NPASS Compound

Natural Product: NPC487386

Natural Product ID	NPC487386
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JJAQRKNMYZIVJG-UUZPQXLNSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0002106] Anthracyclines

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 100106 0 0 0 0 0 0 0 0999 V2000 2.5236 -0.6591 -5.0907 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2641 0.4366 -4.0891 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5115 0.8077 -3.3033 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0003 -0.4142 -2.5699 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9152 -0.0045 -1.4839 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4732 1.0080 -0.6714 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0780 1.4582 -1.0002 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1963 1.9989 -2.3951 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4413 2.1340 -0.0360 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2535 1.4967 0.3199 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5179 0.5419 1.5039 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2574 -0.3246 1.4999 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8641 0.5893 2.1126 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5546 2.0076 1.7340 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9048 2.7814 1.5555 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1853 2.2207 0.6167 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0062 0.2023 1.5735 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8542 -0.7010 2.0469 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0770 -0.2339 2.8150 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2174 -1.1107 2.2236 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3830 -0.5697 0.7682 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0934 -0.8947 0.1110 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3708 -1.9618 -0.9623 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2201 -1.5558 1.0201 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4732 -1.0903 0.1424 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5658 -0.2246 0.1467 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9787 0.2983 -1.1918 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4975 0.1312 -1.3836 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8385 -1.3502 -1.2550 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9546 -1.9735 -0.1825 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6366 -3.0845 0.5419 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6242 -0.9260 0.6994 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1534 -1.4378 -0.8232 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1133 -0.5703 0.2083 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2380 1.4966 0.3472 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5036 0.9972 0.6212 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9664 -0.0540 -0.2180 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2785 -0.6199 0.0494 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7274 -1.5415 -0.6519 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1259 -0.1226 1.1608 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3767 -0.6368 1.4272 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1880 -0.1906 2.4419 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7190 0.8212 3.2260 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4759 1.3622 2.9940 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6531 0.9013 1.9558 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3426 1.4648 1.6914 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9243 2.4087 2.4396 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0405 2.3965 3.8230 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1672 -0.5308 -1.2476 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6361 -1.5690 -2.0666 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7385 2.5418 1.1502 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4919 1.1820 -4.2032 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5514 -1.0379 -5.4793 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0961 -0.2088 -5.9347 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1065 -1.4952 -4.6425 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4569 0.1578 -3.3715 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8597 1.3141 -4.6615 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5448 -1.0392 -3.3274 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1893 -1.0825 -2.2050 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4757 0.4797 -1.1870 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2543 2.4255 -2.7321 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0326 2.7145 -2.4240 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0671 0.7347 -0.5159 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3744 -0.0893 1.3886 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5603 1.1677 2.4059 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4558 -1.1715 2.1477 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6709 0.4162 3.1921 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0547 2.5328 2.5750 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5060 2.2309 0.7924 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3795 2.8031 2.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7331 3.7902 1.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3115 -1.2936 2.8349 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3628 0.7888 2.6072 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0105 -0.5415 3.8604 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1124 -0.8838 2.7971 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8683 -2.1272 2.2470 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4752 0.5350 0.9567 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5749 -0.0502 -0.3624 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6079 -2.9023 -0.3812 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5325 -2.0884 -1.6440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3176 -1.6899 -1.4496 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3518 0.6637 0.8174 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4185 -0.0641 -2.0516 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8264 1.4187 -1.1950 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7847 0.4999 -2.3716 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0537 0.6774 -0.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7576 -1.8378 -2.2346 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0696 -2.3582 -0.7001 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0596 -4.0326 0.4166 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7881 -2.8652 1.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6301 -3.2782 0.1132 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3588 -0.6281 -0.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4590 -1.1737 -0.2884 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7359 -1.4589 0.7874 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1652 -0.6120 2.6259 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3354 1.2131 4.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8492 3.3080 3.3775 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8459 -2.4952 -1.6571 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2739 3.3099 0.6768 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0971 0.4205 -4.4400 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 13 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 21 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 29 33 1 0 12 34 1 0 6 35 1 0 35 36 2 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 40 41 2 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 2 0 45 46 1 0 46 47 2 0 44 48 1 0 37 49 2 0 49 50 1 0 35 51 1 0 3 52 1 6 8 3 1 0 16 10 1 0 24 18 1 0 32 26 1 0 46 36 1 0 49 5 1 0 45 40 1 0 1 53 1 0 1 54 1 0 1 55 1 0 2 56 1 0 2 57 1 0 4 58 1 0 4 59 1 0 7 60 1 6 8 61 1 0 8 62 1 0 10 63 1 6 11 64 1 0 11 65 1 0 12 66 1 1 13 67 1 1 14 68 1 1 15 69 1 0 15 70 1 0 15 71 1 0 18 72 1 1 19 73 1 0 19 74 1 0 20 75 1 0 20 76 1 0 21 77 1 1 22 78 1 6 23 79 1 0 23 80 1 0 23 81 1 0 26 82 1 1 27 83 1 0 27 84 1 0 28 85 1 0 28 86 1 0 29 87 1 6 30 88 1 6 31 89 1 0 31 90 1 0 31 91 1 0 33 92 1 0 34 93 1 0 41 94 1 0 42 95 1 0 43 96 1 0 48 97 1 0 50 98 1 0 51 99 1 0 52100 1 0 M END

