NPASS Compound

Natural Product: NPC482185

Natural Product ID	NPC482185
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	CVNNJVBDNRVAAL-BPOUFJLISA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	90645373
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 86 90 0 0 0 0 0 0 0 0999 V2000 1.6368 -1.0492 -2.0968 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8385 -0.6586 -0.9201 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3765 -0.3789 0.2313 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8613 -0.4444 0.3729 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5566 -1.6923 0.7711 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2202 -1.4031 2.0909 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5255 -2.0980 2.2805 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3132 0.1001 2.1910 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3105 0.6758 1.1965 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3488 1.6622 1.6514 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7919 1.4449 2.7325 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0190 2.8787 0.9173 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6262 3.9136 1.9974 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8109 2.7513 -0.0333 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4155 2.4107 0.6493 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2395 1.3040 0.6824 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3084 -0.0044 0.1277 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6583 -0.5294 -1.0852 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0326 -1.9314 -1.1255 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6228 -2.5301 -2.1956 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8701 -1.8508 -3.2251 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9987 -3.9667 -2.2175 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7203 -0.2562 -0.1087 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4411 -1.2143 0.5376 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8629 -1.9317 1.3924 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8841 -1.4764 0.3007 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5068 -0.5534 -0.7542 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3839 -2.8855 0.2389 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7863 -1.9426 1.3482 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3415 -2.3399 2.7168 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6945 2.5506 -0.0820 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8660 2.3764 -1.5558 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7466 3.4620 0.5125 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7757 4.0507 -0.6775 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0898 4.3061 -1.9607 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4444 3.3691 -2.6703 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0153 5.6731 -2.5175 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5977 0.6211 -0.1397 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4030 -2.2344 -0.1891 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2247 -3.4836 -0.7446 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2451 -4.1500 -0.3524 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1241 -4.0567 -1.7632 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7023 -0.6935 -2.0218 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6168 -2.1467 -2.2976 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2600 -0.5685 -3.0414 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8481 -0.0991 1.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7532 -2.4631 0.9695 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5506 -1.7236 2.9413 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6229 -2.5328 3.3194 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3937 -1.4063 2.1892 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6369 -2.9919 1.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3357 0.4842 2.0111 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0095 0.4819 3.1885 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8656 3.3292 0.3799 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1632 3.4107 2.8688 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5927 4.3175 2.3635 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0543 4.7394 1.5805 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1096 2.1310 -0.8576 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4125 3.0389 1.6355 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9110 1.2526 1.6446 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0602 -0.7741 0.9247 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9582 -0.1564 -2.0528 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1197 -4.0010 -2.1248 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6700 -4.4400 -3.1668 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5303 -4.4351 -1.3223 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4817 0.4966 -0.3988 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9974 -0.6702 -1.7340 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5700 -0.8227 -0.9308 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1326 -3.1577 -0.5286 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6388 -3.6586 0.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8642 -1.6288 1.3063 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4846 -3.0364 2.7269 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1470 -1.4182 3.3197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1838 -2.8617 3.2141 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3857 3.2611 -2.0139 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6156 1.5399 -1.6916 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9638 2.2238 -2.1385 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7725 3.3745 1.6314 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6320 4.4944 0.1776 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7400 3.0706 0.1640 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6982 6.3483 -1.9545 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2214 5.7155 -3.5913 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0234 6.0465 -2.2826 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5907 -4.9892 -1.4016 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9234 -3.3322 -2.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5704 -4.2370 -2.7300 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 17 23 1 0 23 24 1 0 24 25 2 0 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 16 31 1 0 31 32 1 0 31 33 1 0 14 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 9 38 1 6 5 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 18 2 1 0 29 26 1 0 9 4 1 0 31 15 1 0 4 38 1 6 1 43 1 0 1 44 1 0 1 45 1 0 3 46 1 0 5 47 1 1 6 48 1 1 7 49 1 0 7 50 1 0 7 51 1 0 8 52 1 0 8 53 1 0 12 54 1 6 13 55 1 0 13 56 1 0 13 57 1 0 14 58 1 6 15 59 1 1 16 60 1 1 17 61 1 1 18 62 1 6 22 63 1 0 22 64 1 0 22 65 1 0 27 66 1 0 27 67 1 0 27 68 1 0 28 69 1 0 28 70 1 0 29 71 1 1 30 72 1 0 30 73 1 0 30 74 1 0 32 75 1 0 32 76 1 0 32 77 1 0 33 78 1 0 33 79 1 0 33 80 1 0 37 81 1 0 37 82 1 0 37 83 1 0 42 84 1 0 42 85 1 0 42 86 1 0 M END

