NPASS Compound

Natural Product: NPC486504

Natural Product ID	NPC486504
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XIIXGSLOVPMUHO-SYZCISFVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	70692401
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0003297] Organic Polymers [CHEMONTID:0003298] Polypeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 397407 0 0 0 0 0 0 0 0999 V2000 0.8759 12.9732 -2.9723 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3519 12.9030 -2.8470 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9345 14.2916 -2.8477 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9246 12.1883 -1.6821 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6586 10.7678 -1.4428 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3090 10.2760 -1.2123 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9428 9.1672 -1.7897 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2279 10.7698 -0.4585 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0287 11.9870 0.2017 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8544 11.6400 1.4027 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2434 10.1899 1.1959 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9567 9.9993 -0.2686 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1796 10.4770 -1.0138 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3131 10.3428 -0.4031 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.6483 10.6293 -0.7041 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1351 11.9694 -1.0501 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6278 11.9753 -1.3454 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8713 12.9398 0.1135 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3051 9.4833 -1.4732 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7472 8.3895 -1.4192 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.8650 7.0560 -1.8786 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4881 6.4591 -1.7515 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2137 4.8534 -2.4469 S 0 0 0 0 0 0 0 0 0 0 0 0 -4.2526 3.2706 -1.5402 S 0 0 0 0 0 0 0 0 0 0 0 0 -3.2718 2.6033 -0.1494 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8866 1.3584 0.3901 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6541 0.2455 -0.5483 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5392 -0.6475 -0.7506 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.2950 -1.7714 -1.6977 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4974 -2.9673 -0.7636 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6778 -2.7535 0.5192 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8278 -2.9521 -0.3222 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2849 -1.7632 -2.7793 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6268 -2.6867 -3.5632 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1567 -4.0259 -3.6533 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1001 -5.0025 -3.0577 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7019 -5.0907 -3.8732 S 0 0 0 0 0 0 0 0 0 0 0 0 -9.0829 -6.0568 -2.6272 S 0 0 0 0 0 0 0 0 0 0 0 0 -10.1015 -4.9966 -1.6978 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4783 -3.9991 -0.7402 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5303 -4.6627 0.1430 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0721 -4.2953 1.2078 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.9308 -3.4238 2.2351 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0732 -3.4086 3.2495 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2446 -4.7345 3.8520 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5443 -5.1731 4.9793 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7883 -6.4449 5.4490 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6786 -7.2849 4.8705 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3840 -6.8675 3.7635 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1441 -5.5970 3.2887 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6746 -3.7052 3.0613 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0358 -4.6763 3.1133 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1097 -5.6349 3.3883 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8033 -5.1744 3.9510 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1103 -5.6698 4.7591 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.6551 -6.5602 5.6779 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2710 -6.0563 6.1302 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2387 -6.7735 5.9687 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0536 -6.3716 6.3593 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7642 -7.5221 7.1314 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0768 -7.6899 8.4521 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8658 -8.6443 6.3459 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0025 -5.9247 5.3151 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3161 -4.6914 5.3270 N 0 0 0 0 0 0 0 0 0 0 0 0 3.2597 -3.9904 4.4204 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8428 -2.5845 4.1955 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7133 -1.6455 2.9830 S 0 0 0 0 0 0 0 0 0 0 0 0 5.7799 -1.4523 3.2481 S 0 0 0 0 0 0 0 0 0 0 0 0 6.7015 -2.6682 2.2819 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9987 -2.1041 0.8617 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0742 -1.0719 1.0414 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2052 -0.0559 0.2989 N 0 0 0 0 0 0 0 0 0 0 0 0 9.2675 0.9325 0.4788 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6121 0.3256 0.1911 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7630 -0.2798 -1.1860 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6414 1.2871 0.2918 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9623 2.1383 -0.3108 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9217 