NPASS Compound

Natural Product: NPC485925

Natural Product ID	NPC485925
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YTSNCONBEYHKDS-ATPAGDLWSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11061745
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000279] Alkaloids and derivatives [CHEMONTID:0002755] Aspidospermatan-type alkaloids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 106117 0 0 0 0 0 0 0 0999 V2000 -2.8926 -3.9117 -1.0944 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6087 -2.4727 -0.8985 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6825 -1.9849 0.5441 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1028 -2.2537 1.0242 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0539 -1.6338 0.0370 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7418 -0.3873 -0.3098 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5854 0.3041 0.2444 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9832 0.8014 1.6619 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6853 0.8498 2.3613 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7374 0.0410 1.6291 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0266 -0.7791 2.5155 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4336 -0.8758 2.3076 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4055 -0.0423 1.7980 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7379 -0.4305 1.7447 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1286 -1.6595 2.1951 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1651 -2.5176 2.7153 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8426 -2.1009 2.7571 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2802 -2.7874 3.2316 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4508 -2.1839 2.6523 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7315 -2.7930 1.3285 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2295 -4.0871 1.5126 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5449 -1.8713 1.9660 N 0 0 0 0 0 0 0 0 0 0 0 0 5.0054 -0.6881 1.3305 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1638 -0.3558 0.7696 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3299 1.0182 0.1634 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1085 1.2067 -0.7273 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1085 0.0901 -1.7690 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2969 0.0621 -2.6504 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2663 2.4896 -1.4623 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2921 3.4967 -1.3845 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0528 3.2540 -0.5944 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2227 2.2952 0.4290 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9286 2.7531 1.5914 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2283 1.4562 2.3064 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9495 0.3282 1.3273 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8237 1.0462 0.0342 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5128 3.6759 -0.7824 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2300 -1.3256 0.7568 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3200 -0.9612 0.2105 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1255 -2.5845 1.2903 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2520 -3.4404 1.2123 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3647 -0.5095 0.4807 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4599 1.5018 -0.6134 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6262 2.5181 -0.6823 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7967 3.5949 -1.6750 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9868 4.5544 -1.7299 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9241 3.5355 -2.6003 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7624 2.5203 -2.5337 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5753 1.4444 -1.5416 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3040 0.3867 -1.3277 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.8323 2.4749 -3.4152 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0969 1.3900 -4.2760 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1128 4.5580 -3.5574 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2200 5.4231 -3.2656 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1877 -2.3699 -0.4521 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4044 -3.5662 -0.0567 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0822 -1.8482 -1.3484 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1876 -2.5669 -1.8252 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8846 -4.0674 -2.2204 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8631 -4.2850 -0.7777 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1035 -4.6075 -0.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5603 -2.2943 -1.2844 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2500 -1.8823 -1.5568 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3555 -1.9332 2.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2051 -3.3781 0.9826 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8045 0.2671 2.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3326 1.8607 1.4969 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2886 1.8980 2.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7710 0.4913 3.4157 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1205 -0.3279 3.5575 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0968 0.9189 1.4432 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4830 -3.4928 3.0743 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2470 -2.3554 3.4069 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7344 -2.8721 0.7982 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8146 -4.1800 2.2799 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0544 -2.7350 2.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4944 1.8016 0.8871 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2301 0.9526 -0.4648 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1830 0.2093 -2.3708 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0031 -0.9029 -1.2810 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0894 0.7804 -2.4602 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7817 -0.9338 -2.7306 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9567 0.2759 -3.7084 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8873 2.4206 -2.4062 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1224 4.1771 -2.2670 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6166 4.1623 -0.1712 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2941 2.8346 -1.3202 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7907 3.3882 1.4112 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1987 3.3708 2.1755 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1924 1.4042 2.8014 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4612 1.3541 3.1361 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0523 0.5104 -0.5823 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8907 -4.4854 1.1863 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8561 -3.1529 0.3339 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8809 -3.3425 2.1435 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6710 -0.3514 -0.3714 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7866 2.5956 -0.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0175 1.6153 -4.8475 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2752 0.5006 -3.6178 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2311 1.1299 -4.9055 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3365 6.2103 -4.0347 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1719 4.8549 -3.2393 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0464 5.8176 -2.2483 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4068 -3.4395 -1.1777 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1125 -1.9380 -1.8511 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9840 -2.9271 -2.8485 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 3 2 1 6 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 1 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 15 22 1 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 6 27 28 1 0 26 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 35 34 1 1 35 36 1 0 30 37 1 0 24 38 1 0 38 39 2 0 38 40 1 0 40 41 1 0 10 42 1 0 7 43 1 0 43 44 2 0 44 45 1 0 45 46 2 0 45 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 48 51 1 0 51 52 1 0 47 53 1 0 53 54 1 0 5 55 1 0 55 56 2 0 55 57 1 0 57 58 1 0 20 3 1 0 35 23 1 0 49 43 1 0 42 3 1 0 50 6 1 0 42 7 1 0 19 11 1 0 36 26 1 0 17 12 1 0 37 29 1 0 35 14 1 0 36 32 1 0 1 59 1 0 1 60 1 0 1 61 1 0 2 62 1 0 2 63 1 0 4 64 1 0 4 65 1 0 8 66 1 0 8 67 1 0 9 68 1 0 9 69 1 0 11 70 1 1 13 71 1 0 16 72 1 0 19 73 1 1 20 74 1 6 21 75 1 0 22 76 1 0 25 77 1 0 25 78 1 0 27 79 1 0 27 80 1 0 28 81 1 0 28 82 1 0 28 83 1 0 29 84 1 6 30 85 1 6 31 86 1 0 31 87 1 0 33 88 1 0 33 89 1 0 34 90 1 0 34 91 1 0 36 92 1 6 41 93 1 0 41 94 1 0 41 95 1 0 42 96 1 6 44 97 1 0 52 98 1 0 52 99 1 0 52100 1 0 54101 1 0 54102 1 0 54103 1 0 58104 1 0 58105 1 0 58106 1 0 M END

