NPASS Compound

Natural Product: NPC482153

Natural Product ID	NPC482153
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DQOWHTFHFLRPDX-OYEOFKBISA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0002877] Jatrophane and cyclojatrophane diterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 92 94 0 0 0 0 0 0 0 0999 V2000 -3.0334 3.3645 2.5179 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7326 2.0673 2.8132 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7102 1.6995 4.2591 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1650 0.9923 1.9463 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6435 0.0160 2.5381 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2061 1.0584 0.5681 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6565 0.0359 -0.2844 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7130 0.6902 -1.2172 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4868 1.2208 -0.5798 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3333 2.5388 -0.5775 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5814 0.4175 0.0593 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1959 -0.6080 -0.8222 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5828 -0.1248 -1.3199 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2031 -1.3736 -1.8816 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7280 -1.2400 -1.9265 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7893 -2.4203 -0.8689 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5922 -1.8644 -0.1290 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5885 -2.8203 0.2865 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2521 -3.6089 -0.5972 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3483 -4.5773 -1.5430 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3073 -2.8253 -1.3184 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5656 -2.7624 -0.9760 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5959 -1.9743 -1.7001 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8846 -2.8213 -1.6111 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3803 -1.7193 -3.1252 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7694 -0.7352 -0.8529 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9094 -0.3833 -0.6375 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2373 -3.7369 1.1671 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1680 -1.4081 1.1029 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3448 0.3955 -0.2772 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8636 1.6891 -0.3675 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6083 2.3306 -1.4121 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6609 2.2881 0.6778 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9670 1.6217 1.8456 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7197 2.1675 2.8491 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1916 3.4635 2.6633 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9055 4.1558 1.5121 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1441 3.5663 0.5287 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1477 -0.0124 1.3166 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6931 0.4545 2.5098 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6157 1.3084 2.4235 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2849 0.0357 3.8572 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3748 1.7454 -1.8788 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5288 1.9091 -3.2222 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0406 1.0557 -3.9896 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2768 3.1051 -3.7233 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7472 4.2139 2.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6896 3.3850 1.4453 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1901 3.5824 3.2055 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8177 2.1475 2.5149 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3725 0.8000 4.3807 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2230 2.5098 4.8191 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6997 1.4944 4.6491 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1529 -0.7001 0.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4137 0.0117 -2.0775 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5213 3.0049 -0.1393 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0855 3.2060 -1.0307 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4203 1.1583 0.2878 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6612 -0.7381 -1.7857 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4604 0.5859 -2.1616 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8315 -1.6218 -2.8932 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0481 -1.1231 -0.8522 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0412 -0.3620 -2.4903 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1600 -2.1975 -2.2640 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6800 -2.5856 -0.2211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6062 -3.4056 -1.3368 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1152 -2.2851 0.9990 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8721 -4.2661 0.1045 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4819 -5.2866 -1.8553 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1027 -5.2474 -1.0898 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6649 -4.1351 -2.5124 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0105 -2.2833 -2.2082 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8805 -3.3213 -0.1036 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1405 -3.0255 -0.5641 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7111 -2.3057 -2.1514 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6620 -3.7417 -2.1894 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3725 -1.6272 -3.5107 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9762 -0.7915 -3.3966 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8780 -2.5061 -3.7787 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4845 -4.2601 1.5697 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6423 -2.1588 1.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6045 0.5980 2.0131 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9773 1.6733 3.7742 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7911 3.9337 3.4322 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2962 5.1609 1.4175 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9338 4.1214 -0.3577 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3101 0.8864 4.2959 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3457 -0.8688 3.8778 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1560 -0.0757 4.5539 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9396 3.4555 -2.9080 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6075 3.8768 -4.1253 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9842 2.7368 -4.5221 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 21 22 2 0 22 23 1 0 23 24 1 0 23 25 1 0 23 26 1 0 26 27 2 0 18 28 1 0 17 29 1 1 13 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 2 0 34 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 11 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 8 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 26 7 1 0 38 33 1 0 17 12 1 0 1 47 1 0 1 48 1 0 1 49 1 0 2 50 1 0 3 51 1 0 3 52 1 0 3 53 1 0 7 54 1 1 8 55 1 6 10 56 1 0 10 57 1 0 11 58 1 1 12 59 1 6 13 60 1 6 14 61 1 6 15 62 1 0 15 63 1 0 15 64 1 0 16 65 1 0 16 66 1 0 18 67 1 1 19 68 1 1 20 69 1 0 20 70 1 0 20 71 1 0 21 72 1 0 22 73 1 0 24 74 1 0 24 75 1 0 24 76 1 0 25 77 1 0 25 78 1 0 25 79 1 0 28 80 1 0 29 81 1 0 34 82 1 0 35 83 1 0 36 84 1 0 37 85 1 0 38 86 1 0 42 87 1 0 42 88 1 0 42 89 1 0 46 90 1 0 46 91 1 0 46 92 1 0 M END