3.3433 0.0678 N 0 0 0 0 0 0 0 0 0 0 0 0 9.1375 4.0017 1.2822 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6309 4.3943 1.4593 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9508 5.2544 0.2907 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3518 5.7755 0.2245 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3217 4.7213 0.1446 N 0 0 0 0 0 0 0 0 0 0 0 0 14.7037 5.0868 0.0266 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0624 6.2375 -0.4639 N 0 0 0 0 0 0 0 0 0 0 0 0 15.7141 4.1779 0.4327 N 0 0 0 0 0 0 0 0 0 0 0 0 8.2960 5.2403 1.4101 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7576 5.9231 0.5899 N 0 0 0 0 0 0 0 0 0 0 0 0 7.0903 6.7975 -0.1833 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7759 7.3935 -1.4067 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9468 8.2093 -1.0739 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2370 8.5855 0.1047 N 0 0 0 0 0 0 0 0 0 0 0 0 9.7884 8.5977 -2.1442 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7394 6.3239 -0.6243 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7253 7.0064 -0.8968 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5678 8.4628 -0.8712 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1313 8.9661 -2.2036 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3350 9.9273 -2.4619 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6914 8.2660 -3.3072 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6072 4.9272 -0.7485 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1300 5.6514 2.7847 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6677 1.9437 -1.6763 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0073 -1.2259 2.0964 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1506 -3.0502 -0.0689 N 0 0 0 0 0 0 0 0 0 0 0 0 7.4171 -3.8445 -0.9122 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4574 -4.8983 -1.4506 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6292 -6.1619 -0.6273 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0242 -6.6961 -0.6876 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5572 -7.1326 -1.0269 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6055 -5.1449 -2.8309 N 0 0 0 0 0 0 0 0 0 0 0 0 6.5128 -4.2905 -3.8021 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6784 -4.6282 -5.1980 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8711 -3.4668 -6.1585 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6615 -4.1550 -7.4863 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0720 -5.5390 -7.1961 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6861 -5.4416 -5.8396 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5467 -5.9367 -5.1948 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3540 -5.4544 -4.0654 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5989 -6.9358 -5.7332 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3949 -8.1736 -6.2126 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5188 -9.1797 -6.8394 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8829 -10.2783 -6.3148 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1519 -10.8875 -7.2856 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2734 -10.2235 -8.4353 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7529 -10.4305 -9.6968 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0633 -9.5766 -10.7355 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9153 -8.5121 -10.4761 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4323 -8.3063 -9.2213 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1125 -9.1618 -8.1844 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4450 -6.6851 -6.3558 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4400 -5.9392 -6.4884 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4542 -6.3056 -7.4737 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8035 -5.7189 -8.8593 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3530 -6.2894 -9.6676 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4224 -6.6268 -8.6454 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9121 -5.9764 -7.4225 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7004 -5.2980 -6.5160 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1684 -4.9707 -5.4586 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1394 -4.9415 -6.7137 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2556 -3.6201 -7.4915 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6622 -3.5855 -8.8111 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4572 -3.2834 -9.0247 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4206 -3.8917 -9.9468 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7300 -4.5872 -5.4296 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.9258 -4.3890 -5.1195 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9648 -4.4855 -6.0010 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3611 -4.8287 -5.6712 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2425 -2.9854 -3.3881 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7067 -3.8751 -1.4933 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4614 -3.8012 5.4542 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0783 -3.7729 6.5922 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0075 -3.7011 7.9290 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2600 -3.0989 8.5864 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0770 -3.1123 10.0437 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2462 -2.1130 10.8293 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6803 -4.3546 10.5961 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7443 -3.1816 8.5168 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0055 -2.3012 7.9364 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7724 -1.7586 8.4426 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9835 -0.5451 9.3704 