Standard InCHIKey	JJAQRKNMYZIVJG-UUZPQXLNSA-N
Standard InCHI	InChI=1S/C38H48O14/c1-5-38(46)14-20-30(36(45)32-31(34(20)43)33(42)19-7-6-8-22(40)29(19)35(32)44)25(15-38)51-28-13-23(41)37(18(4)49-28)52-27-12-10-24(17(3)48-27)50-26-11-9-21(39)16(2)47-26/h6-8,16-18,21,23-28,37,39-41,43,45-46H,5,9-15H2,1-4H3/t16-,17-,18-,21-,23-,24-,25-,26-,27-,28-,37+,38-/m0/s1
SMILES	CC[C@@]1(Cc2c([C@H](C1)O[C@H]1C[C@@H]([C@@H]([C@H](C)O1)O[C@H]1CC[C@@H]([C@H](C)O1)O[C@H]1CC[C@@H]([C@H](C)O1)O)O)c(c1c(C(=O)c3cccc(c3C1=O)O)c2O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	728.3	Volume:	707.88 ? Van der Waals volume.
Dense:	1.029	LogP:	2.928 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.0 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.922 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	41.0
TPSA:	210.9 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	6.0	Rings:	7.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.193	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.54	Fsp³:	0.632
MCE-18:	166.194 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	1
Colloidal aggregators:	0.68	Fluc inhibitor:	0.044 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.351 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.59 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.238	Promiscuous compounds:	0.935

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.642	MDCK Permeability:	-4.952
Pgp-inhibitor:	0.297	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.147	30% Bioavailability (F30%):	0.578
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.997
Plasma Protein Binding (PPB):	92.355%	Volume Distribution (VD):	0.145
Fu:	7.643% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	0.992	BCRP inhibitor:	0.408
BSEP inhibitor:	0.973

ADMET: Metabolism

CYP1A2-inhibitor:	0.992	CYP1A2-substrate:	0.003
CYP2C19-inhibitor:	0.014	CYP2C19-substrate:	0.002
CYP2C9-inhibitor:	0.012	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.031	CYP3A4-substrate:	0.367
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.082
HLM stability:	0.394 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.729

Half-life (T1/2):

4.898

ADMET: Toxicity

hERG Blockers:	0.095	hERG Blockers (10um):	0.267
Human Hepatotoxicity (H-HT):	0.984	Drug-induced Liver Injury (DILI):	0.989
AMES Toxicity:	0.998	Rat Oral Acute Toxicity:	0.981
Maximum Recommended Daily Dose:	0.994	Skin Sensitization:	1.0
Carcinogencity:	0.715	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.983
Drug-induced Neurotoxicity:	0.171	Ototoxicity:	0.994
Hematotoxicity:	0.992	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.988	RPMI-8226 Immunitoxicity:	0.933
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.995
BCF:	0.706 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.631 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.38 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.551 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40642	Streptomyces sp. SCSIO 1666/17C4	Strain	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[29767975]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	6

Activity Type	# Activity
Cell line	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT397	Cell line	NCI-H460	Homo sapiens	IC50	=	5400.0	nM	PMID[29767975]
NPT400	Cell line	MDA-MB-435	Homo sapiens	IC50	=	4200.0	nM	PMID[29767975]
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	>	50000.0	nM	PMID[29767975]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	=	300.0	nM	PMID[29767975]
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	8600.0	nM	PMID[29767975]
NPT2257	Cell line	MCF-10A	Homo sapiens	IC50	=	2200.0	nM	PMID[29767975]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC487386 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16338
0.1-0.2	32831
0.2-0.3	597
0.3-0.4	55
0.4-0.5	22
0.5-0.6	1
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9211	High Similarity	NPC487390
0.7738	Intermediate Similarity	NPC487385
0.7738	Intermediate Similarity	NPC487387
0.7442	Intermediate Similarity	NPC487384
0.7059	Intermediate Similarity	NPC487388
0.7	Intermediate Similarity	NPC487389
0.6957	Remote Similarity	NPC487383
0.6667	Remote Similarity	NPC602774
0.6531	Remote Similarity	NPC484443
0.6452	Remote Similarity	NPC487394
0.6374	Remote Similarity	NPC487395
0.6222	Remote Similarity	NPC487391
0.6222	Remote Similarity	NPC487392
0.6087	Remote Similarity	NPC487393
0.5158	Remote Similarity	NPC603200

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC487386 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4815
0.1-0.2	4287
0.2-0.3	15
0.3-0.4	19
0.4-0.5	12
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5684	Remote Similarity	NPD7699	Phase 2
0.5684	Remote Similarity	NPD7700	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data