NPASS Compound

Natural Product: NPC482254

Natural Product ID	NPC482254
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HNELXDSUOMBXGM-AISMXQSVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	134148309
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 102104 0 0 0 0 0 0 0 0999 V2000 -1.3357 -4.1452 2.5072 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8400 -2.9900 1.6065 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9027 -1.9622 1.6150 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6375 -1.6495 0.5228 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7068 -0.6329 0.4963 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7520 -1.1419 -0.4778 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4231 -0.6934 1.8573 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2637 0.7465 0.2758 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6674 1.1627 -1.0040 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4913 0.3766 -1.5308 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3378 0.2654 -0.6054 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1590 1.2275 0.2447 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5833 -0.8402 -0.8173 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5191 -1.3811 0.0957 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9038 -0.7504 -0.0576 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7469 -1.4448 0.9891 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3995 -0.4299 1.8816 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8145 -2.3047 1.7428 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4240 -1.5759 1.5414 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4844 -2.6005 2.0319 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9239 -3.2703 3.0150 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5395 -0.4681 2.3332 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4973 -0.3656 3.6670 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3367 -1.3152 4.4514 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6552 1.0014 4.2826 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7036 -2.1938 0.2466 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6667 -2.9735 0.8164 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7015 -3.0267 2.0874 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6630 -3.7531 -0.0002 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9484 0.6120 0.1791 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3782 1.5522 -0.7464 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7393 1.1111 -1.8664 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4155 2.9796 -0.4495 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8537 3.8339 -1.4436 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9121 5.1887 -1.1942 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5301 5.6356 0.0393 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0819 4.7924 1.0643 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0384 3.4440 0.7735 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0713 -1.9556 -1.4737 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1725 -2.3598 -2.7446 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0270 -1.7425 -3.4323 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4914 -3.5026 -3.4369 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0376 1.0701 -2.7374 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2390 0.6222 -3.9957 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8474 -0.4321 -4.2169 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7431 1.3681 -5.1967 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6534 1.1594 -2.0537 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0455 2.2548 -2.7555 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5222 3.3640 -2.4819 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0796 2.0772 -3.8164 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3414 1.6424 0.6372 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2653 2.4672 1.7228 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2140 2.4326 2.4166 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3382 3.4148 2.1558 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8502 -3.6466 3.3485 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4571 -4.7073 2.8641 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0780 -4.7654 1.9894 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8374 -3.5041 0.5911 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1101 -1.4273 2.5348 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4553 -2.2029 -0.3994 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2972 -1.3914 -1.4805 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0778 -2.1234 -0.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6398 -0.5175 -0.5469 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3923 -0.1519 1.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6137 -1.7376 2.1578 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7494 -0.2372 2.6059 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5054 0.9378 1.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3604 2.2146 -0.9486 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9017 -0.5561 -1.9317 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8657 2.1029 0.2546 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5963 1.3757 0.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2373 -0.4708 -1.7420 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7692 -2.4736 -0.2835 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2759 -0.9165 -1.0949 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8952 0.5594 1.8450 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3879 -0.7606 2.9532 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4629 -0.2120 1.5721 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6775 -3.3196 1.2967 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9950 -2.3399 2.8326 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3983 0.9907 5.3454 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0281 1.6856 3.6662 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7110 1.3358 4.0848 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5624 -3.8937 0.5959 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9302 -3.1702 -0.9135 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1800 -4.6784 -0.3682 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1561 3.4631 -2.4257 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2438 5.9052 -1.9307 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5528 6.6949 0.3024 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7897 5.1641 2.0166 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6899 2.7667 1.5621 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4601 -3.7666 -2.9700 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1590 -4.3883 -3.3129 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6489 -3.2705 -4.5158 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0853 0.8244 -5.6999 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6305 1.4448 -5.8832 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3914 2.3645 -4.9353 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5382 1.6065 -4.6861 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4668 3.0389 -4.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8251 1.3502 -3.4916 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5046 3.2913 3.2547 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3076 3.1685 1.6642 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0729 4.4422 1.8854 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 5 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 19 22 1 1 22 23 1 0 23 24 2 0 23 25 1 0 16 26 1 6 26 27 1 0 27 28 2 0 27 29 1 0 15 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 2 0 34 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 13 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 10 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 9 47 1 0 47 48 1 0 48 49 2 0 48 50 1 0 8 51 1 0 51 52 1 0 52 53 2 0 52 54 1 0 20 2 1 0 38 33 1 0 19 14 1 0 1 55 1 0 1 56 1 0 1 57 1 0 2 58 1 6 3 59 1 0 4 60 1 0 6 61 1 0 6 62 1 0 6 63 1 0 7 64 1 0 7 65 1 0 7 66 1 0 8 67 1 1 9 68 1 1 10 69 1 6 12 70 1 0 12 71 1 0 13 72 1 6 14 73 1 6 15 74 1 6 17 75 1 0 17 76 1 0 17 77 1 0 18 78 1 0 18 79 1 0 25 80 1 0 25 81 1 0 25 82 1 0 29 83 1 0 29 84 1 0 29 85 1 0 34 86 1 0 35 87 1 0 36 88 1 0 37 89 1 0 38 90 1 0 42 91 1 0 42 92 1 0 42 93 1 0 46 94 1 0 46 95 1 0 46 96 1 0 50 97 1 0 50 98 1 0 50 99 1 0 54100 1 0 54101 1 0 54102 1 0 M END