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8848 -0.8436 10.5351 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6049 0.4841 8.6234 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0406 -1.2293 7.2639 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5538 -1.0489 6.1974 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4101 -0.9486 7.3390 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3183 -1.3194 8.4475 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1450 -0.0711 8.5930 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0933 0.6214 7.2502 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2345 -0.3289 6.3664 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6031 0.4784 5.3179 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1825 0.5481 4.1569 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3899 -0.1092 3.8233 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9508 0.2378 2.5050 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3425 1.0132 1.6994 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1887 -0.2689 2.0757 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4358 1.1582 5.5126 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3255 -3.6602 9.7602 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6821 -3.7053 4.9060 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4995 -6.8472 4.3822 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2958 -4.8011 6.6943 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2923 -3.9285 3.4143 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2688 -2.5472 3.8693 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0618 -5.9465 -0.3143 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2591 -2.7745 -1.3699 N 0 0 0 0 0 0 0 0 0 0 0 0 -9.0692 -1.5979 -0.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2148 -0.3680 -1.4996 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6148 -0.3113 -2.1114 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7795 -1.3034 -3.1955 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5644 -0.3385 -1.1004 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1591 0.8301 -0.6597 N 0 0 0 0 0 0 0 0 0 0 0 0 -8.9573 2.0018 -1.1473 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9143 3.2082 -0.2602 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9354 4.2128 -0.7630 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3368 3.6102 -0.7422 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3392 4.5946 -1.2214 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0636 5.7173 -1.5650 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.7044 4.1257 -1.2532 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6176 3.7759 -0.2000 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.1433 4.2850 0.9197 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8428 4.8892 1.0963 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2598 5.6296 0.0611 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7664 6.3316 -0.8672 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1328 6.4677 -0.9735 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0173 4.2174 2.0401 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7641 2.2368 -2.4915 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9667 -0.5235 -2.9966 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4549 0.1678 -1.2226 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4654 9.6449 -2.1921 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1671 11.0228 -2.2591 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4783 13.7599 -2.3153 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6412 13.3180 -4.0312 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3714 11.9984 -2.9065 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7497 12.3968 -3.7721 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4507 14.9297 -2.0776 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9403 14.7779 -3.8470 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0026 14.1994 -2.5329 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8202 12.7785 -0.7223 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0684 12.2849 -1.8261 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2504 10.4896 -0.4996 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9029 12.5707 0.5146 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5577 12.6718 -0.4890 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7278 12.3061 1.4977 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2290 11.6955 2.3053 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2831 9.9633 1.4646 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5126 9.5432 1.7513 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7878 8.9097 -0.4913 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1884 10.4333 0.3499 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6366 12.3892 -1.9142 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1621 11.2387 -0.7477 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7713 11.9061 -2.4191 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9980 12.9804 -0.9884 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8147 13.3184 0.5394 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3115 12.3619 0.8788 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2024 13.7417 -0.2462 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2877 6.8858 -2.8590 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7110 7.1422 -2.