1013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0305 3.0523 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6286 4.5523 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5652 1.6820 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2181 -3.8352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7181 -5.3352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7181 -2.3352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8086 -4.3483 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7640 -4.7112 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7009 -5.9266 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2981 -10.7487 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5586 -14.8239 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6595 -19.6852 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7086 -19.1362 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1105 -17.6362 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 19 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 2 0 26 29 1 0 29 30 1 0 22 31 1 0 31 32 1 0 32 33 2 0 17 34 1 0 13 35 1 0 12 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 41 47 1 0 40 48 1 0 39 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 38 53 1 0 11 54 1 0 10 55 1 0 6 56 1 0 5 57 1 0 4 58 1 0 3 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 56 2 1 0 35 9 1 0 47 37 1 0 33 15 1 0 32 18 1 0 28 23 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 6 3 67 1 1 4 68 1 6 5 69 1 6 6 70 1 1 8 71 1 0 8 72 1 0 9 73 1 1 10 74 1 6 11 75 1 1 12 76 1 6 13 77 1 1 16 78 1 0 21 79 1 0 24 80 1 0 25 81 1 0 27 82 1 0 28 83 1 0 30 84 1 0 30 85 1 0 30 86 1 0 33 87 1 0 34 88 1 0 37 89 1 6 38 90 1 1 39 91 1 6 40 92 1 1 41 93 1 6 42 94 1 0 42 95 1 0 46 96 1 0 46 97 1 0 46 98 1 0 48 99 1 0 52100 1 0 52101 1 0 52102 1 0 53103 1 0 54104 1 0 55105 1 0 57106 1 0 58107 1 0 62108 1 0 62109 1 0 62110 1 0 M END

Standard InCHIKey	LVOGUHTYJUNQSC-AIUGDTPHSA-N
Standard InCHI	InChI=1S/C40H48O22/c1-15-35(56-17(3)42)32(49)33(50)38(55-15)54-14-26-29(46)31(48)37(62-39-34(51)36(57-18(4)43)30(47)27(60-39)13-53-16(2)41)40(61-26)58-21-10-22(44)28-23(45)12-24(59-25(28)11-21)19-6-8-20(52-5)9-7-19/h6-12,15,26-27,29-40,44,46-51H,13-14H2,1-5H3/t15-,26+,27+,29+,30+,31-,32-,33+,34+,35-,36-,37+,38+,39-,40+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4c(=O)cc(c5ccc(cc5)OC)oc4c3)O)O2)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](COC(=O)C)O2)O)OC(=O)C)O)O)O)O1)O)O)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	880.26	Volume:	813.441 ? Van der Waals volume.
Dense:	1.082	LogP:	0.422 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.188 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.084 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	39.0
TPSA:	315.33 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	7.0	Rings:	6.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.078	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.548	Fsp³:	0.55
MCE-18:	153.29 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.734	Fluc inhibitor:	0.543 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.828 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.494 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.083	Promiscuous compounds:	0.405

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.139	MDCK Permeability:	-5.179
Pgp-inhibitor:	0.094	Pgp-substrate:	0.767
PAMPA:	0.995 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.996
20% Bioavailability (F20%):	0.823	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.548
Plasma Protein Binding (PPB):	74.344%	Volume Distribution (VD):	-0.409
Fu:	23.076% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.18

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.446
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.038
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.004
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.586 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.786

Half-life (T1/2):

3.745

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.028
Human Hepatotoxicity (H-HT):	0.334	Drug-induced Liver Injury (DILI):	0.998
AMES Toxicity:	0.979	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	0.997
Carcinogencity:	0.107	Eye Corrosion:	0.0
Eye Irritation:	0.006	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.981
Hematotoxicity:	0.381	Drug-induced Nephrotoxicity:	0.778
Genotoxicity:	0.783	RPMI-8226 Immunitoxicity:	0.151
A549 Cytotoxicity:	0.158	Hek293 Cytotoxicity:	0.206
BCF:	0.473 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.228 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.96 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.161 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	Aerial Parts	n.a.	n.a.	PMID[32991171]
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21355	Elsholtzia ciliata	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT804	Cell line	HT-22	Mus musculus	EC50	>	100000.0	nM	PMID[32991171]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488088 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16585
0.1-0.2	30082
0.2-0.3	2568
0.3-0.4	483
0.4-0.5	101
0.5-0.6	17
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8866	High Similarity	NPC488087
0.8137	Intermediate Similarity	NPC488086
0.8119	Intermediate Similarity	NPC488083
0.7624	Intermediate Similarity	NPC11468
0.7475	Intermediate Similarity	NPC488089
0.6972	Remote Similarity	NPC68592
0.6635	Remote Similarity	NPC479766
0.6609	Remote Similarity	NPC262222
0.6606	Remote Similarity	NPC473644
0.6545	Remote Similarity	NPC311850
0.6415	Remote Similarity	NPC479765
0.6316	Remote Similarity	NPC298666
0.6293	Remote Similarity	NPC120952
0.6154	Remote Similarity	NPC22062
0.6154	Remote Similarity	NPC473634
0.6154	Remote Similarity	NPC138811
0.61	Remote Similarity	NPC80188
0.6055	Remote Similarity	NPC101636
0.604	Remote Similarity	NPC220169
0.5926	Remote Similarity	NPC473623
0.5897	Remote Similarity	NPC198199
0.5596	Remote Similarity	NPC46202
0.5495	Remote Similarity	NPC209296
0.5351	Remote Similarity	NPC298171
0.534	Remote Similarity	NPC181712
0.5327	Remote Similarity	NPC211594
0.5321	Remote Similarity	NPC44931
0.5243	Remote Similarity	NPC95090
0.5243	Remote Similarity	NPC27408
0.5175	Remote Similarity	NPC142142
0.5135	Remote Similarity	NPC65003
0.5135	Remote Similarity	NPC210073
0.513	Remote Similarity	NPC475382
0.5089	Remote Similarity	NPC122809
0.5089	Remote Similarity	NPC204693
0.5088	Remote Similarity	NPC483707

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488088 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5044
0.1-0.2	4056
0.2-0.3	42
0.3-0.4	5
0.4-0.5	2
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5495	Remote Similarity	NPD7054	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data