Standard InCHIKey	HNELXDSUOMBXGM-AISMXQSVSA-N
Standard InCHI	InChI=1S/C39H48O15/c1-20-17-18-37(9,10)35(51-25(6)43)32(50-24(5)42)31(49-23(4)41)21(2)30(48-22(3)40)29-34(52-36(47)28-15-13-12-14-16-28)38(11,53-26(7)44)19-39(29,33(20)46)54-27(8)45/h12-18,20,29-32,34-35H,2,19H2,1,3-11H3/b18-17+/t20-,29-,30-,31-,32+,34+,35+,38+,39+/m0/s1
SMILES	C[C@H]1/C=C/C(C)(C)[C@@H]([C@@H]([C@H](C(=C)[C@@H]([C@H]2[C@H]([C@@](C)(C[C@@]2(C1=O)OC(=O)C)OC(=O)C)OC(=O)c1ccccc1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	756.3	Volume:	755.01 ? Van der Waals volume.
Dense:	1.002	LogP:	2.667 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.889 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.461 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	31.0
TPSA:	201.17 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	0.0	Rings:	3.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.21	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.822	Fsp³:	0.538
MCE-18:	117.833 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.656	Fluc inhibitor:	0.007 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.277	Promiscuous compounds:	0.044

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.127	MDCK Permeability:	-4.667
Pgp-inhibitor:	1.0	Pgp-substrate:	0.092
PAMPA:	0.129 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.996	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	91.761%	Volume Distribution (VD):	-0.339
Fu:	7.536% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.668
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.063
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.445

Half-life (T1/2):

0.567

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.031
Human Hepatotoxicity (H-HT):	0.372	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.544	Rat Oral Acute Toxicity:	0.174
Maximum Recommended Daily Dose:	0.122	Skin Sensitization:	0.992
Carcinogencity:	0.468	Eye Corrosion:	0.002
Eye Irritation:	0.128	Respiratory Toxicity:	0.012
Drug-induced Neurotoxicity:	0.122	Ototoxicity:	0.233
Hematotoxicity:	0.622	Drug-induced Nephrotoxicity:	0.805
Genotoxicity:	0.999	RPMI-8226 Immunitoxicity:	0.049
A549 Cytotoxicity:	0.311	Hek293 Cytotoxicity:	0.163
BCF:	0.642 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.567 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.436 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.038 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21612217]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[21612217]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27447736]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32233482]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO3099	Euphorbia esula	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	5000.0	nM	PMID[27447736]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482254 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	13713
0.1-0.2	34039
0.2-0.3	1637
0.3-0.4	380
0.4-0.5	38
0.5-0.6	30
0.6-0.7	8
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8873	High Similarity	NPC285221
0.8472	Intermediate Similarity	NPC194769
0.8243	Intermediate Similarity	NPC475660
0.75	Intermediate Similarity	NPC475262
0.7391	Intermediate Similarity	NPC482404
0.7051	Intermediate Similarity	NPC265459
0.7051	Intermediate Similarity	NPC290833
0.7051	Intermediate Similarity	NPC482304
0.7051	Intermediate Similarity	NPC482265
0.6962	Remote Similarity	NPC482248
0.6707	Remote Similarity	NPC482253
0.6625	Remote Similarity	NPC482249
0.6543	Remote Similarity	NPC482251
0.6463	Remote Similarity	NPC482267
0.6447	Remote Similarity	NPC471757
0.642	Remote Similarity	NPC272523
0.6092	Remote Similarity	NPC482250
0.5976	Remote Similarity	NPC325805
0.5955	Remote Similarity	NPC482154
0.5889	Remote Similarity	NPC482258
0.5814	Remote Similarity	NPC482255
0.5714	Remote Similarity	NPC482266
0.5714	Remote Similarity	NPC482300
0.5698	Remote Similarity	NPC482268
0.5647	Remote Similarity	NPC482247
0.5529	Remote Similarity	NPC86772
0.5529	Remote Similarity	NPC482315
0.5517	Remote Similarity	NPC482269
0.5506	Remote Similarity	NPC40919
0.5455	Remote Similarity	NPC482263
0.5368	Remote Similarity	NPC482260
0.5349	Remote Similarity	NPC482314
0.5287	Remote Similarity	NPC482270
0.5281	Remote Similarity	NPC482252
0.5256	Remote Similarity	NPC78127
0.5233	Remote Similarity	NPC482308
0.5222	Remote Similarity	NPC482201
0.5217	Remote Similarity	NPC482155
0.5213	Remote Similarity	NPC470189
0.5169	Remote Similarity	NPC472247
0.5169	Remote Similarity	NPC482359
0.5169	Remote Similarity	NPC482272
0.5161	Remote Similarity	NPC482204
0.5114	Remote Similarity	NPC82467
0.5109	Remote Similarity	NPC319556
0.5109	Remote Similarity	NPC482202
0.5056	Remote Similarity	NPC482311

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482254 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3962
0.1-0.2	5101
0.2-0.3	87
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data