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2003 6.4264 -0.6631 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1199 3.4083 0.5828 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2577 2.3867 -0.6044 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9928 1.5694 0.4747 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2888 -1.7554 -2.0551 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1610 -3.8861 -1.1641 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3558 -2.7690 1.4091 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9384 -3.5584 0.6881 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1011 -1.8244 0.4934 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4056 -2.8243 -1.1375 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1134 -4.1113 -3.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6314 -6.0482 -3.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1412 -5.0289 -1.9555 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8621 -4.4185 -2.3373 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7927 -5.6285 -1.0227 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4018 -3.7343 -0.0126 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8127 -2.3821 1.9239 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0032 -3.1135 2.7270 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8258 -2.6672 3.9999 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8573 -4.5084 5.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2500 -6.8149 6.3326 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8691 -8.2949 5.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0985 -7.5334 3.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7206 -5.2928 2.3952 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5008 -6.4303 4.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8341 -6.2663 2.4770 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5600 -7.6244 5.3274 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3008 -6.5523 6.6075 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9952 -5.5663 7.1468 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8272 -7.1349 7.2683 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6856 -8.7225 8.5465 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2902 -6.9367 8.6494 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8215 -7.5532 9.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7539 -8.7346 5.9039 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5295 -4.5787 3.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7924 -2.0285 5.1967 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7527 -2.6733 3.8383 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6175 -2.9742 2.7684 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9927 -3.5163 2.0793 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0554 -1.4878 0.6608 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3090 1.2776 1.5451 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8713 -0.5247 0.9052 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5742 -1.3503 -1.0842 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0518 0.1063 -1.9150 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8293 -0.1672 -1.5123 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4377 0.9040 0.7315 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8691 3.3581 2.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2049 3.4997 1.5558 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6956 5.0164 2.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2373 6.0936 0.2945 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7112 4.6342 -0.6293 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4357 6.4627 -0.6841 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5657 6.4382 1.0924 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0876 3.7141 0.1770 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3847 6.9436 -0.7849 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6638 3.7772 1.3818 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4491 3.9633 -0.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8794 7.7807 0.4437 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0746 8.0127 -2.0178 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0483 6.5438 -2.0917 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1020 9.1793 0.2564 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4699 9.3152 -1.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8075 8.6612 -0.0869 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5142 8.8840 -0.5210 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1747 8.1897 -4.1743 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7826 4.5582 -1.2524 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4079 6.3654 2.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9604 2.5996 -2.4000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3073 -0.4111 2.6709 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4558 -4.4833 -1.2459 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4069 -5.8787 0.4416 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9579 -7.8228 -0.7216 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6155 -6.4919 0.2435 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6041 -6.3761 -1.5456 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6044 -6.6568 -1.3403 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2973 -7.8749 -0.2329 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9213 -7.6993 -1.9138 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6461 -5.2695 -5.2998 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9175 -3.1116 -5.9795 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1596 -2.6776 -5.9449 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5954 -4.2074 -8.0594 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9090 -3.5761 -8.0582 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9372 -6.2606 -7.2962 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2792 -5.7336 -7.9387 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2291 -7.4230 -4.6755 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1789 -7.7940 -6.8680 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9308 -8.6465 -5.