Standard InCHIKey	DQOWHTFHFLRPDX-OYEOFKBISA-N
Standard InCHI	InChI=1S/C35H46O11/c1-18(2)32(40)46-29-28(44-23(7)37)21(5)27(43-22(6)36)25-26(45-33(41)24-13-11-10-12-14-24)20(4)17-35(25,42)30(38)19(3)15-16-34(8,9)31(29)39/h10-16,18-20,25-30,38,42H,5,17H2,1-4,6-9H3/b16-15+/t19-,20+,25-,26+,27-,28+,29-,30-,35-/m1/s1
SMILES	CC(C)C(=O)O[C@@H]1[C@H](C(=C)[C@H]([C@H]2[C@H]([C@@H](C)C[C@@]2([C@@H]([C@H](C)/C=C/C(C)(C)C1=O)O)O)OC(=O)c1ccccc1)OC(=O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	642.3	Volume:	658.574 ? Van der Waals volume.
Dense:	0.975	LogP:	3.187 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.207 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.556 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	28.0
TPSA:	162.73 ? Topological Polar Surface Area.	H-Bond Acceptor:	11.0
H-Bond Donor:	2.0	Rings:	3.0
Heavy Atoms:	11.0

MedChem Properties

QED Drug-Likeness Score:	0.264	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.652	Fsp³:	0.571
MCE-18:	105.4 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.848	Fluc inhibitor:	0.005 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.008 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.199	Promiscuous compounds:	0.172

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.349	MDCK Permeability:	-4.899
Pgp-inhibitor:	1.0	Pgp-substrate:	0.018
PAMPA:	0.352 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.996	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	94.939%	Volume Distribution (VD):	-0.05
Fu:	5.625% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.001
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.039
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.002
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.047
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.247
CYP3A4-inhibitor:	0.975	CYP3A4-substrate:	0.882
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.996 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.459

Half-life (T1/2):

0.694

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.1
Human Hepatotoxicity (H-HT):	0.566	Drug-induced Liver Injury (DILI):	0.972
AMES Toxicity:	0.456	Rat Oral Acute Toxicity:	0.045
Maximum Recommended Daily Dose:	0.104	Skin Sensitization:	0.991
Carcinogencity:	0.281	Eye Corrosion:	0.001
Eye Irritation:	0.2	Respiratory Toxicity:	0.086
Drug-induced Neurotoxicity:	0.435	Ototoxicity:	0.651
Hematotoxicity:	0.558	Drug-induced Nephrotoxicity:	0.928
Genotoxicity:	0.979	RPMI-8226 Immunitoxicity:	0.149
A549 Cytotoxicity:	0.648	Hek293 Cytotoxicity:	0.393
BCF:	0.728 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.701 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.71 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.172 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21749	Euphorbia spp.	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28106996]
NPO21749	Euphorbia spp.	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21749	Euphorbia spp.	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
MIC80	3
Ratio	8

Activity Type	# Activity
Others	5
Organism	7

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC80	=	792000.0	nM	PMID[28106996]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC80	=	710000.0	nM	PMID[28106996]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC80	=	679000.0	nM	PMID[28106996]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	Ratio	=	0.9	n.a.	PMID[28106996]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	Ratio	=	0.85	n.a.	PMID[28106996]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	Ratio	=	1.0	n.a.	PMID[28106996]
NPT2	Others	Unspecified	n.a.	Activity	=	74.0	%	PMID[28106996]
NPT2	Others	Unspecified	n.a.	Ratio	=	1.0	n.a.	PMID[28106996]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482153 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8147
0.1-0.2	37629
0.2-0.3	3453
0.3-0.4	499
0.4-0.5	105
0.5-0.6	13
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7671	Intermediate Similarity	NPC473497
0.6962	Remote Similarity	NPC474303
0.6835	Remote Similarity	NPC482303
0.6835	Remote Similarity	NPC482311
0.6625	Remote Similarity	NPC482316
0.6543	Remote Similarity	NPC482312
0.6463	Remote Similarity	NPC475413
0.6173	Remote Similarity	NPC482300
0.6125	Remote Similarity	NPC482313
0.6098	Remote Similarity	NPC482309
0.5783	Remote Similarity	NPC482315
0.5765	Remote Similarity	NPC482272
0.5595	Remote Similarity	NPC86772
0.5595	Remote Similarity	NPC482266
0.5595	Remote Similarity	NPC482314
0.5309	Remote Similarity	NPC604476
0.5294	Remote Similarity	NPC482352
0.5294	Remote Similarity	NPC243595
0.5172	Remote Similarity	NPC272523
0.5172	Remote Similarity	NPC601407
0.5057	Remote Similarity	NPC611479
0.5056	Remote Similarity	NPC482310
0.5056	Remote Similarity	NPC482302

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482153 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3109
0.1-0.2	5861
0.2-0.3	175
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data