Standard InCHIKey	YTSNCONBEYHKDS-ATPAGDLWSA-N
Standard InCHI	InChI=1S/C44H48N4O10/c1-7-41-16-20(37(51)55-5)34-44(23-14-25(49)30(53-3)31(54-4)28(23)46-34)10-12-48(40(41)44)29-19-13-22-24(15-26(19)57-32(29)35(41)50)45-33-21(38(52)56-6)17-42(8-2)36-27(58-36)18-47-11-9-43(22,33)39(42)47/h13-15,27,29,32,35-36,39-40,45,50H,7-12,16-18H2,1-6H3/t27-,29-,32+,35-,36-,39+,40+,41-,42-,43+,44+/m1/s1
SMILES	CC[C@@]12CC(=C3[C@]4(CCN([C@@H]5c6cc7c(cc6O[C@@H]5[C@H]1O)NC1=C(C[C@]5(CC)[C@H]6[C@@H](CN8CC[C@]71[C@H]58)O6)C(=O)OC)[C@@H]24)C1=CC(=O)C(=C(C1=N3)OC)OC)C(=O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	792.34	Volume:	769.791 ? Van der Waals volume.
Dense:	1.029	LogP:	1.629 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.991 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.545 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	54.0
TPSA:	160.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	2.0	Rings:	12.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.246	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.131	Fsp³:	0.591
MCE-18:	325.029 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	1
Colloidal aggregators:	0.93	Fluc inhibitor:	0.203 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.745 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.858 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.002	Promiscuous compounds:	0.132

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.769	MDCK Permeability:	-5.122
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	0.012 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.924	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.621	MRP1:	1.0
Plasma Protein Binding (PPB):	96.668%	Volume Distribution (VD):	0.346
Fu:	2.829% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.513
OATP1B3 inhibitor:	0.257	BCRP inhibitor:	0.012
BSEP inhibitor:	0.686

ADMET: Metabolism

CYP1A2-inhibitor:	0.811	CYP1A2-substrate:	0.035
CYP2C19-inhibitor:	0.999	CYP2C19-substrate:	0.013
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.381
CYP2D6-inhibitor:	0.003	CYP2D6-substrate:	0.846
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.813 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.001

Half-life (T1/2):

1.686

ADMET: Toxicity

hERG Blockers:	0.074	hERG Blockers (10um):	0.144
Human Hepatotoxicity (H-HT):	0.945	Drug-induced Liver Injury (DILI):	0.963
AMES Toxicity:	0.98	Rat Oral Acute Toxicity:	0.787
Maximum Recommended Daily Dose:	0.985	Skin Sensitization:	1.0
Carcinogencity:	0.796	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.877
Drug-induced Neurotoxicity:	0.855	Ototoxicity:	0.968
Hematotoxicity:	0.991	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.247
A549 Cytotoxicity:	0.87	Hek293 Cytotoxicity:	0.907
BCF:	0.866 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.073 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.809 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.298 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18778099]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18778099]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	Leaves	n.a.	n.a.	PMID[24773071]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	stem-bark	Pahang, Malaysia	2003-JUN	PMID[25919190]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26918761]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27077800]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[29319316]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[30869890]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32356659]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9376	Tabernaemontana corymbosa	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	10

Activity Type	# Activity
Cell line	9
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT306	Cell line	PC-3	Homo sapiens	IC50	=	700.0	nM	PMID[30869890]
NPT858	Cell line	LNCaP	Homo sapiens	IC50	>	10000.0	nM	PMID[30869890]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	300.0	nM	PMID[30869890]
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	=	400.0	nM	PMID[30869890]
NPT81	Cell line	A549	Homo sapiens	IC50	>	10000.0	nM	PMID[30869890]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	=	200.0	nM	PMID[30869890]
NPT139	Cell line	HT-29	Homo sapiens	IC50	=	200.0	nM	PMID[30869890]
NPT22764	Cell line	KB/VJ300	Homo sapiens	IC50	=	8600.0	nM	PMID[30869890]
NPT22764	Cell line	KB/VJ300	Homo sapiens	IC50	=	1500.0	nM	PMID[30869890]
NPT2	Others	Unspecified	n.a.	IC50	=	100.0	nM	PMID[30869890]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC485925 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22474
0.1-0.2	27223
0.2-0.3	89
0.3-0.4	55
0.4-0.5	4
0.5-0.6	7
0.6-0.7	3
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.875	High Similarity	NPC74025
0.8115	Intermediate Similarity	NPC485926
0.8115	Intermediate Similarity	NPC485929
0.6842	Remote Similarity	NPC485927
0.6308	Remote Similarity	NPC485924
0.6212	Remote Similarity	NPC144228
0.5971	Remote Similarity	NPC485923
0.5254	Remote Similarity	NPC195636
0.5147	Remote Similarity	NPC469722
0.5124	Remote Similarity	NPC476069
0.5041	Remote Similarity	NPC19175
0.5035	Remote Similarity	NPC485931
0.5034	Remote Similarity	NPC485930

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC485925 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5604
0.1-0.2	3531
0.2-0.3	15
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data