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9440 -10.6264 -5.2999 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5831 -11.7448 -7.1415 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0778 -11.2714 -9.9210 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6539 -9.7486 -11.7237 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1553 -7.8525 -11.3095 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0952 -7.4902 -9.0561 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4492 -7.4585 -7.6220 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7464 -4.6400 -8.7512 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7687 -6.0695 -9.2175 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7187 -5.6456 -10.4560 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0047 -7.2636 -10.0863 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5028 -7.7318 -8.4881 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3814 -6.2962 -8.9662 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6524 -5.7704 -7.1705 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7070 -2.8697 -6.8480 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2963 -3.3044 -7.5208 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1079 -3.6325 -10.8790 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9005 -5.0952 -6.7737 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4608 -4.9404 -4.6445 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7578 -2.8179 -2.4888 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1535 -2.9910 -1.7782 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0814 -4.8062 8.3346 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1320 -3.7471 8.3562 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4193 -2.0427 8.2556 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1195 -2.1735 11.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2871 -4.4154 11.5221 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1237 -2.4751 8.9453 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0124 -0.2163 9.7759 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3798 -1.5614 11.2179 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8846 -1.0934 10.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8975 0.1331 11.1251 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1032 0.6456 7.7799 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9965 -2.1474 8.0570 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7940 -1.6363 9.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6709 0.5656 9.3815 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2198 -0.2647 8.8318 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4479 1.5351 7.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0775 0.7845 6.8191 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9125 -1.1086 5.9545 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2737 -1.2350 3.9015 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2175 0.0724 4.5772 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8845 0.2130 1.5814 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2243 1.1873 4.7188 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3170 -3.6752 9.9665 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4482 -3.3564 5.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1242 -6.5620 3.6220 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6460 -4.5080 7.3773 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2980 -3.8681 3.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5589 -2.7208 4.5599 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2405 -6.2959 0.1564 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5403 -2.8753 -2.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8768 -1.5396 0.1567 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0607 -1.4777 -0.1402 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4884 -0.2869 -2.2881 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7026 0.7192 -2.5939 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4398 -2.1380 -2.8528 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8613 -1.6212 -3.6954 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3929 -0.8799 -4.0842 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7068 -1.2449 -0.7639 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2687 2.8483 0.7432 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7058 4.5230 -1.8222 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9067 5.1551 -0.1906 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3053 2.7051 -1.3595 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5924 3.3504 0.3000 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3763 4.8930 -1.2905 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8421 5.5651 2.0381 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1672 4.0581 1.4837 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6822 6.6303 -0.1186 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0095 4.4336 1.9228 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2373 1.5465 -3.0440 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3937 -0.3698 -3.9173 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3918 -0.0888 -2.