Standard InCHIKey	CVNNJVBDNRVAAL-BPOUFJLISA-N
Standard InCHI	InChI=1S/C32H44O10/c1-14-11-32-27(40-20(7)35)15(2)12-31(32,42-32)26(36)17(4)24(39-19(6)34)21-22(29(21,8)9)25(23(14)38-18(5)33)41-28(37)30(10)13-16(30)3/h11,15-17,21-25,27H,12-13H2,1-10H3/b14-11+/t15-,16+,17+,21-,22+,23+,24-,25+,27-,30-,31-,32-/m0/s1
SMILES	C/C/1=C[C@]23[C@H]([C@@H](C)C[C@@]2(C(=O)[C@H](C)[C@@H]([C@@H]2[C@H]([C@H]([C@@H]1OC(=O)C)OC(=O)[C@@]1(C)C[C@H]1C)C2(C)C)OC(=O)C)O3)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	588.29	Volume:	591.329 ? Van der Waals volume.
Dense:	0.995	LogP:	2.576 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.986 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.555 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	27.0
TPSA:	134.8 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	0.0	Rings:	5.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.202	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.089	Fsp³:	0.781
MCE-18:	106.105 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.85	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.333	Promiscuous compounds:	0.704

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.157	MDCK Permeability:	-4.799
Pgp-inhibitor:	1.0	Pgp-substrate:	0.197
PAMPA:	0.708 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.072
20% Bioavailability (F20%):	0.98	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.997
Plasma Protein Binding (PPB):	75.588%	Volume Distribution (VD):	0.053
Fu:	22.704% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.992	BCRP inhibitor:	0.0
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.007
CYP2C19-inhibitor:	0.009	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.002	CYP2C9-substrate:	0.986
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.326
CYP3A4-inhibitor:	0.157	CYP3A4-substrate:	0.276
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.994 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

8.545

Half-life (T1/2):

0.623

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.101
Human Hepatotoxicity (H-HT):	0.612	Drug-induced Liver Injury (DILI):	0.889
AMES Toxicity:	0.841	Rat Oral Acute Toxicity:	0.34
Maximum Recommended Daily Dose:	0.179	Skin Sensitization:	0.993
Carcinogencity:	0.663	Eye Corrosion:	0.026
Eye Irritation:	0.221	Respiratory Toxicity:	0.503
Drug-induced Neurotoxicity:	0.084	Ototoxicity:	0.447
Hematotoxicity:	0.961	Drug-induced Nephrotoxicity:	0.897
Genotoxicity:	0.987	RPMI-8226 Immunitoxicity:	0.134
A549 Cytotoxicity:	0.181	Hek293 Cytotoxicity:	0.187
BCF:	0.568 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.543 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.104 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.611 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11858748]
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24840014]
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	Stems	n.a.	n.a.	PMID[31180680]
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO10031	Euphorbia antiquorum	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Individual protein	1
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT178	Individual protein	Protein-tyrosine phosphatase 1B	Homo sapiens	IC50	<	10000.0	nM	PMID[24840014]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	<	10000.0	nM	PMID[24840014]
NPT81	Cell line	A549	Homo sapiens	IC50	<	10000.0	nM	PMID[24840014]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482185 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22250
0.1-0.2	26513
0.2-0.3	1048
0.3-0.4	4
0.4-0.5	13
0.5-0.6	11
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9298	High Similarity	NPC482184
0.8814	High Similarity	NPC482179
0.7742	Intermediate Similarity	NPC475277
0.7742	Intermediate Similarity	NPC475495
0.7742	Intermediate Similarity	NPC482193
0.746	Intermediate Similarity	NPC482178
0.746	Intermediate Similarity	NPC482177
0.746	Intermediate Similarity	NPC477093
0.7344	Intermediate Similarity	NPC482192
0.7164	Intermediate Similarity	NPC473522
0.7015	Intermediate Similarity	NPC482180
0.6761	Remote Similarity	NPC29922
0.6528	Remote Similarity	NPC477096
0.6316	Remote Similarity	NPC482402
0.6234	Remote Similarity	NPC482400
0.6212	Remote Similarity	NPC479266
0.6143	Remote Similarity	NPC482176
0.6087	Remote Similarity	NPC81761
0.6081	Remote Similarity	NPC477095
0.5972	Remote Similarity	NPC482174
0.5897	Remote Similarity	NPC477094
0.5857	Remote Similarity	NPC482186
0.5857	Remote Similarity	NPC482191
0.5857	Remote Similarity	NPC189556
0.5857	Remote Similarity	NPC477092
0.5429	Remote Similarity	NPC482187
0.5349	Remote Similarity	NPC482195
0.5309	Remote Similarity	NPC482175
0.5195	Remote Similarity	NPC475305
0.5068	Remote Similarity	NPC475401

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482185 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6938
0.1-0.2	2189
0.2-0.3	23
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data