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2758 9.0312 -2.0225 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4647 11.9635 -2.4384 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 3 14 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 15 19 1 0 19 20 2 3 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 3 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 29 33 1 0 33 34 2 3 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 3 42 43 1 0 43 44 1 0 44 45 1 0 45 46 2 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 43 51 1 0 51 52 2 3 52 53 1 0 53 54 1 0 54 55 2 3 55 56 1 0 56 57 1 0 57 58 2 3 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 59 63 1 0 63 64 2 3 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 2 3 72 73 1 0 73 74 1 0 74 75 1 0 74 76 1 0 73 77 1 0 77 78 2 3 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 2 3 84 86 1 0 79 87 1 0 87 88 2 3 88 89 1 0 89 90 1 0 90 91 1 0 91 92 2 3 91 93 1 0 89 94 1 0 94 95 2 3 95 96 1 0 96 97 1 0 97 98 2 3 97 99 1 0 94100 1 0 87101 1 0 77102 1 0 71103 1 0 70104 1 0 104105 2 3 105106 1 0 106107 1 0 107108 1 0 107109 1 0 106110 1 0 110111 2 3 111112 1 0 112113 1 0 113114 1 0 114115 1 0 115116 1 0 116117 1 0 117118 2 0 117119 1 0 119120 1 0 120121 1 0 121122 2 0 122123 1 0 123124 1 0 124125 2 0 125126 1 0 126127 2 0 127128 1 0 128129 2 0 119130 1 0 130131 2 3 131132 1 0 132133 1 0 133134 1 0 134135 1 0 135136 1 0 136137 1 0 137138 2 0 137139 1 0 139140 1 0 140141 1 0 141142 2 0 141143 1 0 139144 1 0 144145 2 3 145146 1 0 131147 1 0 111148 1 0 105149 1 0 65150 1 0 150151 2 3 151152 1 0 152153 1 0 153154 1 0 154155 2 3 154156 1 0 152157 1 0 157158 2 3 158159 1 0 159160 1 0 160161 1 0 160162 1 0 159163 1 0 163164 2 0 163165 1 0 165166 1 0 166167 1 0 167168 1 0 168169 1 0 169170 1 0 170171 2 3 171172 1 0 172173 1 0 173174 2 3 173175 1 0 170176 1 0 157177 1 0 150178 1 0 63179 1 0 57180 1 0 54181 1 0 51182 1 0 41183 1 0 40184 1 0 184185 1 0 185186 1 0 186187 1 0 187188 1 0 187189 1 0 186190 1 0 190191 2 3 191192 1 0 192193 1 0 193194 1 0 194195 1 0 195196 2 0 195197 1 0 192198 1 0 198199 2 3 199200 1 0 200201 1 0 201202 2 3 202203 1 0 199204 1 0 191205 1 0 33206 1 0 27207 1 0 19208 1 0 13209 1 0 98 5 1 0 116112 1 0 129121 1 0 136132 1 0 169165 1 0 12 8 1 0 202 21 1 0 174 26 1 0 145 35 1 0 50 45 1 0 129124 1 0 1210 1 0 1211 1 0 1212 1 0 2213 1 0 3214 1 0 3215 1 0 3216 1 0 4217 1 0 4218 1 0 5219 1 1 9220 1 0 9221 1 0 10222 1 0 10223 1 0 11224 1 0 11225 1 0 12226 1 1 15227 1 1 16228 1 0 17229 1 0 17230 1 0 17231 1 0 18232 1 0 18233 1 0 18234 1 0 21235 1 6 22236 1 0 22237 1 0 25238 1 0 25239 1 0 26240 1 1 29241 1 6 30242 1 6 31243 1 0 31244 1 0 31245 1 0 32246 1 0 35247 1 1 36248 1 0 36249 1 0 39250 1 0 39251 1 0 40252 1 1 43253 1 6 44254 1 0 44255 1 0 46256 1 0 47257 1 0 48258 1 0 49259 1 0 50260 1 0 53261 1 0 53262 1 0 56263 1 0 56264 1 0 59265 1 1 60266 1 1 61267 1 0 61268 1 0 61269 1 0 62270 1 0 65271 1 6 66272 1 0 66273 1 0 69274 1 0 69275 1 0 70276 1 6 73277 1 1 74278 1 1 75279 1 0 75280 1 0 75281 1 0 76282 1 0 79283 1 1 80284 1 0 80285 1 0 81286 1 0 81287 1 0 82288 1 0 82289 1 0 83290 1 0 85291 1 0 86292 1 0 86293 1 0 89294 1 1 90295 1 0 90296 1 0 92297 1 0 93298 1 0 96299 1 0 96300 1 0 99301 1 0 100302 1 0 101303 1 0 102304 1 0 103305 1 0 106306 1 6 107307 1 0 108308 1 0 108309 1 0 108310 1 0 109311 1 0 109312 1 0 109313 1 0 112314 1 1 113315 1 0 113316 1 0 114317 1 0 114318 1 0 115319 1 0 115320 1 0 119321 1 1 120322 1 0 120323 1 0 122324 1 0 123325 1 0 125326 1 0 126327 1 0 127328 1 0 128329 1 0 132330 1 6 133331 1 0 133332 1 0 134333 1 0 134334 1 0 135335 1 0 135336 1 0 139337 1 6 140338 1 0 140339 1 0 143340 1 0 146341 1 0 147342 1 0 148343 1 0 149344 1 0 152345 1 1 153346 1 0 153347 1 0 155348 1 0 156349 1 0 159350 1 1 160351 1 1 161352 1 0 161353 1 0 161354 1 0 162355 1 0 166356 1 0 166357 1 0 167358 1 0 167359 1 0 168360 1 0 168361 1 0 169362 1 6 172363 1 0 172364 1 0 175365 1 0 176366 1 0 177367 1 0 178368 1 0 179369 1 0 180370 1 0 181371 1 0 182372 1 0 183373 1 0 184374 1 0 185375 1 0 185376 1 0 186377 1 6 187378 1 6 188379 1 0 188380 1 0 188381 1 0 189382 1 0 192383 1 1 193384 1 0 193385 1 0 194386 1 0 194387 1 0 197388 1 0 200389 1 0 200390 1 0 203391 1 0 204392 1 0 205393 1 0 206394 1 0 207395 1 0 208396 1 0 209397 1 0 M END

Standard InCHIKey	XIIXGSLOVPMUHO-SYZCISFVSA-N
Standard InCHI	InChI=1S/C127H188N36O40S6/c1-57(2)38-74-123(200)161-35-20-29-86(161)116(193)155-97(58(3)4)118(195)150-79-52-205-206-53-80-112(189)157-101(63(10)167)122(199)153-82-55-207-204-51-78(134-45-77(60(7)164)149-107(184)70(31-32-95(176)177)140-91(172)48-138-105(79)182)109(186)144-71(39-65-22-13-12-14-23-65)103(180)136-46-90(171)135-47-94(175)154-99(61(8)165)120(197)152-81(110(187)146-73(42-89(129)170)108(185)159-102(64(11)168)126(203)163-37-18-27-84(163)114(191)139-50-93(174)142-80)54-208-209-56-83(113(190)158-100(62(9)166)121(198)143-69(26-17-33-132-127(130)131)106(183)145-72(41-88(128)169)104(181)137-49-92(173)141-74)151-119(196)98(59(5)6)156-117(194)87-30-21-36-162(87)124(201)75(40-66-44-133-68-25-16-15-24-67(66)68)148-115(192)85-28-19-34-160(85)125(202)76(43-96(178)179)147-111(82)188/h12-16,22-25,44,57-64,69-87,97-102,133-134,164-168H,17-21,26-43,45-56H2,1-11H3,(H2,128,169)(H2,129,170)(H,135,171)(H,136,180)(H,137,181)(H,138,182)(H,139,191)(H,140,172)(H,141,173)(H,142,174)(H,143,198)(H,144,186)(H,145,183)(H,146,187)(H,147,188)(H,148,192)(H,149,184)(H,150,195)(H,151,196)(H,152,197)(H,153,199)(H,154,175)(H,155,193)(H,156,194)(H,157,189)(H,158,190)(H,159,185)(H,176,177)(H,178,179)(H4,130,131,132)/t60-,61-,62-,63-,64-,69+,70+,71+,72+,73+,74+,75+,76+,77+,78+,79+,80+,81+,82+,83+,84+,85+,86+,87+,97+,98+,99+,100+,101+,102+/m1/s1
SMILES	CC(C)C[C@H]1C(=O)N2CCC[C@H]2C(=N[C@@H](C(C)C)C(=N[C@H]2CSSC[C@H]3C(=N[C@@H]([C@@H](C)O)C(=N[C@H]4CSSC[C@@H](C(=N[C@@H](Cc5ccccc5)C(=NCC(=NCC(=N[C@@H]([C@@H](C)O)C(=N[C@@H](CSSC[C@@H](C(=N[C@@H]([C@@H](C)O)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](CC(=N)O)C(=NCC(=N1)O)O)O)O)O)N=C([C@H](C(C)C)N=C([C@@H]1CCCN1C(=O)[C@H](Cc1c[nH]c5ccccc15)N=C([C@@H]1CCCN1C(=O)[C@H](CC(=O)O)N=C4O)O)O)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H]([C@@H](C)O)C(=O)N1CCC[C@H]1C(=NCC(=N3)O)O)O)O)O)O)O)O)O)NC[C@@H]([C@@H](C)O)N=C([C@H](CCC(=O)O)N=C(CN=C2O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	3049.21	Volume:	2861.477 ? Van der Waals volume.
Dense:	1.066	LogP:	-8.886 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-4.873 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.766 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	27.0	Rigid Bonds:	146.0
TPSA:	1249.62 ? Topological Polar Surface Area.	H-Bond Acceptor:	76.0
H-Bond Donor:	42.0	Rings:	11.0
Heavy Atoms:	82.0

MedChem Properties

QED Drug-Likeness Score:	0.012	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	9.891	Fsp³:	0.622
MCE-18:	375.379 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.333	Fluc inhibitor:	0.354 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.33 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.337 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.715	Promiscuous compounds:	0.212

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.098	MDCK Permeability:	-5.492
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.853
Plasma Protein Binding (PPB):	-29.14%	Volume Distribution (VD):	-0.968
Fu:	159.424% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.219

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-4.28

Half-life (T1/2):

11.181

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.0	Rat Oral Acute Toxicity:	0.093
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.998	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.22
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.966	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.0
BCF:	-0.321 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.001 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.601 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.189 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30114	Viola abyssinica	Species	Violaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21434649]
NPO30114	Viola abyssinica	Species	Violaceae	Eukaryota	n.a.	aerial part	n.a.	PMID[21434649]
NPO30114	Viola abyssinica	Species	Violaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT5192	Cell line	U-937/GTB	Homo sapiens	IC50	=	2600.0	nM	PMID[21434649]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486504 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	33143
0.1-0.2	15722
0.2-0.3	763
0.3-0.4	144
0.4-0.5	52
0.5-0.6	24
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7614	Intermediate Similarity	NPC486508
0.75	Intermediate Similarity	NPC486503
0.7444	Intermediate Similarity	NPC485125
0.7128	Intermediate Similarity	NPC329847
0.7016	Intermediate Similarity	NPC329855
0.68	Remote Similarity	NPC479083
0.665	Remote Similarity	NPC479082
0.63	Remote Similarity	NPC485244
0.6198	Remote Similarity	NPC485243
0.6027	Remote Similarity	NPC480594
0.5959	Remote Similarity	NPC485245
0.595	Remote Similarity	NPC486515
0.5907	Remote Similarity	NPC485246
0.5891	Remote Similarity	NPC486506
0.5891	Remote Similarity	NPC485247
0.5891	Remote Similarity	NPC486514
0.5871	Remote Similarity	NPC477635
0.5829	Remote Similarity	NPC486517
0.5592	Remote Similarity	NPC329843
0.5472	Remote Similarity	NPC477634
0.5427	Remote Similarity	NPC477632
0.5425	Remote Similarity	NPC477633
0.5381	Remote Similarity	NPC486513
0.5377	Remote Similarity	NPC486507
0.5363	Remote Similarity	NPC485124
0.53	Remote Similarity	NPC484963
0.5297	Remote Similarity	NPC489512
0.5286	Remote Similarity	NPC479872
0.5245	Remote Similarity	NPC484964
0.5238	Remote Similarity	NPC489511
0.5238	Remote Similarity	NPC484965
0.5198	Remote Similarity	NPC486505
0.5116	Remote Similarity	NPC489216
0.5074	Remote Similarity	NPC485115

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486504 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4726
0.1-0.2	4277
0.2-0.3	130
0.3-0.4	13
0.4-0.5	4
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data